Answer:
Kb = 1.6 × 10⁻⁵
Explanation:
Step 1: Given data
Acid dissociation constant of hydrocyanic acid (Ka): 6.2 × 10⁻¹⁰
Concentration of cyanide ion (Cb): 0.1 M
Step 2: Calculate the basic dissociation constant (Kb) of cyanide ion
We have the Ka of HCN. We can calculate the Kb of its conjugate base using the following expression.
Ka × Kb = Kw = 1.0 × 10⁻¹⁴
Kb = 1.0 × 10⁻¹⁴/Ka
Kb = 1.0 × 10⁻¹⁴/6.2 × 10⁻¹⁰
Kb = 1.6 × 10⁻⁵
The Kb for a 0.1 M solution of cyanide ion is :
- 1.6 × 10⁻⁵
Base dissociation constantGiven:
Acid dissociation constant of hydrocyanic acid (Ka)= 6.2 × 10⁻¹⁰
Concentration of cyanide ion (Cb)= 0.1 M
Base dissociation constant (kb)=?
Ka × Kb = Kw = 1.0 × 10⁻¹⁴
Kb = 1.0 × 10⁻¹⁴/Ka
Kb = 1.0 × 10⁻¹⁴/6.2 × 10⁻¹⁰
Kb = 1.6 × 10⁻⁵
Learn more about " Kb":
https://brainly.com/question/26871012?referrer=searchResults
A 0.50 mol sample of COBr2 is transferred to a 9.50-L flask and heated until equilibrium is attained. Calculate the equilibrium concentrations of each species.
Answer:
Equlibrium concentration for each species ae as follows:
[CO] = 0.043 mol/L
[Br₂] = 0.043 mol/L
[COBr₂] = 0.01 mol/L
Explanation:
Let take a look at the chemical equation taking place at equilibrium
COBr2(g) ⇄ CO(g) + Br2(g)
The concentration of COBr2 i.e.
[COBr2] = no of moles/volume
= 0.50 mol/9.50 L
[COBr2] = 0.0530 mol/L
At standard conditions
Kc for COBr2 = 0.190
Now, the ICE table for the above reaction can be computed as follows:
COBr2(g) ⇄ CO(g) + Br2(g)
Initial 0.053 0 0
Change -x +x +x
Equilibrium (0.053 - x) x x
\(\mathsf{K_c = \dfrac{[CO][Br_2]}{[COBr_2]}}\)
\(K_c = \dfrac{(x) (x)}{(0,053 -x)}\)
\(0.190= \dfrac{x^2}{(0.053 -x)}\)
x² = 0.190(0.053 - x)
x² = 0.01007 - 0.190x
x² + 0.190x - 0.01007 = 0
Using quadratic formula:
x ≅ 0.043 mol/L
SInce: x = [CO][Br₂] = 0.043 mol/L
[COBr₂] = 0.053 - x
[COBr₂] = 0.053 - 0.043 mol/L
[COBr₂] = 0.01 mol/L
write the structural formula for 2-bromo-3-chloro-4,4-dimethylpentanal
Answer:
Br-CH2-CH(CH3)2-C(Cl)H-CH(CH3)2-CHO
Explanation:
The molecule has a total of 14 carbon atoms, 13 hydrogen atoms, and 1 bromine atom. The carbon atoms are arranged in a chain with a methyl group attached to the second carbon atom, a chlorine atom attached to the third carbon atom, and two methyl groups attached to the fourth carbon atom. The fifth carbon atom has a carbonyl group attached to it.
The molecule is an aldehyde, which means that it has a carbonyl group (C=O) at the end of the chain. The carbonyl group is polar, and the oxygen atom has a partial negative charge. The hydrogen atom has a partial positive charge. This polarity makes the aldehyde group susceptible to nucleophilic attack.
The bromine and chlorine atoms are both electrophilic, which means that they have a partial positive charge. This makes them susceptible to nucleophilic attack.
The methyl groups are non-polar and do not have any significant reactivity.
