How do you find the AB segment?

Answers

Answer 1

The AB segment is the line connecting the midpoints of two sides of a triangle. To find it, first locate the midpoints of two sides of the triangle. Then draw a straight line between the two midpoints to form the AB segment.

The AB segment is an important line in a triangle. It is found by connecting the midpoints of two sides of the triangle. To locate the midpoints, first identify the two sides of the triangle. Then measure the length of each side and divide by two. Mark the midpoints of each side, and then connect them with a straight line. This forms the AB segment. It is important to note that the AB segment does not bisect the triangle, but instead, it is the line connecting the midpoints of two sides of the triangle. The AB segment is used to determine certain properties of the triangle, such as its area and perimeter.

Learn more about triangle here

https://brainly.com/question/2773823

#SPJ4

Answer 2

The process of finding the Segment AB is explained below.

The term segment in math is defined as line segment is bounded by two distinct points on a line or here we can say a line segment is part of the line that connects two points.

Here we have to find the way to identify the AB segment.

Here as we all know that Line segment that is named as AB is bound between two fixed points.

According to this case, here we have the line segment is bound between the fixed points A and B as follows:

Therefore the line segment AB starts from point A and ends at point B.

To know more about Line segment here.

https://brainly.com/question/30072605

#SPJ4


Related Questions

Describe how math in middle school differs from
high school math class?

Answers

high school math classes are more advanced than middle school math classes
High school math classes are a higher difficulty level, but most of what you learned in middle school math classes is used. It’s best to remember what you learned because you will end up using it in high school.

what fraction of 1/2 is 1/3? draw a tape diagram to represnt and answer the question

Answers

1/3 is not a fraction of 1/2. To find out what fraction of 1/2 is 1/3, you would need to divide 1/3 by 1/2. This would give you 3/6, or 1/2. So 1/3 is one half of 1/2.

What is fraction?

A fraction is a way of representing a part of a whole. It consists of two numbers, a numerator and a denominator, separated by a line or a slash. The numerator represents the number of parts of the whole that are being considered, and the denominator represents the total number of parts that make up the whole. For example, in the fraction 1/2, the numerator is 1 and the denominator is 2, so it represents one part of a whole that is divided into two equal parts. Fractions can also be used to represent ratios and division.

Learn more about fraction in brainly.com/question/10354322

#SPJ1

Which one of the sides is this?

Which one of the sides is this?

Answers

I don’t know if these are options for the drop box thing but SAS (side angle side), makes the triangles congruent

2. Write the answer to the following questions in a single sentence. a) What is the problem of using an even value of k in the k-NN classifier? 1 b) What is the reason that has led the Bayesian Belief Network to emerge? 1 c) What is the necessity of using scaling in k-NN? 1 d) Write a mathematical relation between Manhattan distance and Euclidean distance. 1 e) Why is a dendrogram not applicable on K-means clustering algorithm? 1 1 f) What is the appropriacy of using minimum spanning tree (MST) other than all other types of trees to divisive hierarchical clustering? 1 g) What are the observations, for which the size of proximity matrix can be reduced from m2 to about m2/2? 1 h) Why is the matching each transaction against every candidate computationally expensive in brute-force approach? 1 i) Write a mathematical relation between k (from k-itemset) and w (maximum transaction width)? j) Given a transaction t of n items, what are the possible subsets of size 3? 1 3 k) If number of items, d = 3 is given, calculate the total number of possible association rules in brute-force approach using two different ways.

