Draw the hydrogen bonding of G-C and A-T pairs by hand. For each hydrogen bond, please point out which are hydrogen bond donors, and which are hydrogen bond acceptors.

Answers

Answer 1

Everyone agrees that guanine-cytosine (GC) base pairs have three hydrogen bonds, but adenine-thymine (AT) base pairs only have two.

What do adenine's hydrogen bond acceptors and donors look like?

Testing the significance of the these two polar organisations together necessitates an analogue whereby both are replaced to nonpolar functionality, preferably maintaining steric dimensions and forms as closely as possible. Adenine carries a hydrogen - bonding acceptor (N1) as well as a donor (NH2) along its Watson-Crick base pairing edge.

What do donors and acceptors of cytosine hydrogen bonds do?

Three hydrogen bonds hold guanine-cytosine base pairs, often known as GC base pairs, together. The bases are marked with the names of the hydrogen - bonding donors and recipients. The hydrogen - bonding donors all are NH groups. Nitrogen and oxygen atoms with a single pair of electrons can act as hydrogen bond acceptors.

To know more about adenine-thymine visit:

https://brainly.com/question/15305540

#SPJ1


Related Questions

What is the wavelength of spectral line resulted from the electron transition from n=3 to n=2 in a hydrogen atom.

Answers

Answer:

\(\lambda=6.56x10^{-7}m\)

Explanation:

Hello there!

In this case, it possible to use the Rydberg equation in order to calculate the wavelength for this transition from n=3 to n=2 as shown below:

\(\frac{1}{\lambda} =R_H(\frac{1}{n_f^2}-\frac{1}{n_i^2} )\)

Thus, we plug in the corresponding energy levels and the Rydberg constant to obtain:

\(\frac{1}{\lambda} =10973731.6m^{-1}(\frac{1}{2^2}-\frac{1}{3^2} )\\\\\frac{1}{\lambda} =1524129.4m^{-1}\\\\\lambda=\frac{1}{1524129.4m^{-1}} \\\\\lambda=6.56x10^{-7}m\)

Best regards!

After 3.00 g of solid PH3BCl3 is added to a closed 1.500- L vessel at 60 ∘C , the vessel is charged with 0.0500 g of BCl3(g) . What is the equilibrium concentration of PH3 ?

Answers

It should be noted that the equilibrium concentration of PH₃ in the 1.500 L vessel at 60 °C is 0.0146 M.

How to calculate the value

moles of PH₃BCl₃ = mass / molar mass

molar mass of PH₃BCl₃ = 3(1.01 g/mol) + 1(10.81 g/mol) + 3(35.45 g/mol) = 137.28 g/mol

moles of PH₃BCl₃ = 3.00 g / 137.28 g/mol = 0.0219 mol

Calculate the moles of BCl₃:

moles of BCl₃ = mass / molar mass

molar mass of BCl₃ = 1(10.81 g/mol) + 3(35.45 g/mol) = 117.21 g/mol

moles of BCl₃ = 0.0500 g / 117.21 g/mol = 0.000426 mol

Based on the stoichiometry of the reaction, 1 mole of PH₃BCl₃ produces 1 mole of PH₃:

moles of PH₃ produced = moles of PH₃BCl₃ = 0.0219 mol

Convert the moles of PH₃ to concentration:

concentration of PH₃ = moles / volume

concentration of PH₃ = 0.0219 mol / 1.500 L = 0.0146 M

Learn more about equillbrium on

https://brainly.com/question/517289

#SPJ4

Scurvy was a serious disease that 18th-century sailors often came down with on their long-distance voyages overseas. The cause of scurvy was not known at the time, and the cure was not always accepted.

A famous British explorer named James Cook decided to put his crew on a strict diet plan that he hoped might prevent his sailors from getting the illness. One food Captain Cook required his sailors to eat was sauerkraut. Interestingly, none of his sailors ever died from scurvy.