The molecule is a chiral molecule, which means that it has a mirror image that is not superimposable on itself. This is because the carbon atom with the carbonyl group is attached to four different groups.
The molecule is a liquid at room temperature and has a strong odor. It is used in a variety of products, including perfumes, flavorings, and plastics.
(50 points) A chemist reacted 15.0 liters of F2 gas with NaCl in the laboratory to form Cl2 and NaF. Use the ideal gas law equation to determine the mass of NaCl that reacted with F2 at 280. K and 1.50 atm.
F2 + 2NaCl → Cl2 + 2NaF
Part 2. Explain how you would determine the mass of sodium chloride that can react with the same volume of fluorine gas at STP.
A. The mass of NaCl needed to react with F₂ at 280 K and 1.50 atm is 115.83 g
B. The mass of NaCl needed to react with F₂ at STP is 78.39 g
A. How to determine mass of NaCl needed at 280 K and 1.50 atmWe'll begin by calculating the number of mole of F₂ by using the ideal gas equation as follow:
Volume (V) = 15 LTemperature (T) = 280 KPressure (P) = 1.5 atm Gas constant (R) = 0.0821 atm.L/Kmol Number of mole (n) =?n = PV / RT
n = (1.5 × 15) / (0.082 × 280)
n = 0.98 mole
Next, we shall determine the number of mole NaCl that reacts. This is given below
F₂ + 2NaCl → Cl₂ + 2NaF
From the balanced equation above,
1 mole of F₂ reacted with 2 moles of NaCl.
Therefore,
0.98 mole of F₂ will react with = 0.98 × 2 = 1.96 moles of NaCl
Finally, we shall determine mass of NaCl as follow
Mole of NaCl = 1.96 molesMolar mass of NaCl = 58.5 g/mol Mass of NaCl =?Mass = mole × molar mass
Mass of NaCl = 1.98 × 58.5
Mass of NaCl = 115.83 g
B. How to determine mass of NaCl needed at STPAt standard temperature and pressure (STP),
22.4 L = 1 mole of F₂
Therefore,
15 L = 15 / 22.4
15 L = 0.67 mole of F₂
Next, we shall determine the number of mole NaCl that reacts. This is given below
F₂ + 2NaCl → Cl₂ + 2NaF
From the balanced equation above,
1 mole of F₂ reacted with 2 moles of NaCl.
Therefore,
0.67 mole of F₂ will react with = 0.67 × 2 = 1.34 moles of NaCl
Finally, we shall determine mass of NaCl as follow
Mole of NaCl = 1.34 molesMolar mass of NaCl = 58.5 g/mol Mass of NaCl =?Mass = mole × molar mass
Mass of NaCl = 1.34 × 58.5
Mass of NaCl = 78.39 g
Learn more about ideal gas equation:
https://brainly.com/question/4147359
#SPJ1
i need help filling in these 2 blanks i really need answers asap
is there a word bank so i know which words to chose from?
1st blank: command
2nd blank: messages
Explanation:
I am not too sure about the second blank, but to me it makes sense.
35. Explain what the Triple Point is and why the Triple
Point is never observed in Nature.
Help please
Answer:
In thermodynamics, the triple point of a substance is the temperature and pressure at which the three phases of that substance coexist in thermodynamic equilibrium. It is that temperatureand pressure at which the sublimation curve, fusion curve and vaporisation curve meet.
Answer:
At the triple point, all three phases (solid, liquid, and gas) are in equilibrium. Since the triple point is a point, there is only one temperature and one pressure where the three phases will exist. This fact often helps in identifying compounds or in problem solving.
If I have a 200 L container filled with nitrogen at a pressure of 1.0 atm, how many moles of nitrogen are present at 25 C?
0
Select one:
O a. 0,085 moles
O b. 81.8 moles
O C. 19.3 moles
O d. 8.18 moles
what is formed when polyatomic ions bond with other ions.
A) ionic compounds.
B) neutral compounds.
C) ionic elements.
