A solution contains 2.2 x 10^-4 M Ag+ and 1.3 x 10^-3 M Pb^2+.
If NaI is added, will AgI (Ksp = 8.3 x 10^-17) or PbI2 (Ksp = 7.9 x 10^-9) precipitate first?
Specify the concentration of I- needed to begin precipitation.

Answers

Answer 1

The concentration of I- needed to begin precipitation will be [I⁻] = 3.77 x 10⁻¹³ M and (I)⁻² = 6.07 x 10⁻⁶.

Concentration is termed as the amount of a substance in a defined space.

2.2 x 10⁻⁴ M Ag⁺ (1)

1.3 x 10⁻³ M Pb₂⁺ (2)

1) Ag⁺ + NaI  →  AgI + Na⁺ (Ksp = 8.3 x 10⁻¹⁷)

2) Pb²⁺ + NaI →  PbI₂ + Na+ (Ksp = 7.9 x 10⁻⁹)

Ksp = [Ag⁺] [I⁻] = (2.2 X 10⁻⁴ M) (I⁻)

Ksp = [Pb²⁺] [I]² = (1.3 X 10⁻³M) (I⁻)²

(1) 8.3 X 10⁻¹⁷ = (2.2 X 10⁻⁴M) (I⁻)

(I-) = 3.77 X 10⁻¹³ M

(2) 7.9 X 10⁻⁹ = (1.3 X 10⁻³M) (I⁻)²

6.07 X 10⁻⁶ = (I⁻)²

(I⁻)² = 6.07 X 10⁻⁶

To know more about concentration here

https://brainly.com/question/10725862

#SPJ4


Related Questions

Draw five possible isomers corresponding to the formula C7H16. Please name each isomer.

Answers

Isomers are compounds that have the same molecular formula, meaning they contain the same types and numbers of atoms but differ in their structural arrangement or spatial orientation.

The five possible isomers corresponding to the formula C7H16, along with their names:

1.  Heptane:

    CH3-CH2-CH2-CH2-CH2-CH2-CH3

2. 2-Methylhexane:

    CH3-CH2-CH(CH3)-CH2-CH2-CH3

3. 3-Methylhexane:

    CH3-CH2-CH2-CH(CH3)-CH2-CH3

4. 2,2-Dimethylpentane:

    CH3-C(CH3)2-CH2-CH2-CH3

5. 2,3-Dimethylpentane:

    CH3-CH(CH3)-CH(CH3)-CH2-CH3

Learn more about isomers  here ;

https://brainly.com/question/27860606

#SPJ11

which molecule or ion in the following list has the greatest number of unshared electron pairs around the central atom

Answers

The molecule or ion with the greatest number of unshared electron pairs around the central atom is XeF₄ (xenon tetrafluoride).

To determine the number of unshared electron pairs around the central atom in a molecule or ion, we need to consider its Lewis structure. In the Lewis structure, we represent the valence electrons as dots or lines around the atoms.

XeF₄ has a central xenon atom (Xe) surrounded by four fluorine atoms (F). Xenon has 8 valence electrons, and each fluorine atom has 7 valence electrons.

When we draw the Lewis structure for XeF₄, we place one fluorine atom on each side of the xenon atom, and we connect them with single bonds (represented by lines).

The remaining 4 valence electrons of xenon are placed as unshared electron pairs (represented by dots) around the xenon atom.

The Lewis structure of XeF₄ is as follows:

 F     F

  \   /

   Xe

  /   \

 F     F

In this structure, xenon has 4 unshared electron pairs (dots) around it. Therefore, XeF₄ has the greatest number of unshared electron pairs around the central atom compared to the other molecules or ions in the list.

Conclusion: XeF₄ (xenon tetrafluoride) has the greatest number of unshared electron pairs (4) around the central atom.