Today, we know that scurvy is caused by a lack of vitamin C. Although Captain Cook did not realize that sauerkraut had this important nutrient, his plan helped keep his sailors healthy. (5 points)

a. Who was the scientist in the above story? (1 point)

b. What "experiment" did he do? (1 point)

c. What "chemicals" were used in his experiment? (1 point)

d. How did this "scientist" use his knowledge to serve others? (1 point)

e. What does this story tell you about where chemicals can be found and who can be a scientist? (1 point)

Answers

a. The scientist in the above story is James Cook, the famous British explorer.

b. The "experiment" that James Cook conducted was putting his crew on a strict diet plan that included sauerkraut.

c. The "chemical" used in his experiment was vitamin C, although it was not known at the time.

d. James Cook used his knowledge and observations to serve others by implementing a diet plan that helped prevent scurvy among his sailors.

e. This story highlights that scientific discoveries can be made even without a complete understanding of the underlying chemistry.

a. The scientist in the above story is James Cook, the famous British explorer.

b. The "experiment" that James Cook conducted was putting his crew on a strict diet plan that included sauerkraut.

c. The "chemical" used in his experiment was vitamin C, although it was not known at the time.

d. James Cook used his knowledge and observations to serve others by implementing a diet plan that helped prevent scurvy among his sailors. By requiring his crew to eat sauerkraut, which happened to contain vitamin C, he unknowingly provided them with the necessary nutrient to stay healthy and avoid the illness.

e. This story highlights that scientific discoveries can be made even without a complete understanding of the underlying chemistry. James Cook's use of sauerkraut as a preventive measure against scurvy demonstrates that valuable knowledge and effective solutions can come from observation, experimentation, and practical applications. It also emphasizes that anyone can contribute to scientific advancements, as Cook, an explorer rather than a trained scientist, made a significant impact on the health of his crew through his innovative approach. This story shows that chemicals, in this case, vitamin C, can be found in natural sources, and scientific discoveries can be made by individuals from various backgrounds and professions.

For more question on scientist

https://brainly.com/question/29886197

#SPJ8

which substance has more particles 1 mole of gold or 1 mole of water explain your answer .

Answers

Answer:

Neither of them have more particles than the other.

Explanation:

Neither of them have more particles than the other because;

1 mole of any substance usually contains 6.022 × 10^(23) atoms/molecules/particles of that very same substance.

Thus, it will be the same value for Gold (Au) and water(H2O).

ASAP:
The gases in a can of compressed air are at a temperature of 274.9 K and a pressure of 227.2 kPa. If the gases in the can reach a pressure of 845.3 kPa, the can will explode. What temperature (in K) would the can need to be heated up to for it to explode?

Answers

Answer:

845.4

Explanation:

A given mass of gas has a volume of 893 mL at -33°C and 480 torr. Calculate the volume of the gas at
30°C and 210 torr of pressure and the amount of gas is constant.

Answers

1,392 mL is the volume of the gas at 30 °C and 210 torrs of pressure.

Calculation-

The combined gas law, which states that for a certain amount of gas, the product of pressure and volume is directly proportional to the absolute temperature, can be used to solve this issue.

P2V2/T2 = P1V1/T1

where the initial pressure, volume, and temperature are P1, V1, and T1, respectively, and the final pressure, volume, and temperature are P2, V2, and T2, respectively.

Substituting the given values:

P1 = 480 torr

V1 = 893 mL

T1 = -33°C + 273.15 = 240.15 K (converted to Kelvin)

P2 = 210 torr

T2 = 30°C + 273.15 = 303.15 K

We need to find V2.

P1V1/T1 = P2V2/T2

480 torr x 893 mL / 240.15 K = 210 torr x V2 / 303.15 K

V2 = 480 torr x 893 mL x 303.15 K / (240.15 K x 210 torr)

V2 = 1,392 mL (rounded to the nearest whole number)

to know more about pressure here;

brainly.com/question/12971272

#SPJ1

2 C2F4 → C4F8 is 0.0410 M−1 s −1 . We start with 0.105 mol C2F4 in a 4.00-liter container, with no C4F8 initially present. What will be the concentration of C2F4 after 3.00 hours ? Answer in units of M.

Answers

Answer:

After three hours, concentration of C₂F₄ is 0.00208M

Explanation:

As the units of the rate constant of the reaction are M⁻¹s⁻¹ we can know this reaction is of second order. Its integrated law is:

\(\frac{1}{[A]} =\frac{1}{[A]_0} +Kt\)

Where [A] and [A]₀ represents initial and final concentrations of the reactant (C₂F₄), K is rate constant (0.0410M⁻¹s⁻¹) and t is time.