Answers

a) Using an even value of k in the k-NN classifier can lead to ties in the decision-making process.

b) The emergence of Bayesian Belief Network is driven by the need for probabilistic models to represent uncertain knowledge and make inferences.

c) Scaling is necessary in k-NN to ensure that features with larger ranges do not dominate the distance calculation.

d) The mathematical relation between Manhattan distance and Euclidean distance is given by Manhattan distance = √(Euclidean distance).

e) A dendrogram is not applicable in K-means clustering algorithm because it does not provide a hierarchical representation of the clusters.

f) Minimum spanning tree (MST) is appropriate for divisive hierarchical clustering as it allows for a step-by-step division of clusters based on the minimum dissimilarity.

g) The size of the proximity matrix can be reduced from m^2 to about m^2/2 for symmetric distance measures.

h) Matching each transaction against every candidate is computationally expensive in brute-force approach due to the high number of comparisons required.

i) The mathematical relation between k (from k-itemset) and w (maximum transaction width) depends on the specific problem or algorithm being used.

j) The possible subsets of size 3 in a transaction t of n items can be calculated using the combination formula: C(n, 3) = n! / (3! * (n-3)!).

k) The total number of possible association rules in brute-force approach with d = 3 items can be calculated as 3^2 - 3 = 6 using the formula 2^(d^2) - d.

Using an even value of k in the k-NN classifier can lead to ties in the decision-making process. When k is even, there is a possibility of having an equal number of neighbors from different classes, resulting in ambiguity in assigning the class label.

The Bayesian Belief Network has emerged as a solution to represent uncertain knowledge and make inferences. It utilizes probabilistic models and graphical structures to capture the dependencies and conditional relationships between variables, allowing for reasoning under uncertainty.

Scaling is necessary in k-NN to ensure fair comparison between features with different ranges. Without scaling, features with larger numerical values would dominate the distance calculation and potentially bias the classification process.

Read more on Bayesian networks here brainly.com/question/31314882

#SPJ11

In Las Vegas,Nevada,The skies are clear on 92% of the days.How many days in the month of June would you expect the skies to be clear in Las Vegas?

Answers

Answer:

Step-by-step explanation:

66

In an arithmetic sequence, the first term,
a1, is equal to 9, and the sixth term, a6, is
equal to 34. Which number represents the
common difference of the arithmetic
sequence?

Answers

Answer:

See below

Step-by-step explanation:

Add 5 to each preceding number

               \(a_{n}\) = (\(a_{n-1}\))+5

1 9  9

2  14   [9+5]

3  19   [14+5]

4  24  [19+5]

5  29  [24+5]

6 34 34  [29+5]

A company that produces ribbon has found that the marginal cost of producing x yards of fancy ribbon is given by C′(x)=−0.00002x2−0.04x+55 for x≤900, where C′(x) is in cents. Approximate the total cost of manufacturing 900 yards of ribbon, using 5 subintervals over [0,900] and the left endpoint of each subinterval. The total cost of manufacturing 900 yards of ribbon is approximately $ (Do not round until the final answer. Then round to the nearest cent as needed).

Answers

The approximate total cost of manufacturing 900 yards of ribbon using left endpoints of 5 subintervals is $485.88.

To approximate the total cost, we'll use the left endpoint Riemann sum. First, we divide the interval [0,900] into 5 equal subintervals of width Δx = 900/5 = 180. Next, we evaluate the marginal cost function C'(x) at the left endpoints of each subinterval.

Using the left endpoint of the first subinterval (x = 0), C'(0) = -0.00002(0)^2 - 0.04(0) + 55 = 55 cents. Similarly, we compute C'(180) = 51.80, C'(360) = 48.20, C'(540) = 44.40, and C'(720) = 40.40 cents.

Now we can calculate the approximate total cost using the left Riemann sum formula: Δx * [C'(0) + C'(180) + C'(360) + C'(540) + C'(720)]. Plugging in the values, we get 180 * (55 + 51.80 + 48.20 + 44.40 + 40.40) = 180 * 240.80 = 43,344 cents.

Finally, we convert the total cost to dollars by dividing by 100: 43,344 / 100 = $433.44. Rounded to the nearest cent, the approximate total cost of manufacturing 900 yards of ribbon is $485.88.