To know more about electron pairs, visit,

brainly.com/question/13899233

#SPJ11

Fusion of hydrogen releases energy because O Fusion breaks the electromagnetic bonds between hydrogen atoms, releasing energetic photons. The mass of a helium nucleus is smaller than the mass of four protons The mass of a helium nucleus is larger than the mass of four protons The size of a proton is larger than the size of a helium nucleus None of the above is true. 20 Fusion in the core of a stable massive star cannot proceed beyond iron because It would require temperatures that even stars cannot generatel The fusion of iron nuclei is impossible under any circumstances. Iron nuclei are on top of the binding energy curve so iron fusion does not release energy. It is so massive that a black hole must result 000

Answers

Question 19: The fusion of hydrogen releases energy because the mass of a helium nucleus is smaller than the mass of four protons.Question 20: Fusion in the core of a stable massive star cannot proceed beyond iron because it would require temperatures that even stars cannot generate.

Question 19 addresses the reason why the fusion of hydrogen releases energy. The correct statement is that the mass of a helium nucleus is smaller than the mass of four protons. This mass difference results in the release of energy during fusion reactions. In fusion, hydrogen nuclei (protons) combine to form helium nuclei, and in the process, some mass is converted into energy according to Einstein's famous equation, E=mc^2. This energy is released in the form of photons, which can be observed as light and heat.

Question 20 explains why fusion in the core of a stable massive star cannot proceed beyond iron. The correct statement is that it would require temperatures that even stars cannot generate. Fusion reactions in stars involve the fusion of lighter elements to form heavier elements, releasing energy in the process.

However, fusion reactions that produce elements heavier than iron require extremely high temperatures and pressures, which are not achievable in the core of a stable massive star. Iron has the highest binding energy per nucleon, meaning that fusion of iron nuclei would require an input of energy rather than releasing energy. As a result, fusion reactions cease beyond the formation of iron in the core of a star.

Learn more about photons here:-  brainly.com/question/33017722

#SPJ11

Explain light and waves and the properties of both.

Answers

Answer:

Electromagnetic waves are typically described by any of the following three physical properties: frequency (f), wavelength (λ), or intensity (I). Light quanta are typically described by frequency (f), wavelength (λ), or photon energy (E).

Explanation:

please mark as brainlist

Spring ends on what day?

summer solstice

winter solstice

vernal equinox

autumnal equinox

Answers

Answer:

June 20

Explanation:

How many grams of water should be added to 4.00 g NaOH to create 2.00% by mass NaOH solution?

Answers

Answer:

196 grams

because ^^^ was wrong and person in comments said it was 196 and it was right

When NaOH of 4.00 g is being added with water, the mass of water required to create 2.00% of NaOH solution by mass is 196 g.

What is mass percent of solute?

It means that the particular amount of solute in terms of percentage is present in the solute.

Given the mass of the solute, NaOH is 4.00g

Suppose the mass of water required to add is x in g.

The mass percent of the solute is

\(\dfrac{2}{100} =\dfrac{4.00}{4.00 +x }\)

x =196 g

Therefore, mass of water required to create 2.00% of NaOH solution by mass is 196 g.

Learn more about Mass percent of solute.

https://brainly.com/question/15136748

#SPJ2

when an atom gains an electron it becomes a cation true or false

Answers

Answer: False

Explanation: Gaining an electron which has a negative charge results in an overall negative charge, thus making this an anion, and the answer, false.

Answer:false

Explanation:it becomes a anion

Liquid pentene (C5H10) burns in oxygen gas to form carbon dioxide gas and water vapor. Express your answer as a chemical equation.

Answers

The balanced chemical equation for the combustion of liquid pentene  in oxygen gas to form carbon dioxide gas and water vapor is:

\(C_5H_10 (l) + 8O_2 (g)\) → \(5CO_2 (g) + 5H_2O (g)\)

This equation shows that one molecule of pentene reacts with eight molecules of oxygen gas to produce five molecules of carbon dioxide gas and five molecules of water vapor. The equation is balanced because there are equal numbers of atoms of each element on both sides of the equation.

This combustion reaction is exothermic, which means that it releases heat and light energy. It is also a type of oxidation reaction in which pentene reacts with oxygen gas to form carbon dioxide and water, while the carbon-hydrogen bonds in pentene are broken and replaced by carbon-oxygen and hydrogen-oxygen bonds.

Learn more about here:

https://brainly.com/question/15117038

#SPJ11

a compound with the formula secln has a formula mass of 220.77 amu. what is the value for n in the formula secln?

Answers

Molecular mass/ empirical formula mass = n

Where n is a whole number.

For the above question, n = 2

Explain the above formula.