3.00 hours are in seconds:

3 hours ₓ (3600 seconds / 1 hour) = 10800 seconds

Computing in the equation:

\(\frac{1}{[A]} =\frac{1}{[0.105mol / 4L]} +0.0410M^{-1}s^{-1}*10800s\\\frac{1}{[A]} = 480.9M^{-1}\\\\)

[A] = 0.00208M

After three hours, concentration of C₂F₄ is 0.00208M

5.34x10 to the 27th power molecules of sulfur hexafluoride to moles of sulfur hexafluoride

Answers

Answer:

8.87 × 10³ moles.

Explanation:

To convert number of molecules of sulfur hexafluoride (SF6) to moles (n), we divide by Avogadro's number (6.02 × 10²³)

That is; n = N ÷ nA

According to the question, 5.34 x 10^27 molecules of SF6 was given in this question. Hence, the number of moles it contains is given as:

n = 5.34 x 10^27 ÷ 6.02 × 10²³

n = 5.34/6.02 × 10^ (27-23)

n = 0.887 × 10⁴

n = 8.87 × 10³ moles.

Find the volume of oxygen that has a mass of 250. 0 g

NEED HELP ASAP PLEASE!!!

Answers

At STP, the volume of oxygen of mass 250g is found to be 175mL.

Volume is the amount of space occupied by an item or substance. Volume is a measurement of how much 3-dimensional space an object occupies. Volume is the measurement of a limited quantity of area at a specific end.

Mass is a measurement of the quantity of matter in an item or substance. Mass is the physical quantity that represents the amount of matter in an object's body. The amount of weight accommodated in an item or stuff is measured in mass.

Density - The amount of space taken up by an item or substance (its volume) in proportion to the amount of matter in that thing or substance (its mass).

Given:

Mass = 250g = 0.25kg

Density at STP = 1.4291g/L

To find:

Volume = ?

Formula:

Density = Mass / Volume

Calculations:

Volume = Mass / Density

Volume = 0.25 / 1.4291

Volume = 0.175L

Volume = 175mL

Result:

The volume of oxygen of mass 250g is found to be 175mL at STP.

Learn more about volume of gas here:

https://brainly.com/question/4519953

#SPJ4

Can someone please help me ty!!❤️

Can someone please help me ty!!

Answers

Answer:

A

Explanation:

Answer:

are u tryin to get a bf thats ameture and i got a gf already

Explanation: bruh

What part of the Sun can you see best
during the daytime?
a: photosphere
c:chromosome

Answers

photosphere


hope this helps :)

what is the product of the number 1.00 x 103 and the measurement 0.00357 m expressed in the correct number of significant digits?

Answers

The product of the number 1.00 x 10³ and the measurement 0.00357 m, expressed in the correct number of significant digits, is 3.57.

To determine the product of two numbers while considering significant digits, we need to multiply the numbers and then round the result to the appropriate number of significant digits based on the given measurements.

In this case, the number 1.00 x 10³ has three significant digits because the trailing zeros after the decimal point and before the non-zero digit are considered significant. The measurement 0.00357 m has four significant digits as all non-zero digits in a decimal number are significant.

Performing the multiplication, we get:

(1.00 x 10³) * (0.00357 m) = 3.57 m

Since the measurement 0.00357 m has the smallest number of significant digits (four), we round the product to match that precision. Therefore, the product is expressed as 3.57, with four significant digits.

It's important to note that the rules of significant digits help ensure the accuracy and precision of calculations and measurements. By considering the appropriate number of significant digits, we can properly convey the level of certainty and precision in our calculations and measurements.

To know more about decimal point refer here:

https://brainly.com/question/28338004#

#SPJ11

write the equilibrium equation for the saturated barium chromate solution. barium chromate equilibrium:

Answers

The balanced chemical equation for the reaction between barium chromate and water in order to form a saturated barium chromate solution can be written as follows:

\(BaCrO_4 (s) \rightarrow Ba^{2+} (aq) + CrO_4^{2-} (aq)\)

The formula of barium chromate is \(BaCrO_4\).

The solution will be saturated once the amount of \(BaCrO_4\) dissolved in water reaches its maximum solubility, after which no more \(BaCrO_4\) can dissolve in water.