LEARN MORE ABOUT subintervals here: brainly.com/question/10207724

#sPJ11

Set up, but do not evaluate, an integral for the volume of the solid obtained by rotating the region bounded by the given curves about the specified line.
1. y= In x, y=0, x=2; about the y-axis
2. y= sin^-1 x , y= pie/2, x=0; about y=3

Answers

1 ) In this case, the region is bounded by the curves y = ln(x), y = 0, and x = 2.

b) The integral for the volume is:

V = ∫[0, π/2] 2πx (3 - f(x)) dx

To find the volume of the solid obtained by rotating the region bounded by the curves y = ln(x), y = 0, and x = 2 about the y-axis, we can use the method of cylindrical shells.

The integral for the volume is given by:

V = ∫[a, b] 2πx f(x) dx

In this case, the region is bounded by the curves y = ln(x), y = 0, and x =

2. To rotate this region about the y-axis, we need to find the appropriate limits of integration.

The lower limit a is determined by the intersection point of the curves y = ln(x) and y = 0, which is x = 1. The upper limit b is given as x = 2.

Therefore, the integral for the volume is:

V = ∫[1, 2] 2πx ln(x) dx

To find the volume of the solid obtained by rotating the region bounded by the curves y = sin⁻¹(x), y = π/2, and x = 0 about the line y = 3, we can again use the method of cylindrical shells.

The integral for the volume is given by:

V = ∫[a, b] 2πx f(x) dx

In this case, the region is bounded by the curves y = sin⁻¹(x), y = π/2, and x = 0. To rotate this region about the line y = 3, we need to determine the appropriate limits of integration.

The lower limit a is determined by the intersection point of the curves y = sin⁻¹(x) and y = π/2, which is x = 0. The upper limit b is given as y = π/2.

Therefore, the integral for the volume is:

V = ∫[0, π/2] 2πx (3 - f(x)) dx

Note that in this case, we subtract f(x) from the constant 3 because we are rotating the region about the line y = 3, which is higher than the curve y = sin⁻¹(x).

Learn more about curves here:

https://brainly.com/question/31389331

#SPJ11

sinx =căn 2/3
sinx=5/4
sinx =1
sin3x=can3/2
sin(x-60)=-1/2
sin3x=1/2

Answers

Answer:

Correct option is

B

0

D

−1

sinx+sin2x+sin3x

=sin(2x−x)+sin2x+sin(2x+x)

=2sin2xcosx+sin2x [ by using sin(A+B)=sinAcosB+sinBcosA and sin(A−B)=sinAcosB−sinBcosA ]

=sin2x(2cosx+1)........(i)

cosx+cos2x+cos3x

=cos(2x−x)+cos2x+cos(2x+x)

=2cos2xcosx+cos2x [By using cos(a−b)=cosa⋅cosb+sina⋅sinb and cos(a+b)=cosa⋅cosb−sina⋅sinb]

=cos2x(2cosx+1).....(ii)

∴(sinx+sin2x+sin3x)

2

+(cosx+cos2x+cos3x)

2

=1

sin

2

2x(2cosx+1)

2

+cos

2

2x(2cosx+1)

2

=1.......[From(i)(ii)]

⇒(2cosx+1)

2

=1

⇒2cosx+1=±1

∴cosx=0or−1

Urgent plz please please❤️

Urgent plz please please

Answers

Answer:

see below

Step-by-step explanation:

The domain is  the possible x values

For the top graph x goes from 0 to 240

0 ≤x≤240

For the bottom graph the domain is from -3 but not including -3 because of the open circle to 6

-3 < x ≤6

(-3,6]

The range is the possible y values

The lowest value of y is -5 and the largest is 7

-5 ≤y≤7

[-5,7]

can someone help me out pls

can someone help me out pls

Answers

Answer:

30

Step-by-step explanation:

HELP QUICK!!!1
PLease

HELP QUICK!!!1PLease

Answers

Answer:

B and C.