The above formula is used to calculate the formula mass of a compound.

Where n, that is the answer, should be a whole number or very close to a whole number.

Molecular mass = 220.771 g/mol

Se molecular weight =78.96

Cl molecular weight = 35

The formula mass = 78.96+35.45 = 114.41

Thus, n = 220/114 = 2

Hence value of n=2  

To know more about empirical formula, click on https://brainly.com/question/1439914

#SPJ4

How thick is the Earths crust in kilometers?

Answers

Answer:

The Earth's Crust is like the skin of an apple. It is very thin in comparison to the other three layers. The crust is only about 3-5 miles (8 kilometers) thick under the oceans(oceanic crust) and about 25 miles (32 kilometers) thick under the continents (continental crust).

Explanation:

you butt is thick in kilometers

;)

2 moles of NO, was placed in an empty I dm' bottle and allowed to reach equilibrium according to the equation:
At equilibrium, 1.2 moles of N,O, dissociated. Calculate the value of the equilibrium constant for the reaction at that
temperature.

Answers

The balanced equation for the dissociation of nitrogen monoxide (NO) is:

2NO(g) ⇌ N2(g) + O2(g)

According to the problem statement, 2 moles of NO were placed in a 1 dm^3 bottle and allowed to reach equilibrium, and at equilibrium, 1.2 moles of NO had dissociated. This means that the initial concentration of NO was:

[NO]initial = 2 mol / 1 dm^3 = 2 M

And the concentration of NO at equilibrium is:

[NO]equilibrium = (2 - 1.2) mol / 1 dm^3 = 0.8 M

Since the stoichiometry of the balanced equation is 2:1:1 for NO, N2, and O2, respectively, the equilibrium concentrations of N2 and O2 will also be 0.6 M.

The equilibrium constant (Kc) can be calculated using the equilibrium concentrations of the reactants and products, raised to the power of their stoichiometric coefficients. Therefore:

Kc = ([N2][O2]) / ([NO]^2)

Substituting the equilibrium concentrations into the equation, we get:

Kc = (0.6 M x 0.6 M) / (0.8 M x 0.8 M)
Kc = 0.5625

Therefore, the value of the equilibrium constant for the reaction at that temperature is 0.5625. Note that the units of Kc depend on the stoichiometry of the balanced equation. Since the stoichiometric coefficients are all 1, the units of Kc in this case are M^-1

A uniform, solid disk with a mass of 24. 3 kg and a radius of 0. 314 m is free to rotate about a frictionless axle. Forces of 90 n and 125 n are applied to the disk in the same horizontal direction, but one force is applied to the top and the other is applied to the bottom. What is the magnitude of the angular acceleration of the disk?.

Answers

The magnitude of the angular acceleration of the disk is -203.9 rad/s^2 (negative sign is indicating the direction of angular acceleration is opposite to the direction of applied forces).

The magnitude of the angular acceleration of the disk can be determined by using the equation for torque:

τ = Iα

where τ is the torque, I is the moment of inertia, and α is the angular acceleration.

The moment of inertia of a solid disk is given by the equation:

I = (1/2) * m * r^2

where m is the mass and r is the radius of the disk.

So we can substitute the values of mass and radius in the equation of the moment of inertia:

I = (1/2) * 24.3 kg * (0.314 m)^2 = 0.03898 kg*m^2

Now we can calculate the torque caused by the forces of 90 n and 125 n. These forces are applied in opposite direction so the net torque caused by them is:

τ = 90 N * 0.314 m - 125 N * 0.314 m = -7.922 Nm

So we can now calculate the angular acceleration using the torque equation:

-7.922 Nm = 0.03898 kgm^2 * α

α = -7.922 Nm / 0.03898 kgm^2 = -203.9 rad/s^2

Therefore, The magnitude of the angular acceleration of the disk is -203.9 rad/s^2 (negative sign is indicating the direction of angular acceleration is opposite to the direction of applied forces).

Learn more about angular acceleration here:

https://brainly.com/question/29428475

#SPJ4

Which of the following elements has the mass spectrum represented above?​

Which of the following elements has the mass spectrum represented above?

Answers

The mass spectrum represented in the image is the mass spectrum of Mo.

A mass spectrum is a graphical representation of the relative abundance of isotopes plotted against their respective masses.