Thus, at the saturation point, the equilibrium equation can be written as follows:

\(BaCrO_4 (s) \rightarrow Ba^{2+} (aq) + CrO_4^{2-} (aq)\)

The law of mass action, states that at equilibrium, the rate of the forward reaction is equal to the rate of the reverse reaction. This allows us to write an expression for the equilibrium constant (K) based on the concentrations of the reactants and products at equilibrium. The equilibrium constant expression varies depending on the balanced chemical equation for the reaction.

To learn about balanced chemical equations refer - https://brainly.com/question/14851443

#SPJ11

How many grams of SO2 would you need to dissolve in 100g of 40 degree water to make a saturated solution?
If you heated the solution to 90 degrees would the new solution be unsaturated, or supersaturated?

Answers

The grams of SO₂ that would be dissolved in 100 g of 40 degree water to make a saturated solution can be calculated by making solubility curve.

What is mass?

Mass is the quantity of matter of a physical body.

If you want to calculate the mass of Sulfur dioxide in 100 g of 40 degree, you have to make a solution curve.

With the increase in temperature, the solubility increases as well

Thus, the grams of SO₂ that would be dissolved in 100 g of 40 degree water to make a saturated solution can be calculated by making a solubility curve.

Learn more about mass

https://brainly.com/question/19694949

#SPJ1

Seat belts in cars help prevent passenger injuries that would otherwise occur as a result of passengers remaining in motion during a car’s abrupt stop. Which of these laws predicts that an unrestrained moving body will continue to move?

A. Law of inertia
B. Law of reflection
C. Law of universal gravitation
D. Law of conservation of momentum

Seat belts in cars help prevent passenger injuries that would otherwise occur as a result of passengers

Answers

It’s Newton’s first law of motion. Objects in motion will stay in motion unless another force is acted upon the object like the seat belt. But that’s not an answer so then I would say A because that’s the only answer that it could possibly be because inertia a law of movement and rest in physics.

solid copper deposits on a piece of aluminum foil when the foil is placed in a blue copper nitrate solution. the blue color of the solution fades.?trackid

Answers

The observed phenomena is the result of a chemical interaction between aluminium and copper nitrate. The following happens when aluminium is added to a copper nitrate solution: 2Al + 3Cu(NO3)2 -> 3Cu + 2Al(NO3) (NO3) 3.

The inorganic substance copper nitrate solution has the vivid blue chemical formula Cu(NO3)2. It dissolves easily in water and easily separates into copper (Cu2+) and nitrate (NO3-) ions in solution. Copper nitrate solution is frequently employed in industrial processes like electroplating and as a catalyst in organic synthesis as well as laboratory studies. Moreover, it is employed in the manufacturing of a number of copper-based products, including copper oxide, copper hydroxide, and copper carbonate. While highly reactive, copper nitrate solution can be hazardous if handled improperly, especially when it comes into touch with combustible materials as this could result in the production of explosive compounds. As a result, it needs to be handled carefully and in a controlled environment.

Learn more about copper nitrate solution here:

https://brainly.com/question/15088874

#SPJ4

What is the male sex cell that results from meiosis?

Answers

Answer: B) Sperm

Explanation:  For lazy gang wya Lol

Using the reaction below, how many molecules of lithium nitrate (LiNo3) will be needed to react with 2.35 grams of lead (IV) sulfate, Pb (SO4)2?equation in photo

Using the reaction below, how many molecules of lithium nitrate (LiNo3) will be needed to react with

Answers

From the reaction, each Pb(SO₄)₂ reacts with 4 LiNO₃.

So, first, we need to figure ot how many moles of Pb(SO₄)₂ we have in 2.35 grams.

For this, we need to use the molar masses of its elements to find its molar mass:

\(\begin{gathered} M_{Pb\mleft(SO_4\mright)_2}=1\cdot M_{Pb}+2\cdot(1\cdot M_S+4\cdot M_O)=(1\cdot207.2+2\cdot(1\cdot32.065+4\cdot15.9994))g\/mol \\ M_{Pb(SO_4)_2}=399.3252g\/mol \end{gathered}\)

Using it, we can calcualte the number of moles of Pb(SO₄)₂:

\(\begin{gathered} M_{Pb\mleft(SO_4\mright)_2}=\frac{m_{Pb\mleft(SO_4\mright)_2}}{n_{Pb\mleft(SO_{4}\mright)_{2}}} \\ n_{Pb\mleft(SO_4\mright)_2}=\frac{m_{Pb\mleft(SO_4\mright)_2}}{M_{Pb\mleft(SO_{4}\mright)_{2}}}=\frac{2.35g}{399.3252g\/mol}=0.005884\ldots mol \end{gathered}\)