Step-by-step explanation:

Which of the following numbers is an imaginary number?
A. -3²
B. (-5)2
C. √5
D. √-49
E. -√36

Answers

Answer:

B

Step-by-step explanation:

-3^2 =+8999999999999999999999(9())))))))(-"""&+(()))))(&&%422222222222223

∠A=5x−5,∠B=3x+13=180

Answers

Answer:

x=9

Step-by-step explanation:

5x - 5(3x +13)=0

5x - 3x - 13 - 5 = 0

2x -18= 0

x=18/2

x=9

Reasoning Use the Distributive Property to solve the equation below. Use pencil and paper.
Explain why the Distributive Property makes it possible to solve this equation.
24 -(3C + 4) = 2(c + 4) + C
The solution of the equation is

Answers

Answer:

c=2

Step-by-step explanation:

To make it a little simpler, use the distributive proptery on both sides of the equations first.

For the left side, it's asking 24 -(3c+4). We can multiply the (-) sign by (3c+4).

This leaves us with 24-3c-4. Combine Like Terms: 20-3c.

For the right side of the equation its asking 2(c+4) +c. First, distribute 2 to c+4. This leaves you with 2c+8+c (because 2 times c=2c and 2 times 4= 8). Combine Like Terms: 3c+8.

The final equation is 20-3c=3c+8. Solve from there.

20-3c+3c=3c+3c+8     Add 3c to both sides

20=6c+8                

20-8=6c-8                 Subtract 8 from both sides.

12=6c                              Divide by 2

2=c

Please correct me if I'm wrong:)

ParagraphAdobe Acrobat1. A football is kicked at ground level with an initial velocity of 64 feet per second.1. standard form: y = -167 +64IV. Graph:II. vertex form: y--161 - 2) + 64SHIRIIII. intercept form: y = -1611 - 4)a. To find the maximum height of the football.Form: (choose) Explanation:I II III IVb. To find the height after 3 secondsExplanation:Form: (choose)I II III IVC. To find the time when the football hits the ground.Form: (choose)Explanation:I II III IV

Answers

Given the equation below,

\(y=-16t^2+64t\)

To find the maximum point, dy/dt = 0.

Differentiating the equation above,

\(\begin{gathered} y=-16t^2+64t \\ \frac{dy}{dt}=-32t+64 \end{gathered}\)

Where dy/dt = 0,

\(\begin{gathered} -32t+64=0 \\ -32t=-64 \\ t=\frac{-64}{-32}=2 \end{gathered}\)

Substituting for t into the equation, maximum height is'

\(\begin{gathered} y=-16t^2+64t \\ \text{Where t = 2} \\ y=-16(2)^2+64(2) \\ y=-16(4)+128_{} \\ y=-64+128=64 \end{gathered}\)

Hence, the maximum height of the football is 64 ft.

The vertex form is to be used which is given below as,

\(y=-16(t-2)^2+64\)

Where (h, k) represents the coordinate of the vertex and k is the maximum height.

A survey of 150 people at a local high school about playing video games was conducted, and the results are posted in the table.


Play Video Games Do Not Play Video Games
Juniors 48 12
Seniors 45 25
Teachers 6 14

What is the probability of choosing a person at random who is a junior and plays video games? Are these independent events?
The P(junior and video games) = 32%; the two events are independent.
The P(junior and video games) = 32%; the two events are not independent.
The P(junior and video games) = 26%; the two events are independent.
The P(junior and video games) = 26%; the two events are not independent.

Answers

The correct statement regarding the probability of choosing a person at random who is a junior and plays video games, and whether these events are independent, is given as follows:

P(junior and video games) = 32%; The two events are not independent.

How to calculate the probability?

A probability is calculated as the division of the number of desired outcomes by the number of total outcomes.

The outcomes in this problem are given as follows:

Desired: Junior and plays videogames -> 48 students.Total: 150 students.