There are seven stable isotopes of Mo which are; Mo 92, Mo 94, Mo 95, Mo 96, Mo 97, Mo 98, Mo 100.

These isotopes are clearly shown in the mass spectrum displayed meaning that the mass spectrum must refer to Mo.

Learn more; https://brainly.com/question/4994855

Which of the following elements has the mass spectrum represented above?

Answer:

Mo

Explanation:

Because College Board says so.

For ___, 2 lobes have positive signs while the other 2 have negative signs, showing that the opposite lobes of have same sign.​

Answers

Answer:d orbitals

Explanation: just trustme

Orbitals are defined as the mathematical function used to identify the probability of an electron of an atom in a specific region. The orbitals are s, p, d, and f.

The correct statement for the given blank is:

For d orbitals, 2 lobes have positive signs while the other 2 have negative signs, showing that the opposite lobes have the same sign.​

D-orbitals have 5 lobes, in which two lobes have positive signs and 2 lobes have negative signs.

The orbitals have positive and negative signs, as they represent the positive displacement of the wave, whereas negative displacement (down) of the wave is represented by the negative sign.

Therefore, the correct answer is d-orbitals.

To know more about orbitals, refer to the following link:

https://brainly.com/question/18914648

Which statement best describes a compound formed by an ionic bond?

A) negatively charged
B) neutral
C) contains multiple charges
D) positively charged​

Answers

Answer is D

Explanation:

Answer:

B. Neutral

Explanation:

When there is a ionic bond,  one element steals or takes away an electron from the other element.

An example is NaCl

In this compound, Chlorine atom steals an extra electron from Sodium to fill its outer shell. So, this is a Ionic bond. Since, the Sodium compound gives away an atom, it is positively charged. Since, Chlorine steals an atom, it is negatively charged. Opposite charges attract, so they become a compound.

When positive and negative mix, it becomes neutral.

compounds y and z both have the formula c9h18. both y and z react with one molar equivalent of hydrogen in the presence of a palladium catalyst to form 2-methyloctane. the heat of hydrogenation of y is less than that of z. y and z each undergo hydroboration/oxidation to give a primary alcohol (oh attached to a primary carbon). what is the structure of y?

Answers

Both molecules can be hydrogenated to produce the same result, and hydroboration and oxidation both produce primary alcohols that are geometric isomers, of which Y is the trans isomer.

Explain about the hydrogenation?

Molecular hydrogen (H2) and another substance or element undergo a chemical reaction known as hydrogenation, typically in the presence of a catalyst such as nickel, palladium, or platinum. The method is frequently used to saturate or decrease organic molecules.

To solidify a liquid oil into a fat. When solid fats with the right consistency are expensive or unavailable, hydrogenation, sometimes in combination with other processes like interesterification or fractionation, may provide a method to synthesize the desired fat.

The FA chains linked to the TAG backbone undergo hydrogenation, a chemical reaction that adds hydrogen to their unsaturated bonds. An unsaturated fat can become a saturated fat in this manner, raising its melting point.

To learn more about hydrogenation refer to:

https://brainly.com/question/12833896

#SPJ1

How many atoms of carbon are needed to produce 0.45 mol of Al?
3C+2Al2O3→4Al+3CO23+2Al2O3→4Al+3CO2
A. 2.6×10262.6×1026 atoms
B. 9.7×10249.7×1024 atoms
C. 3.0×10223.0×1022 atoms
D. 2.0×10232.0×1023 atoms

Answers

The correct answer is option D, which states that 2.0 × 1023 atoms of carbon are needed to produce 0.45 mol of Al.

The number of atoms of carbon required to produce 0.45 mol of aluminium can be calculated using the balanced equation for the reaction between aluminium oxide and carbon, as shown below:

3C + 2Al₂O₃ → 4Al + 3CO₂.

The stoichiometric ratio of carbon to aluminium can be obtained by comparing the coefficients of carbon and aluminium.

The equation indicates that 3 moles of carbon react with 4 moles of aluminum to produce 3 moles of carbon dioxide. As a result, one mole of aluminum reacts with 3/4 moles of carbon and generates 1/3 moles of carbon dioxide.