Using the stoichiometry, we have:

LiNO₃ --- Pb(SO₄)₂

4 --- 1

\(\begin{gathered} \frac{n_{LiNO_3}}{4}=\frac{n_{Pb\mleft(SO_4\mright)_2}}{1} \\ n_{LiNO_3}=4\cdot n_{Pb\mleft(SO_4\mright)_2}=4\cdot0.005884\ldots mol=0.023539\ldots mol \end{gathered}\)

Now that we know the number of moles of LiNO₃, we can calculate how many LiNO₃ are needed by using the Avogadro's Number:

\(N_{LiNO_3}=N_A\cdot n_{LiNO_3}\)

Avogadro's Number is approximately 6.022 x 10²³ mol⁻¹, so, using this value, we have:

\(N_{LiNO_3}=6.022\times10^{23}mol^{-1}\cdot0.023539\ldots mol=1.41756\ldots\times10^{22}\approx1.42\times10^{22}\)

So, we need approximately 1.42 x 10²² LiNO₃.

How many methane molecules could form from these reactants? limiting reactants gizmo answers

Answers

Answer:

Explanation:not

Intrinsic motivation reflects desires that others have.
T or F

Answers

it is false...........

compare the size of ions to the size of atoms from which they form

Answers

Cations are always smaller than the atoms from which they form. Anions are always larger than the atoms from which they form. Ions are usually bigger than the atoms from which they are formed.

When an atom receives or loses electrons, the atom's electron configuration changes, resulting in a net positive or negative charge.

This net charge expands the electron cloud surrounding the nucleus, making the ion bigger in size than the neutral atoms from which it arose. When a metal atom loses one or more electrons to create a cation, it shrinks in size because the positive charge of the nucleus pulls the remaining electrons more strongly.

When a nonmetal atom obtains one or more electrons to create an anion, it normally expands in size.Because of the increasing amount of electrons, the electron cloud surrounding the nucleus grows. It should be noted that this comparison is not absolute and is dependent on the individual factors involved. Some ions are smaller than their neutral atom counterparts, while others are similar in size.

learn more about atoms  here:

https://brainly.com/question/29695801

#SPJ4

The complete question is:

Compare the size of ions to the size of atoms from which they form.

how many grams of baf2 are dissolved in 75.0 ml of a saturated solution of baf2? ksp = 1.00 x 10-6

Answers

Using the solubility product of the saturated solution, the mass of BaF2 dissolved is 0.083 g.

The equation of the reaction is obtained from;

BaF2(s) ⇄ Ba^+(aq) + F^-(aq)

The concentration of the substance can be obtained from the Ksp as follows;

Ksp = [Ba^2+] [2F^-]^2

Ksp = 4x^3

x = ∛Ksp/4

x = ∛ 1.00 x 10-6/4

x = 6.3  x 10^-3 M

Given that;

mass/molar mass = concentration x  volume

molar mass  = 175 g/mol

concentration  = 6.3  x 10^-3 M

volume = 75.0 ml or 0.075 L

Mass = ?

Mass  = concentration x  volume x molar mass

Mass  = 6.3  x 10^-3 M x  0.075 L x   175 g/mol

Mass = 0.083 g

Learn more about solubility product: https://brainly.com/question/857770

Which describes the molecule shown below?
O A. Unsaturated alkyne
O B. Saturated alkane
O C. Saturated alkene
O D. Unsaturated alkane

Which describes the molecule shown below?O A. Unsaturated alkyneO B. Saturated alkaneO C. Saturated alkeneO

Answers

The description of the molecules shown is it is unsaturated alkynes. The correct option is A.

What are unsaturated alkynes?

Alkynes are unsaturated double bond containing compound that react with hydrogen when a catalyst is present.

The pie bond shows that the hydrogen atoms are lost from the alkanes.

Thus, the correct option is A, unsaturated alkynes.