D) neutral elements.
Answer:
iconic compounds is your anwser
Answer:
Iconic Compounds
Explanation:
I watched a video about it.
Have a nice Friday!
A chemist requires a large amount of 1-bromo-4-phenyl-2-butene as starting material for a synthesis and decides to carry out the following NBS allylic bromination reaction in the presence of UV light. Draw the structures of all of the observed products.
NBS
(C6H5)CH2CH = CHCH3 → ?
CCI4
Draw one additional resonance structure for the species below:
CH3CH=CHCH=CHCH=CHCH2
Answer:
CH 2 CH 3 CHCH = C6H5 + 5 Hydrogen Atoms
I hope I helped you.
Deepest apologies if I was wrong!
Bye!
~ Myaka O.
Why is it expensive to bring electricity into urban areas?
Answer:
Power plants are not located in cities. Power has to travel a long distance over power lines to reach cities.
Explanation:
how many elements are in 3caso4
Answer:
there are only three elements in 3CaSO4: calcium, sulfur and oxygen
Electric Current: Mastery Test
Select the correct answer.
What is the symbol for voltage?
OA. P
OB. V
OC. T
OD. V
Reset
Next
The derived unit for voltage inside the International System of Units is called volt. V is the symbol for voltage. Therefore, the correct option is option D.
What is voltage?Voltage seems to be the difference throughout electric potential between two locations, often referred to as electrical pressure, electric tension, as well as (electric) potential difference.
It refers to the labor required per unit of charge that move pure test charge between two places inside a static electric field. The derived unit for voltage inside the International System of Units is called volt. V is the symbol for voltage.
Therefore, the correct option is option D.
To know more about voltage, here:
https://brainly.com/question/28164474
#SPJ9
Best answer and explanation will get marked brainiest
How many significant figures does this have:
The number 345,000 has 3 significant figures because the trailing zeros are not significant since there's no decimal point.
What is significant figures?Significant figures of a number in positional notation are digits in the number that are reliable and necessary to indicate the quantity of something.
Also significant figures can be defined as, the number of digits in a value, often a measurement, that contribute to the degree of accuracy of the value.
Examples of significant figures;
405 = 3 significant figures405000 = 3 significant0.040500 = 5 significant figuresNote: leading zeros are not significant but trailing zeros, which are zeros at the end of a number, are significant only if the number has a decimal point.
345,000 = 3.45 x 10⁵ (3 significant figures)
Thus, the number 345,000 has 3 significant figures because the trailing zeros are not significant since there's no decimal point.
Learn more about significant figures here: https://brainly.com/question/24491627
#SPJ1
What is the maximum number of electrons in the second principal energy level?
02 32 8 18
Answer:
8 electrons
Explanation:
The second principal energy level has two sublevels: 2s and 2p
2s : 2 electrons
2p : 6 electrons (3 sublevels × 2 electrons each = 6 electrons)
It can hold a maximum of 8 electrons.
Hope this helps. :)
please help fast :/
how many moles are present in 60 grams of hydrochloric acid , HCI ?
a : 1.40 moles
b : 36.45 moles
c : 1.65 moles
d : 60 moles
Answer: C- 1.65 moles
Explanation:
HCl = 1 + 35.45 = 36.45 g/mol
The main assumptions of the Kinetic Molecular Theory of gases are:
1. Gases are made up of molecules which are relatively far apart.
2. The molecules are in motion at high speeds.
3. The molecules are perfectly elastic.
4. Increase in temperature increases the kinetic energy of the molecules.
The assumption that accounts for the great compressibility of gases compared to liquids and solids is:
1
2
3
4
none
The assumption that accounts for the great compressibility of gases compared to liquids and solids is assumption 1: Gases are made up of molecules which are relatively far apart. Option A)
The assumption that accounts for the great compressibility of gases compared to liquids and solids is assumption 1: Gases are made up of molecules which are relatively far apart.