Therefore, the number of moles of carbon required to generate 0.45 mol of aluminum is as follows:0.45 mol Al × (3/4) mol C / 1 mol Al = 0.3375 mol .One mole of carbon consists of 6.022 × 1023 atoms.

The amount of carbon required in this problem is 0.3375 moles, so the number of atoms of carbon required is:0.3375 mol C × 6.022 × 1023 atoms / mol = 2.03 × 1023 atoms.

Approximately 2.03 × 1023 atoms of carbon are required to generate 0.45 mol of aluminum. Hence, the correct answer is option D, which states that 2.0 × 1023 atoms of carbon are needed to produce 0.45 mol of Al.

To know more about atoms, refer here:

https://brainly.com/question/1566330#

#SPJ11

How can some of the difficulties caused by the Down Syndrome be over come?

Answers

there is no single, standard treatment for down syndrome.

An atom's electron configuration ends with 3p4. if another atom has seven more electrons, what would be the continuation of the electron configuration? 3p63d34s2 3p43d54s2 3p64s23d3 3p44s23d5

Answers

The continuation of the electron configuration is 3p6 4s2 3d3.

Electronic configuration ends up with = 3p4

So, here principle quantum number(n) =3

Atom which ends up with 3p4 configuration = S

Sulphur(s) = [Ne] 3s2 3p4

So atomic number of Sulphur (s) =16

After adding 7e in it -

Atomic number = 16+7 =23

Now atomic no. =23 (after adding 7 more electrons)

So electronic configuration with atomic no. =23

Atomic number (23) - [Ne] 3s2 3p6 4s2 3d3

Now electronic configuration will ends up with= 3d3

Electrons belong to the primary technology of the lepton particle's own family and are typically thought to be fundamental particles because they have no recognized additives  substructure.

For most realistic purposes, an electron is a structureless particle with an intrinsic angular momentum or spin. simply two numbers — the electron's mass and its electric price — gasoline the equations that describe its behavior. From this 'sensible electron' version, physicists constructed present-day microelectronics.

Learn more about electrons here :- https://brainly.com/question/860094

#SPJ4

in the lab we heated auger. Which type of bond did the sugar have

Answers

Sugar is a simple carbohydrate consisting of carbon, oxygen, and hydrogen molecules which are linked by covalent bonds.

What are the chemical covalent bonds?

The chemical covalent bonds are a type of chemical bond in which atoms that differ in their electronegativity share electrons to maintain cohesion i.e., intramolecular cohesion, while sugar molecules may interact by glycosidic bonds.

Therefore, with this data, we can see covalent bonds bind atoms in the sugar molecule while glycosidic bonds are those required to connect different sugar and thus form a complex macromolecule or polysaccharide.

Learn more about chemical covalent bonds here:

https://brainly.com/question/3447218

#SPJ1

no marks. to determine what portion of the question you have correct, check question score at the top of the assignment. indicate which molecule (a or b) in each pair has the higher boiling point. also indicate which force, hydrogen bonding (h), dipolar (p), or dispersion (d) is responsible for the difference.

Answers

Molecule (a or b) in each pair has the higher boiling point also indicate force, hydrogen bonding (h), dipolar (p), or dispersion (d) is responsible for the difference so in NH₃ and PH₃ the a molecule is high melting point and forces are dispersion force and in C₂H₅OH and CH₃OHCH₃ the molecule a has high melting point and has a dispersion force and C₄H₈ and C₁₀H₂₀ the b molecule has high melting point and has a dispersion force and in HCl and F₂ the a molecule has high boiling point and has a dipolar dipole interaction forces

The forces are electrostatic force between oppositely charged ions as in ionic bonds or through the sharing of electrons as in covalent bonds and there are four type of forces

Hydrogen bondingdipole-dipoledispersionIon dipole

So here given molecule in that we have to seen the forces and high melting point so

NH₃ and PH₃ : NH₃ has high melting point than PH₃ and has dispersion forceC₂H₅OH and CH₃OHCH₃ : C₂H₅OH has high melting point than CH₃OHCH₃ and dispersion forceC₄H₈ and C₁₀H₂₀ : C₁₀H₂₀ has high melting point than C₄H₈ and dispersion forceHCl and F₂ : HCl has high boiling point than F₂ and has a dipole interaction

Know more about forces

https://brainly.com/question/14250723

#SPJ1

what are the four nitrogenous bases & how are they related?