Learn more about unsaturated alkynes

https://brainly.com/question/23508203

#SPJ2

1. You may be using medium for shoot regeneration from leaf explants of a plant in Expt-5. The plant media may contain the plant growth regulators (hoones) BA and NAA. The molecular weight of BK is 72 A : and NAA is 186. The media is pH to 5.8. (a) Before making the plant media, you found the pH to be 3.6. What would you add quiekly to get it to a pH of 5.8 (give a specific name of the solution)? Why? (1 pt) (b) How much BA will be weighed fot a 1M solution? (Y po) (c) Convert your answer from (b) to mg/ml. (Y/ pt) (d) Convert your answer from (c) to mg 1 . (1 pt) (e) How much BA will be weighed for a 5mM solution? (1/4pt) (f) Convert your answer from (c) to mg/ml. ( /4pt ) (g) Convert your answer from (f) to mg/L. (H/ pt) (h) Your stock solution of BA is 5mM and your working solution is 0.2mg/.. What volume of the stoc be added to 250ml of medium? [Hint: fook at the previous answers Keep to 4 decimal pts.) (3 pts Convert your answer from (h) to μI, and which pipettor will you use to aliquot the B. A? (1 pt)

Answers

(a) To get the pH of the media to 5.8, you would add NaOH solution. NaOH is used as a basic solution, and when it is added to a solution, it will increase the pH of the solution.

(b) The molecular weight of BA is 225.3. To prepare a 1M solution, you would have to weigh out 225.3 grams of BA.(c) To convert a 1M solution of BA to mg/mL, you can use the following equation: 1 mole = molecular weight in grams; 1000 millimoles = 1 mole. So, 1 M = 1000 mg/mL. Therefore, a 1M solution of BA is equivalent to 1000 mg/mL .(d) To convert a concentration of 1000 mg/mL .

Therefore, to calculate the weight required for a 5 mM solution, use the following formula :Mass of BA = molarity × volume × molecular weight= 5 × 0.001 × 225.3= 1.1265 grams(f) To convert a concentration of 5 mM to mg/mL, we use the following formula: Concentration (mg/mL) = (Concentration (mM) × Molecular weight) / 1000= (5 × 225.3) / 1000= 1.1265 mg/mL(g)

To convert a concentration of 1.1265 mg/mL to mg/L, we multiply by 1000, so 1.1265 mg/mL = 1126.5 mg/L.(h) Given that the stock solution of BA is 5 mM and the working solution is 0.2 mg/mL.

To know more about increase visit:

brainly.com/question/19383315

#SPJ11

you dissolve of the aminoacid leucine in a solution with . select the structure of the predominant form of the amino acid in solution?

Answers

Option a. CH, NH, CH, H-O. O. The predominant form of leucine in a physiological buffer with pH 7.40 is its zwitterionic form.

The predominant form of the amino acid leucine in a buffer with physiological pH (7.40) would be in its zwitterionic form, also known as the dipolar ion.

In this form, the amino group (-NH3+) is protonated and the carboxyl group (-COO-) is deprotonated, resulting in a molecule with both positive and negative charges. This zwitterionic form is more stable than the neutral or charged forms of the amino acid in aqueous solution due to the interactions between the charged functional groups.

The specific structure of leucine in its zwitterionic form can be represented as NH3+CH(CH3)CH2CH(NH2)COO-. Therefore, the answer would be option (a) CH3CH(NH3+)CH2COO-.

To learn more about predominant form, refer:

https://brainly.com/question/30781791

#SPJ4

The complete question is:

You dissolve 0.1 mol of the amino acid leucine in a buffer with physiological pH (7.40) and make 1L of solution. Select the structure of the predominant form of the amino acid in solution? NH, но, Q-COOH a-NH3 Leucine pl 2.32 9.58 ΝΗ, CH O (a) CH, NH, CH, H-O. O (b) wy CH ΝΗ, CH H-O O(C) CH NH' CH, O (d) yer CH

1.) Uranium is breaking down at a half-life rate of 10 minutes. It begins this decay at a mass of 48g and it takes 78 minutes to complete. How much Uranium is left after decay?

2.) Ra-226 has a half-life of 1,600 years. 14.0g of it takes 300 years to decay. What quantity is left after 300 yr?

3.) The half-life of Po-218 is 3 minutes. After 15 minutes Po-218 is finished decaying and there is only 0.625g left. How much Po-218 did you start with?

4.) A 32g sample of Curium-247 will break down in 6 half lives to make 0.5g of it. It has a half-life of 1.5 million years. How long does this take? Slide 13.