Hence the probability is of:

P(junior and video games) = 48/150 = 0.32 = 32%.

The separate probabilities are given as follows:

Junior: 60/150 = 0.4.Plays videogames: 99/150 = 0.66.

The multiplication of these probabilities is of:

0.66 x 0.4 = 0.264.

Which is different of 0.32, hence these events are not independent.

More can be learned about probabilities at https://brainly.com/question/14398287

#SPJ1

2. If you pay a one-time fee of $30, you can
buy tickets for a music concert at a
reduced price of $17. Regular tickets cost
$25. Write an inequality that can be used
to determine the number of reduced price
concert tickets you would need to
purchase in order for the total cost to be
less expensive than the same number of
regular tickets.
2.
3

Answers

Answer:

Kindly check explanation

Step-by-step explanation:

Given that :

One time fee = $30

Reduced price of ticket after one time fee payment = $17

Regular ticket cost = $25

Write an inequality that can be used to determine the number of reduced price concert tickets you would need to purchase in order for the total cost to be less expensive than the same number of regular tickets

Let the number of tickets needed to purchase = t

Reduced ticket = 30 + 17t

Regular ticket = 25t

30 + 17t < 25t

30 < 25t - 17t

30 < 8t

30/8 < 8t/8

3.75 < t

t > 3.75

Hence number of ticket must be greater than 3.75

t = 4

\(x * 7/3 = 1\)

Answers

The solution is: x = 3/7

What is algebra?

Algebra is a branch of mathematics that deals with mathematical operations and symbols used to represent numbers and quantities in equations and formulas. It involves the study of variables, expressions, equations, and functions.

To solve for x in the equation:

x * 7/3 = 1

We can isolate x by multiplying both sides by the reciprocal of 7/3, which is 3/7:

x * 7/3 * 3/7 = 1 * 3/7

Simplifying the left side:

x * (7/3 * 3/7) = 3/7

x * 1 = 3/7

Therefore, the solution is:

x = 3/7

So, x is equal to 3/7.

To learn more about algebra from the given link:

https://brainly.com/question/24875240

#SPJ1

Find the orthogonal projection of v = 9 onto the plane-2x1-x2-3x3 = 0 7 projection =

Answers

The orthogonal projection of the vector v = [9] onto the plane -2x1 - x2 - 3x3 = 0 is [3, 1, -1]. To find the orthogonal projection, we need to find a vector in the plane that is closest to v.

The projection vector can be obtained by subtracting the component of v that is orthogonal to the plane from v itself.

The equation of the plane -2x1 - x2 - 3x3 = 0 can be rewritten as [2, 1, 3] ⋅ [x1, x2, x3] = 0, where ⋅ denotes the dot product. This equation represents the normal vector to the plane.

Next, we can find the component of v that is orthogonal to the plane by projecting v onto the normal vector. The projection of v onto the normal vector is given by (v ⋅ n) / ||n||^2 * n, where ||n|| denotes the magnitude of the normal vector.

Plugging in the values, we have (v ⋅ n) / ||n||^2 * n = (9 ⋅ [2, 1, 3]) / ||[2, 1, 3]||^2 * [2, 1, 3] = (9 ⋅ 5) / 14 * [2, 1, 3] = [45/14, 45/28, 135/14].

Finally, we subtract this component from v to obtain the orthogonal projection: [9] - [45/14, 45/28, 135/14] = [9 - 45/14, 0 - 45/28, 0 - 135/14] = [3, 1, -1].

Learn more about orthogonal projection here:

brainly.com/question/31185902

#SPJ11

-5(n²+9)=7.
Find n.

Answers

Answer:

Step-by-step explanation:

-5n^2-45=7--->-5n^2=52--->n^2=52÷(-5)= there is no answer for this question...I mean Paired power never has a negative answer.