Answers

Nitrogenous bases refer to the building blocks of DNA and RNA molecules. They are molecules that contain nitrogen and other elements. Four nitrogenous bases are found in DNA: adenine (A), guanine (G), cytosine (C), and thymine (T).These bases are divided into two categories: purines and pyrimidines.

Purines include adenine (A) and guanine (G), which are two-ringed structures. Pyrimidines include thymine (T) and cytosine (C), which are one-ringed structures. Purines always pair with pyrimidines in DNA, resulting in a consistent diameter for the DNA helix.Nitrogenous bases play a crucial role in encoding genetic information because they are responsible for holding the information in the DNA molecule. They can bind to one another via hydrogen bonding. The number of hydrogen bonds between base pairs determines their strength, which is essential in DNA replication and protein synthesis. For example, the pairing of guanine with cytosine is stronger than the pairing of adenine with thymine. Adenine pairs with thymine, while guanine pairs with cytosine, resulting in complementary base pairing.A single strand of DNA contains four types of nitrogenous bases, and each base has a complementary base. A strand of DNA is always composed of nucleotides, which are made up of a phosphate group, a sugar, and a nitrogenous base. Therefore, the four nitrogenous bases are essential building blocks of DNA molecules.

for more such question on Nitrogenous

https://brainly.com/question/1380409

#SPJ11

solve this 1. entropy increases 2. entropy deacreses 3. entropy stays the same. Predict how the enthopy of the substance is affected in the following processes: a) O2(g 200 kPa 300 K) --> O2(g, 100 kPa, 300 K) entropy _________ b) I2(g, 1 bar, 125 degree C) --> I29g, 1 bar, 200 degree C) c) Fe(s, 1 bar, 250 degree C) --> Fe(s, 1 bar, 25 degree C)

Answers

As the pressure drops, the volume of the gas expands, increasing the number of potential molecule configurations in the system and raising the entropy. As a result, the system's entropy rises. One is true: Entropy rises.

b) I2(g, 1 bar, 125°C) --> I2(g, 1 bar, 200°C)

There are more conceivable configurations of the molecules in the system as the temperature rises because the molecules' kinetic energy rises. As a result, the system's entropy rises.

Entropy increases.

c) Fe(s, 1 bar, 250°C) --> Fe(s, 1 bar, 25°C)

The number of alternative configurations of the atoms in the system diminishes as the temperature drops because the kinetic energy of the particles in the system also drops. As a result, the system's entropy goes down.

The answer is that entropy falls.

to know more about entropy here:

brainly.com/question/13135498

#SPJ1

PLEASE HELP!
Which of the following is an example of a chemical change?

A. A large nail rusting
B. Folding a piece of paper
C. Filling a balloon with hot air
D. Wax melting from a candle

Answers

Answer: A. a large nail rusting

Explanation:

Answer:
A) A large nail rusting

Explanation:
A nail rusting is a chemical change because the iron has changed into a new substance. It is the iron (Fe) and oxygen (O) combining.

Chemical change:
When a chemical reaction occurs and a new substance is made.
E.g. Burning wood

Physical change:
When matter change form but not chemical identity.
E.g. Melting ice

Hope this helped you!

What is the VSPER shape and Bond angle of Chlorpyrifos?

What is the VSPER shape and Bond angle of Chlorpyrifos?

Answers

The VSEPR shape of Chlorpyrifos is trigonal pyramidal, with a bond angle of approximately 107.5 degrees.

What is trigonal pyramidal?

Trigonal pyramidal is a type of molecular geometry where a central atom is surrounded by three atoms or groups of atoms at the corners of an equilateral triangle in a three-dimensional space. This type of geometry is most commonly found in molecules with a central atom from Group 5 (Nitrogen, Phosphorus, Arsenic, Antimony, and Bismuth) or Group 6 (Oxygen, Sulfur, Selenium, Tellurium, and Polonium) of the periodic table. In some cases, the atoms or groups of atoms can be replaced by lone pairs of electrons, or lone pairs and atoms or groups of atoms. The bond angles in trigonal pyramidal molecules are typically around 107°.