Show all Work and solve by using this Forumla:
N(t) = No(1/2) t/ t 1/2
Calculate for H to find the amount of half-lives before solving for N values.

Answers

The half life of uranium is 10 minutes. Then, the 48 g of uranium sample will decay to 0.21 g after 78 minutes.

What is radioactive decay ?

Heavy unstable radioactive isotopes undergo nuclear decay by the emission of charged particles. The nuclear decay is a first order reaction.

thus, decay constant k = 1/t ln W0/Wt.

The half life time of the sample = 10 minute.

decay constant = 0.693/ t1/2

k = 0.693/10 = 0.069 min⁻¹

then,W0 = 48 g

we have to find the amount  Wt.

time of decay t = 78 min

ln 48 g/Wt =  0.069 min⁻¹ × 78 min

Wt = 0.12 g.

Therefore, the mass of uranium sample left after the decay will be 0.12 g.

Find more on radioactive decay:

https://brainly.com/question/1770619

#SPJ1

what is the stoichiometry for the cobalt (iil) glycinate complex? explain the thinking behind having the conoentration of glycinate be more than 4 times greater than the concentration of cobalt ion

Answers

Glycinate donates an electron pair so it is a bidentate ligand.

The molecular formula is C₂H₄NO₂⁻. The octahedral complex is formed between glycinate molecules and cobalt(III) and the stoichiometry of the complex is [Co(gly)₃]. The reaction is as follows;

Co₃⁺(aq) + 3C₂H₄NO₂⁻ ⇒ [Co(C₂H₄NO₂⁻](aq)

A cobalt complex is formed when 3 glycinate ions equivalents react with one Co₃⁺ ion equivalent so, it is necessary to keep the glycinate ions concentration greater than the cobalt(III) ions at least three times more.

So, taking the concentration 4 times greater can facilitate the reaction.

For a complex whose concentration is 0.015M, 0.06M glycinate ions are required to obtain the desired cobalt(III) glycinate complex.

You can learn more about glycinate complex from the following answer;

https://brainly.com/question/28285145

#SPJ4

How much energy is required to vaporize 18.32 grams of water at its boiling point?​

Answers


That is, water has a high heat of vaporization, the amount of energy needed to change one gram of a liquid substance to a gas at constant temperature. Water's heat of vaporization is around 540 cal/g at 100 °C, water's boiling point.

LITHIPODIUS NULLA

Which members of the population are the most adapted? Least adapted?

Answers

Answer:According to the Darwin’s theory “ the survival of the fittest” , any organism would survive through the process of natural selection by  adapting itself  to the changing environment in order to become the fittest among all of its native species.  

Thus, in order to survive even after some major environmental changes, an organism is required to adapt to the new conditions.  

Hence, option 2 is the correct answer which talks about adaptation as per the changing environmental condition

Explanation:

what is the importance of polar covalent and hydrogen bonds in the structure of water?​

Answers

Answer:

Water is a remarkable substance, and its unique properties are largely due to the presence of polar covalent bonds and hydrogen bonds in its structure. These characteristics play a crucial role in the physical and chemical properties of water, making it essential for life as we know it.

Explanation:

The polar covalent bonds in water arise from the unequal sharing of electrons between oxygen and hydrogen atoms. This results in the oxygen atom having a partial negative charge (δ-) and the hydrogen atoms having partial positive charges (δ+). These charges create polarity within the water molecule, leading to the formation of hydrogen bonds.

Hydrogen bonds occur when the partially positive hydrogen atom of one water molecule is attracted to the partially negative oxygen atom of another water molecule. These hydrogen bonds are relatively weak individually, but when present in large numbers, they contribute to the cohesion, surface tension, and high boiling point of water.

The importance of these bonds is manifold. The cohesion between water molecules due to hydrogen bonding enables water to form droplets, have a high surface tension, and flow freely, facilitating transport within organisms and in the environment. Additionally, hydrogen bonding leads to the high specific heat capacity and heat of vaporization of water, making it an effective regulator of temperature in living organisms and ensuring stable environmental conditions.

Furthermore, hydrogen bonds play a crucial role in the unique properties of water as a solvent. The polar nature of water allows it to dissolve a wide range of substances, including ionic compounds and polar molecules, facilitating various biological processes such as nutrient transport and chemical reactions in cells.