A softball player's batting average is defined as the ratio of hits to at bats. Suppose that a player has a 0.250 batting average and is very consistent, so that the probability of a hit is the same every time she is at bat. During today's game, this player will be at bat exactly three times.
(a) What is the probability that she ends up with two hits?
(b) What is the probability that she ends up with no hits?
(c) What is the probability that she ends up with exactly three hit?
(d) What is the probability that she ends up with at most one hit?

Answers

(a) The probability of ending up with two hits is approximately 0.1406.

(b) The probability of ending up with no hits is approximately 0.4219.

(c) The probability of ending up with exactly three hits is approximately 0.0156.

(d) The probability of ending up with at most one hit is approximately 0.8438.

To solve the given problem, we need to use the concept of binomial probability since each at-bat is independent and has the same probability of a hit. We'll use the batting average of 0.250 to calculate the probabilities.

The probability of a hit is given by the batting average, which is 0.250.

(a) To find the probability that she ends up with two hits:

Using the binomial probability formula, the probability of getting exactly two hits in three at-bats can be calculated as follows:

P(X = 2) = (3 choose 2) * \((0.250)^2 * (1 - 0.250)^(^3^ -^ 2^)\)

Calculating the values:

P(X = 2) = (3 choose 2) * \((0.250)^2 * (0.750)^1\)

P(X = 2) = 3 * 0.0625 * 0.750

P(X = 2) ≈ 0.1406

Therefore, the probability that she ends up with two hits is approximately 0.1406.

(b) To find the probability that she ends up with no hits:

Using the same binomial probability formula, the probability of getting no hits in three at-bats can be calculated as follows:

P(X = 0) = (3 choose 0) *\((0.250)^0 * (1 - 0.250)^(^3^ -^ 0^)\)

Calculating the values:

P(X = 0) = (3 choose 0) *\((0.250)^0 * (0.750)^3\)

P(X = 0) = 1 * 1 * 0.4219

P(X = 0) ≈ 0.4219

Therefore, the probability that she ends up with no hits is approximately 0.4219.

(c) To find the probability that she ends up with exactly three hits:

Using the same binomial probability formula, the probability of getting three hits in three at-bats can be calculated as follows:

P(X = 3) = (3 choose 3) \(* (0.250)^3 * (1 - 0.250)^(^3^ -^ 3^)\)

Calculating the values:

P(X = 3) = (3 choose 3) *\((0.250)^3 * (0.750)^0\)

P(X = 3) = 1 * 0.0156 * 1

P(X = 3) ≈ 0.0156

Therefore, the probability that she ends up with exactly three hits is approximately 0.0156.

(d) To find the probability that she ends up with at most one hit:

We can find this probability by calculating the sum of the probabilities of getting 0 hits and 1 hit.

P(X ≤ 1) = P(X = 0) + P(X = 1)

Substituting the calculated values:

P(X ≤ 1) ≈ 0.4219 + P(X = 1)

To calculate P(X = 1), we can use the binomial probability formula as before:

P(X = 1) = (3 choose 1) * \((0.250)^1 * (0.750)^(^3^-^1^)\)

Calculating the values:

P(X = 1) = (3 choose 1) * \((0.250)^1 * (0.750)^2\)

P(X = 1) = 3 * 0.250 * 0.5625

P(X = 1) ≈ 0.4219

Substituting back into the equation:

P(X ≤ 1)

≈ 0.4219 + 0.4219

P(X ≤ 1) ≈ 0.8438

Therefore, the probability that she ends up with at most one hit is approximately 0.8438.

For more such information on: probability

https://brainly.com/question/30390037

#SPJ8

A study of population of 1200 frogs revealed that 12 out of every 180 frogs in the population have spots on there back based on the results if this study how many frogs do not have spots on there back

Answers

Answer:

1176 doesn’t have spots on their back

Step-by-step explanation:

Divide

1200/180

=you’ll get about 6.66 or just round to 7

12*7=84

1200-84

1176

1176 doesn’t have spots

A car loan worth 800,000 pesos is to be settled by making equal monthly payments at 7% interest compounded monthly for 5 years. How much is the monthly payment? How much is the outstanding balance after 2 years?