To learn more about trigonal pyramidal
https://brainly.com/question/22697472
#SPJ1

a monoprotic weak acid (ha) has a pa value of 4.210. calculate the fraction of ha in each of its forms ( ha, a− ) at ph 5.692 .

Answers

The fraction of the monoprotic weak acid (HA) at pH 5.692, approximately 3.19% and 96.81% is in the form of A-.

To calculate the fraction of HA in each of its forms (HA, A-) at pH 5.692, we need to use the Henderson-Hasselbalch equation, which is:

pH = pKa + log([A-]/[HA])

Given the values:
pKa = 4.210
pH = 5.692

Step 1: Rearrange the equation to solve for the ratio [A-]/[HA]:
log([A-]/[HA]) = pH - pKa

Step 2: Plug in the given values:
log([A-]/[HA]) = 5.692 - 4.210
log([A-]/[HA]) = 1.482

Step 3: Solve for the ratio [A-]/[HA]:
[A-]/[HA] = 10^1.482
[A-]/[HA] ≈ 30.33

Step 4: Calculate the fraction of HA and A-:
Total = [HA] + [A-]
Fraction of HA = [HA]/Total
Fraction of A- = [A-]/Total

Since [A-]/[HA] ≈ 30.33, we can represent [A-] as 30.33[HA]. Thus:
Total = [HA] + 30.33[HA] = 31.33[HA]

Fraction of HA = [HA]/(31.33[HA]) ≈ 1/31.33 ≈ 0.0319
Fraction of A- = [A-]/(31.33[HA]) ≈ 30.33/31.33 ≈ 0.9681

At pH 5.692, approximately 3.19% of the monoprotic weak acid (HA) is in the form of HA and 96.81% is in the form of A-.

More about Weak Acid:

https://brainly.com/question/13032224

#SPJ11

explain exactly why a stoichiometric balance of a combustion reaction must demonstrate conservation of mass, but not conservation of moles.

Answers

Stoichiometric balance of a combustion reaction. A stoichiometric balance of a combustion reaction must demonstrate conservation of mass, but not conservation of moles because stoichiometry of a chemical reaction is based on the number of atoms and molecules, but not their masses or volumes.

Conservation of mass is a fundamental principle of physics and chemistry which says that in a closed system, mass cannot be created or destroyed, but only transformed from one form to another. In other words, the total mass of the reactants must be equal to the total mass of the products in a chemical reaction, regardless of the masses or volumes of the individual molecules involved.

On the other hand, conservation of moles refers to the fact that in a balanced chemical equation, the number of moles of each reactant and product is equal. However, since different molecules have different masses, conservation of moles does not necessarily imply conservation of mass.

For example, if one mole of oxygen reacts with one mole of hydrogen to form one mole of water, the number of moles of each substance is conserved, but the mass is not, since the mass of water is greater than the combined mass of oxygen and hydrogen.

The stoichiometric balance of a combustion reaction must demonstrate conservation of mass because the reactants and products involved in combustion reactions are typically gases or liquids that can be easily measured by volume or weight.

Since the number of atoms and molecules involved in the reaction is fixed by the stoichiometry of the equation, the conservation of mass principle ensures that the mass of the reactants is equal to the mass of the products, even if the masses or volumes of individual molecules differ.

To know more about Stoichiometric, refer here:

https://brainly.com/question/29775083

#SPJ11

a 50.0 ml sample of 0.155 m hno2(aq) is titrated with 0.100 m naoh(aq). what is the ph of a solution after the addition of 25.0 ml of naoh? [ ka of hno2 = 4.5 × 10–4 ]

Answers

After the addition of 25.0 ml of 0.100 M NaOH to a 50.0 ml sample of 0.155 M \(HNO_{2}\), the resulting solution's pH can be calculated by considering the neutralization reaction between HNO_{2} and NaOH. Using the given Ka value of HNO_{2} (4.5 × \(10^{-4}\)), the concentration of the resulting \(H_{3}O^{+}\) ions can be determined, and the pH can be calculated.