In gases, the molecules are widely spaced and have significant gaps between them. This allows gases to be easily compressed under pressure. When external pressure is applied to a gas, the molecules can be brought closer together, reducing the volume occupied by the gas. The gaps between the molecules provide room for compression, allowing gases to occupy a smaller volume.
In contrast, liquids and solids have molecules or particles that are closely packed together. The intermolecular forces in liquids and solids are stronger, limiting their compressibility. The molecules or particles are already in close proximity, leaving little room for further compression.
Therefore, the assumption that gases consist of molecules that are relatively far apart accounts for their greater compressibility compared to liquids and solids. Hence Option A) is correct.
For more question on molecules
https://brainly.com/question/24191825
#SPJ8
how you can separate two soluble substance
Answer: To Separate two water-soluble compounds first concentrate the reaction mixture by vacuum evaporation and then partial crystallization at various temperatures .
Explanation:
Im not sure if its right but if its wrong, Im sorry
Scientists can use chemicals to clean toxins from the soil. What does this
show about chemicals?
Any substance made of matter is by definition a chemical, which includes solids, liquids, and gases. Pure substances or mixtures of substances can both be found in chemicals. Water (H2O), for example, is a pure chemical because the same molecules and molecular combinations are present throughout its whole structure.
Explain about the chemicals ?Any material with a known composition is a chemical. Some chemicals, like water, are found in nature, meaning they always consist of the same "stuff." Other chemicals, including chlorine, are produced (used for bleaching fabrics or in swimming pools).
A chemical compound is a material that contains a specific combination of atoms or ions. Chemical compounds are made up of two or more elements coming together through a chemical process. While all substances are compounds, not all substances are compounds.
On its list of substances covered by the Toxic Substances Control Act, the EPA has more than 85,000 chemicals listed.
Not all chemicals are detrimental to the economy.
To learn more about Chemicals refer to:
https://brainly.com/question/26487468
#SPJ13
A safer but more expensive disinfectant
Some examples of safer but more expensive disinfectants include hydrogen peroxide, quaternary ammonium compounds, electrolyzed water, and ultraviolet light.
Hydrogen peroxide: Hydrogen peroxide is a powerful disinfectant that can be used on many surfaces. It is effective against bacteria, viruses, and fungi, and it breaks down into water and oxygen, making it environmentally friendly. However, it can be more expensive than other disinfectants.Quaternary ammonium compounds: Quaternary ammonium compounds (or "quats") are disinfectants that are often used in hospitals and other healthcare settings. They are effective against a wide range of microorganisms and are less toxic than some other disinfectants. However, they can be more expensive than other options.Electrolyzed water: Electrolyzed water is a disinfectant that is created by passing an electrical current through a mixture of water and salt. It is effective against bacteria, viruses, and other pathogens, and it is safe for use on food contact surfaces. However, it can be more expensive than other disinfectants.Ultraviolet light: Ultraviolet (UV) light can be used to disinfect surfaces and air. UV light is effective against bacteria, viruses, and other microorganisms, and it is environmentally friendly since it does not require any chemicals. However, UV light equipment can be expensive.To know more about disinfectants, visit:
https://brainly.com/question/28522315
#SPJ1
how is the Bohr atomic model different from the plum-pudding model ?
The plum-pudding model suggested a uniform distribution of electrons within a positively charged atom, whereas the Bohr atomic model introduced the concept of quantized energy levels and specific orbits for electrons.
The Bohr atomic model and the plum-pudding model are two distinct models that were proposed to explain the structure of atoms, and they differ in their fundamental concepts.
The plum-pudding model, also known as the Thomson model, was proposed by J.J. Thomson in 1904. According to this model, an atom consists of a positively charged sphere (the "pudding") with embedded negatively charged electrons (the "plums").
In other words, the electrons were thought to be uniformly distributed throughout the positively charged atom. This model suggested that the atom was overall neutral and did not contain any distinct substructures.
On the other hand, the Bohr atomic model, proposed by Niels Bohr in 1913, introduced the concept of quantized energy levels within an atom. According to this model, electrons orbit the nucleus in specific, discrete energy levels or shells.