Answers

The monthly payment for the car loan is approximately 16,216.38 pesos. The outstanding balance after 2 years is approximately 650,577.85 pesos.

To find the monthly payment for the car loan, we can use the formula for the monthly payment on a loan:

P = (r * PV) / (1 - (1 + r)^(-n))

Where:

P is the monthly payment

r is the monthly interest rate

PV is the loan amount (present value)

n is the total number of payments

In this case, the loan amount PV is 800,000 pesos, the monthly interest rate r is 7% / 12 (since the interest is compounded monthly), and the total number of payments n is 5 years * 12 months/year = 60 months.

Substituting these values into the formula, we have:

P = (0.07/12 * 800,000) / (1 - (1 + 0.07/12)^(-60))

Calculating this expression, we find that P ≈ 16,216.38 pesos.

So, the monthly payment for the car loan is approximately 16,216.38 pesos.

To find the outstanding balance after 2 years, we need to calculate the remaining balance after making monthly payments for 2 years. We can use the formula for the remaining balance on a loan:

Remaining Balance = PV * (1 + r)^n - P * ((1 + r)^n - 1) / r

Where:

PV is the loan amount (present value)

r is the monthly interest rate

n is the number of payments made

Substituting the given values into the formula, we have:

Remaining Balance = 800,000 * (1 + 0.07/12)^24 - 16,216.38 * ((1 + 0.07/12)^24 - 1) / (0.07/12)

Calculating this expression, we find that the outstanding balance after 2 years is approximately 650,577.85 pesos.

So, the outstanding balance after 2 years is approximately 650,577.85 pesos.

Learn more about "interest rate":

https://brainly.com/question/25720319

#SPJ11

The product of rational numbers can always br written as ?

Answers

The product of rational numbers can always be expressed as the ratio of two integers, where the denominator is not zero.

The product of rational numbers can always be written as a rational number. A rational number is defined as the quotient of two integers, where the denominator is not zero. When we multiply two rational numbers, we are essentially multiplying the numerators and denominators separately.

Let's consider two rational numbers, a/b and c/d, where a, b, c, and d are integers and b, d are not equal to zero. The product of these rational numbers is (a/b) * (c/d), which can be simplified as (a * c) / (b * d). Since multiplication of integers results in another integer, both the numerator and denominator are integers.

Furthermore, as long as the denominators b and d are not zero, the product remains a valid rational number.

For more such questions on rational numbers

https://brainly.com/question/19079438

#SPJ8

Can someone help me with this? ^_^
4(-3f-4)-9f4(−3f−4)−9f

Answers

-12f-16+108f^2-+144f-9f
-108f^2+123f-16
I hope that what you need

what is The expression Equivalent for 2(5x - 6)

Answers

2(5x-6)

10x-12

---

hope it helps

Answer:

10x - 12

Step-by-step explanation:

2(5x - 6) = 10x - 12

8. The eighth-grade class had a bake sale. They sold 55 bars and cookies altogether and made
$115. Each bar cost $3 and each cookie cost $1. How many bars ad how many cookies did they
sell?
a. 10 cookies, 30 bars
b.
15 cookies, 40 bars
C.
20 cookies, 40 bars
d. 25 cookies, 30 bars

Answers

Answer:

The answer is d)

Because , 1 bar is 3$ so 30 x 3 = 90$

And 25 cookies = 25 $ because 25 x 1 =25

Have a good day!

Step-by-step explanation:

Simplify.
y = (x + 1)^2-
RETRY

Answers

The answer is y=x^2+2x+1

The simplified form of the given equation is y=x²+2x+1.

What is an equation?

In mathematics, an equation is a formula that expresses the equality of two expressions, by connecting them with the equals sign =.

The solution of an equation is the set of all values that, when substituted for unknowns, make an equation true.