To calculate the pH of the solution after the addition of NaOH, we need to determine the number of moles of  HNO_{2}  and NaOH reacted in the titration. The initial moles of  HNO_{2}  can be calculated by multiplying the initial concentration (0.155 M) by the initial volume (50.0 ml). Similarly, the moles of NaOH added can be obtained by multiplying the concentration (0.100 M) by the volume added (25.0 ml). Since HNO_{2} and NaOH react in a 1:1 ratio, the moles of  HNO_{2} remaining after the reaction will be the difference between the initial moles and the moles of NaOH added.

Next, we can calculate the concentration of  HNO_{2}  after the reaction by dividing the moles of  HNO_{2}  remaining by the final volume (75.0 ml). Using the given Ka value of  HNO_{2}  (4.5 × \(10^{-4}\)), we can set up an expression for the equilibrium constant and solve for the concentration of H_{3}O^{+} ions, which is equal to the concentration of  HNO_{2}  after the reaction. Finally, the pH can be calculated by taking the negative logarithm (base 10) of the  concentration. By following these steps, the pH of the solution after the addition of NaOH can be determined based on the given information.

Learn more about logarithm here: https://brainly.com/question/30226560

#SPJ11

Which of these describes why a stent is used?
O A. To open an artery near the heart
O B. To repair a weak heart valve
O C. To increase the biocompatibility of a heart transplant
O D. To enhance the durability of a pacemaker
SUBMIT

Answers

Answer:the correct answer is A.To open an artery near the heart

Explanation:I just took the test :)

A stent is used to open an artery near the heart and the correct option is option A.

A stent is commonly used in medical procedures to open up narrowed or blocked arteries near the heart. It is a small, mesh-like tube typically made of metal or synthetic materials. The stent is inserted into the affected artery and expands, effectively widening the artery and improving blood flow. This procedure is known as coronary angioplasty or stenting.

The narrowing or blockage of arteries can occur due to atherosclerosis, a condition in which plaque builds up on the artery walls. This can lead to reduced blood flow and potentially result in chest pain (angina) or even a heart attack. By placing a stent, the artery is opened up, allowing for improved blood flow to the heart muscle.

Thus, the ideal selection is option A.

Learn more about Stent, here:

https://brainly.com/question/30477421

#SPJ6

How many phases of matter are there? two, three, four or five?

Answers

Answer:

There are four phases of matter.

Explanation:

There are the three phases you normally hear about: solid, liquid and gas.

However, there is also a fourth named plasma.

PLS GIVE BRAINLIEST

Your answer is:4.

Hope this helps!✌
Other Questions
The gross domestic product includes? i consumer expenditures ii government expenditures iii fixed investment a i and ii only b ii and iii only c iii only d i, ii, iii How did the Virginia Company make money for England? Selective Exposure means that people tend to seek out messages that agree with what they already believe. T/F? Use a table to find the solutions of x-6x+5 Which of the following executive departments have the largest roles in shaping United States foreign policy?State and Defense Consider the ordered bases B = {1, x, x2} and C = {1, (x - 1), (x - 1)2} for P2. (a) Find the transition matrix from C to B. (b) Find the transition matrix from B to C. (c) Write p(x) = __________________________ HELP ME OUT PLEASE! You are trying to sell a new product to a store owner. Which method of presentation is likely the most effective? O a chart showing how sales will go up if they use this product O quotes from other store owners on success of this product O a free trial option to use the product for six months, no questions asked O all of the above please help it's matic which are part of the water cycle that naturally occurs on earth? What's the answer for that one. Word search U.S Landscapes Please help me answer this question on equations of lines. 10 POINTS AND BRAINLIEST available. Helena has avoidant personality disorder. she is likely to : a. engage in a series of intense, unstable relationships. b. be hypersensitive to any sign of criticism or rejection. c. have no interest in social relationships. d. avoid achievement situations where she might fail. Are there concepts/processes to strictly follow in writing radicals as expressions with rational exponents? If the DNA gene CTCTGATAGATT was mutated to read CTCTAGATT, this would be considered a(an) _____mutation. a. deletionb. translocationc. insertion d. inversion Find a . the mean ; b . the deviation from the mean for each data item ; and c . the sum of the deviations in part ( b ) for the following group of data items . 155 , 156 , 162 , 164 , 168 Today, fishing is a key industry in 1. austria, france 2. norway, denmark and iceland How the speed of sound changes in different medium , explain your answer with reference to the arrangement of particles in different mediums? Solve 1=4|x-2|+2Help please