These energy levels are represented by fixed orbits or paths, with electrons occupying only certain allowed orbits. The model also introduced the idea that electrons can transition between energy levels by emitting or absorbing energy in discrete packets called photons. This model explained phenomena like atomic spectra and the stability of atoms.
For mopre such questions on Bohr atomic model visit:
https://brainly.com/question/18002213
#SPJ8
Refer to picture for question, all must be answered to be considered for Brainliest!!!
Li₃PO₄ + 3 Zn(NO₃)₂ → 3 LiNO₃ + Zn₃(PO₄)₂. In this balanced equation, one of the products is Zn₃(PO₄)₂. To ensure that the equation is balanced, we need 3 moles of Zn(NO₃)₂ for every 1 mole of Li₃PO₄.
What is product in any given reaction?In a chemical reaction, a product is a substance that is formed as a result of the chemical reaction. It is the end result of a chemical reaction, and it is produced by the rearrangement of atoms and/or ions of the reactants.
In the given equation, we end up with 1 mole of Zn₃(PO₄)₂ for every 3 moles of Zn₃(PO₄)₂. This means that the molar ratio of Zn₃(PO₄)₂ to Zn₃(PO₄)₂ is 1:3, indicating that we need three times as much Zn₃(PO₄)₂ as Zn₃(PO₄)₂ to balance the equation. Therefore, one of the products, Zn₃(PO₄)₂, must be produced in a smaller quantity than the other product, LiNO₃.
To know more about chemical reaction, visit:
https://brainly.com/question/29039149
#SPJ1
Question 1 (4 points)
What is the molecular weight of Magnesium nitride, Mg3N2 (OR Mg3 N2). Report
your answer to two decimal places.
Do not include units with your answer.
The atomic weight of Mg is 24.31 grams/mole
The atomic weight of N is 14.01 grams/mole
How many moles of chlorine atoms are there in 5.9 × 1023 molecules of carbon tetrachloride, CCl4 ?
There are 0.9797 moles of chlorine atoms are there in 5.9 × 1023 molecules of carbon tetrachloride, CCl4
By dividing the number of moles by the Avogadro constant, one can get the total number of atoms or molecules in a sample.The mole idea is a useful way to indicate how much of a substance there is. Any measurement can be divided into two components: the magnitude in numbers and the units in which the magnitude is expressed.Even one gramme of a pure element is known to have an enormous number of atoms when working with particles at the atomic (or molecular) level. The mole concept is frequently applied in this situation. The unit of measurement that receives the most attention is the "mole," which is a count of a sizable number of particles.
Number of Atoms or Molecules = (Number of Moles) * (6.022*10²³)
Given:
Molecules of chlorine atom = 5.9 * 10²³
Avagadro constant = 6.022*10²³
Number of moles = Number of molecules/ Avagadro constant
= 5.9 * 10²³ / 6.022*10²³
= 0.9797
Hence, there are 0.9797 moles of chlorine atoms are there in 5.9 × 1023 molecules of carbon tetrachloride, CCl4.
To know more about moles check the below link:
https://brainly.com/question/921246
#SPJ9
Which of the following choices involves changing nitrogen gas to a nitrate?
ammonification
nitrogen fixation
denitrification
None of the choices are correct
Answer:
nitrogen fixation
Explanation:
I took a test on it so i know its right
HELP ME FAST
How many moles are in 325 g of MgCO3?
0.161 moles
0.269 moles
1.98 moles
3.85 moles
Answer:
3.85
Explanation:
Calculate molar mass, starting with each element, then find grams per mole, then convert.
The Xs show the location of beanbags a student tossed at a target. The
student was aiming for the center circle. Which words best describe the
student's results?
A. Low precision, low accuracy
O B. High precision, low accuracy
O C. High precision, high accuracy
O D. Low precision, high accuracy
Answer:
It is D low precision, high accuracy
Explanation:
I got it correct
The Xs show the location of beanbags a student tossed at a target. The student was aiming for the center circle. Low precision, high accuracy best describe the student's results. Therefore, option D is correct.