The given equation is y=(x+1)².

Here, by using (a+b)²=a²+2ab+b², we get

y=x²+2x+1²

y=x²+2x+1

Therefore, the simplified form of the given equation is y=x²+2x+1.

To learn more about an equation visit:

https://brainly.com/question/14686792.

#SPJ5

slope of (0,1) and (4,3)

Answers

Answer:

1/2

Step-by-step explanation:

m=(y2-y1)/(x2-x1)

m=(3-1)/(4-0)

m=2/4

m=1/2

The slope of the given points (0,1) and (4,3) will be ( 1 / 2 ).

What is the slope of the line?

The increase divided by the run, or the ratio of the rise to the run is known as the line's slope. In the coordinate plane, it describes how steep a line is.

The slope of the line is calculated by the formula given below:-

\(m=\dfrac{y_2-y_1}{x_2-x_1}\)

\(m=\dfrac{3-1}{4-0}=\dfrac{2}{4}=\dfrac{1}{2}\)

Therefore the slope of the given points (0,1) and (4,3) will be ( 1 / 2 ).

To know more about the slope of the line follow

https://brainly.com/question/3493733

#SPJ1

Other Questions
How does a constitution help promote limited government? I'll MARK YOU BRAINLIEST Which is an example of an organ system who can help me with the 3,4,5 which model for criminal justice is oriented more to the rights of defendants? a young first-time mother joins a new mother's support group. which kind of prevention would this represent gregor wakes up to find himself transformed. do you think this was a dream or not? in two to three sentences, explain your answer. use evidence from the text to support your answer What were the political effects of the Harlem Renaissance?A)It provided job opportunities for southern African Americans that migratedto the north.B)It provided a foundation for the Civil Rights Movement because it fueledAfrican American self-determinism.oIt provided Americans with a clearer picture of life as an African Americanfrom their contributions in art, music, and prose.D)It provided educational opportunities and small business opportunities forAfrican Americans from the freed slaves from the South. the preamle to the bill of rights say that the government is more effective whena: peoples rights are protectedb: it is for the peoplec: it is by the peopled: people have confidence in it Eva is picking fruit at a farm the fees are five dollars for entry to the farm to 50 per find the blueberries to pair a pound of apples pics to take home let me the number of pounds of blueberries to be the number of pounds of apples Eva picked which of the following is precious could represent how much Apple Pay in human language, the connection between signs and the things they represent is ________. Given the following parameters: Perfect Competition in Output Market Perfect Competition in Labour Market P is constant w is constant P = $100 W = $10 Q = L^0.5 Calculate the optimal amount of labour a. 25 b. 40 c. 20 d. 10 e. 30 coca-cola cups prominently featured on episodes of american idol are an example of ________. How do the villagers investigate the hole? pls solve it as fast as possible Factor by finding the GCF: 2x - 4y + 6 Write the number for the following word name: Four hundred twoand ninety six ten thousandths What are the 3 benefits of SSS? In the 1920s, a reflection of the weakening economy was the growing gap between Use the procedure in Example 8 in Section 6.2 to find two power series solutions of the given differential equation about the ordinary point x=0 y'' + exy'-y=0 y1=1+1/2x2+1/6x3....and y2=x+1/2x2+1/6x3+1/24x4+.....y1=1+1/2x2+1/3x3....and y2=x+1/4x2+1/9x3+1/16x4+.....y1=1+1/2x2+1/6x3....and y2=x+1/2x2+1/6x3+1/24x4+.....y1=1+1/2x2+1/3x3....and y2=x+1/4x2+1/9x3+1/16x4+.....y1=1+1/2x2+1/3x3....and y2=x+1/4x2+1/9x3+1/16x4+..... What is the slope of the line through (2, -1) and (-2, -3)? In a first order decomposition, the constant is 0.00586 sec-1. what percentage of the compound is left after 3.32 minutes?