What is precision ?There are two ways to assess observational error: accuracy and precision. Precision measures how closely two measurements are to one another, whereas accuracy measures how close a group of measurements is to its actual value. In other words, precision is a measure of statistical variability and a description of random errors.
The proximity of two or more measurements to one another is referred to as precision. Using the aforementioned example, your measurement is extremely accurate if you weigh a certain substance five times and obtain 3.2 kg each time. Accuracy is not necessary for precision.
Regardless of whether or whether two or more measurements are correct, precision is described as "the property of being exact" and relates to how close two or more measurements are to one another.
Thus, option D is correct.
To learn more about the precision, follow the link;
https://brainly.com/question/28336863
#SPJ5
How much energy is required to condense 92.2 g of water?
To answer this question, we have to use the heat of vaporization of water, that tells us the amount of energy required to evaporate or condense 1 g of water.
According to it, you need to remove 2.257kJ to condensate 1 g of water:
\(92.2g\cdot\frac{-2.257kJ}{1g}=-208.09kJ\)It means that -208.09kJ are required to condensate 92.2grams of water.
The answer is negative because to condensate a substance you have to remove heat, so when we express it we have to write as a negative amount.
A cell is placed in a salt solution that has the same concentration as the inside of the cell. What will happen to the cell
A. The cell will contract
B. The cell will expand slightly
C. The cell will burst
D. The cell will remain the same size
By the way I had to ask again because I f forgot to put the answer choices
Answer:
B
Explanation:
If not B then its d
Answer:
D
Explanation:
This would be an isotonic solution. If a cell is placed in a solution of salt with the same concentration of salt in the cell, nothing will happen.
Which equation shows an increase in entropy?
Hint: Look at the states of matter, g s l, of the chemicals in each equation. A C2H4(g) + H2(g) + C2H6(g) в Caco3(9) + Cao(s) - CO2(g) c Fe(s) + S (s) -+ FeS (s)
The equation C2H4(g) + H2(g) + C2H6(g) → Caco3(s) + Cao(s) + CO2(g) shows an increase in entropy due to the formation of a gas as a product. Option A
In this equation, the reactants on the left-hand side consist of gases (C2H4 and H2), while the products on the right-hand side include a solid (Caco3) and a gas (CO2).
When a reaction involves a change from gaseous to solid or liquid states, there is typically a decrease in entropy because the particles become more ordered and constrained in the solid or liquid phase.
Conversely, when a reaction involves the formation of gases, there is generally an increase in entropy because gases have higher degrees of molecular motion and greater freedom of movement compared to solids or liquids.
In the given equation, the reactants include three gaseous compounds (C2H4, H2, and C2H6), and one of the products is a gas (CO2). Therefore, the overall entropy of the system increases during this reaction.
The equation Fe(s) + S(s) → FeS(s) does not show an increase in entropy. Both the reactants (Fe and S) and the product (FeS) are solids. Since solids have lower entropy compared to gases or liquids, the entropy of the system does not increase in this reaction. Option A
For more such questions on entropy visit:
https://brainly.com/question/30481619
#SPJ8
What happens to water when it changes to ice?
Its density increases.
Its density decreases.
Its mass increases.
Its mass decreases.
Its volume increases.
Its volume decreases
Answer:
Its density decreases
Its volume increases
Explanation:
You notice that ice floats on water, this means that its density is less. The mass remains the same because you did not add or remove anything. But what causes the density to decrease then? For density to change, there needs to be a change in either the volume or the mass of the object. Density is calculate by mass/volume. Since the mass did not change, the volume must have. So in this case, the volume increases. Hence, this is what causes it to be less dense. :)
Answer:
D.
Explanation:
brainliest pls
How many significant figures are in a measurement of 28.050 km?
Answer:
has 5, ans 3 decimals.
thats as simple as i can put it.