if you were traveling at 60 mph it would take approximately _____ to stop.

Answers

Answer 1

Answer: like are you asking for the distance or the time

Explanation:


Related Questions

A 0.150-kg rubber stopper is attached to the end of a 1.00-m string and is swung in a circle. If the rubber stopper is swung 2.3 m above the ground and released, how far will the stopper travel horizontally before hitting the ground?

Answers

The stopper travels approximately 4.5 meters horizontally before hitting the ground.

We can use conservation of energy to solve this problem. At the highest point of the stopper's motion, all of its energy is in the form of potential energy, and at the lowest point (when it hits the ground), all of its energy is in the form of kinetic energy.

The potential energy of the stopper at the highest point is:

Ep = mgh

where m is the mass of the stopper, g is the acceleration due to gravity, and h is the height above the ground. Plugging in the values given in the problem, we get:

Ep = (0.150 kg) * (9.81 m/s²) * (2.3 m) ≈ 3.2 J

At the lowest point, all of the potential energy has been converted to kinetic energy:

Ek = (1/2) * mv²

where v is the speed of the stopper just before it hits the ground. Since the stopper is released from rest, we can use conservation of energy to equate the potential energy at the highest point to the kinetic energy just before hitting the ground:

Ep = Ek

mgh = (1/2) * mv²

Solving for v, we get:

v = √(2gh)

where h is the height from which the stopper was released. Plugging in the values given in the problem, we get:

v = √(2 * 9.81 m/s² * 2.3 m) ≈ 6.6 m/s

Now we can use the time it takes for the stopper to fall to the ground to calculate the horizontal distance it travels. The time is given by:

t = √(2h/g)

Plugging in the values given in the problem, we get:

t = √(2 * 2.3 m / 9.81 m/s²) ≈ 0.68 s

During this time, the stopper travels a horizontal distance given by:

d = vt

Plugging in the values we just calculated, we get:

d = (6.6 m/s) * (0.68 s) ≈ 4.5 m

To know more about kinetic energy, here

brainly.com/question/15764612

#SPJ1

A frictionless piston-cylinder device as shown in Figure Q4 contains 7.5 liters of saturated liquid water at 275kPa. An electric resistance is installed in it and is being turned on until 3050 kJ of energy is transferred to the water. Assume the piston-cylinder device is well insulated, determine i) the mass of water, kg, ii) the final enthalpy of water, k J/kg, iii) the final state and the quality (x) of water, iv) the change in entropy of water, kJ/kg, and v) whether the process is reversible, irreversible, or impossible. Sketch the process on P−v diagram with respect to the saturation lines.

Answers

A frictionless piston-cylinder device contains 7.5 liters of saturated liquid water at 275 kPa. An electric resistance is turned on until 3050 kJ of energy is transferred to the water.

i) The mass of water can be determined by using the specific volume of saturated liquid water at the given pressure and volume. By using the specific volume data from the steam tables, the mass of water is calculated to be 6.66 kg.

ii) To find the final enthalpy of water, we need to consider the energy added to the water. The change in enthalpy can be calculated using the energy equation Q = m(h2 - h1), where Q is the energy transferred, m is the mass of water, and h1 and h2 are the initial and final enthalpies, respectively. Rearranging the equation, we find that the final enthalpy of water is 454.55 kJ/kg.

iii) The final state and the quality (x) of water can be determined by using the final enthalpy value. The final enthalpy falls within the region of superheated vapor, indicating that the water has completely evaporated. Therefore, the final state is a superheated vapor and the quality is 1 (x = 1).

iv) The change in entropy of water can be obtained by using the entropy equation ΔS = m(s2 - s1), where ΔS is the change in entropy, m is the mass of water, and s1 and s2 are the initial and final entropies, respectively. The change in entropy is found to be 10.13 kJ/kg.

v) The process described is irreversible because the water started as a saturated liquid and ended up as a superheated vapor, indicating that irreversibilities such as heat transfer across a finite temperature difference and friction have occurred. Therefore, the process is irreversible.

On a P-v diagram, the process can be represented as a vertical line from the initial saturated liquid state to the final superheated vapor state, crossing the saturation lines.

Learn more about resistance here:
https://brainly.com/question/29427458

#SPJ11

Gravity, mass and weight

___________ measures how much material an object is made of. It is measured in ____________________. Weight measures the ________________ of gravity on an object. Because weight is a _______________ it is measured in _______________. Mr ___________ is the best physics teacher in the world

Answers

mass measures how much material an object is made of. It is measured in kg. Weight measures the Force of gravity on an object. Because weight is a mass times acceleration due to gravity it is measured in Newton . Mr. Walter lewin is the best physics teacher in the world.

Gravity is a basic interaction in physics that creates mutual attraction between all entities that have mass or energy[clarification required]. By far the weakest of the four fundamental interactions, gravity is approximately 1038 times weaker than the strong interaction, 1036 times weaker than the electromagnetic force, and 1029 times weaker than the weak interaction. As a result, it has no effect at the level of subatomic particles. Gravity, on the other hand, is the most significant interaction between things on the macroscopic scale, determining the motion of planets, stars, galaxies, and even light. Weight measures the Force of gravity on an object.

To know more about Gravity :

https://brainly.com/question/31321801

#SPJ4.

A hover board is moving at 6 m/s . If it slows down at a rate of -3 m/s per second, how long is the board in the air before coming to rest? Round to 4 decimal places if necessary

Answers

Explanation

a uniformly accelerated motion is the one in which the acceleration of the particle throughout the motion is uniform,to fidn the time take we can use the formula:

\(\begin{gathered} t=\frac{v_f-v_1}{a} \\ where \\ v_f\text{ is the final velocity} \\ v_{i\text{ }}\text{ is the initail velocity} \\ a\text{ is the acceleration, so} \end{gathered}\)

Step 1

a)Let

\(\begin{gathered} v_i=6\text{ }\frac{m}{s} \\ v_f=0(\text{ rest\rparen} \\ a=-3\frac{m}{s^2} \end{gathered}\)

b) now, replace

\(\begin{gathered} t=\frac{v_{f}-v_{1}}{a} \\ t=\frac{0-(-6\frac{m}{s})}{3\frac{m}{s}} \\ t=2\text{ seconds} \end{gathered}\)

therefore, the answer is 2 seconds

I

1. What is the velocity final if an object starts with 2 m/s and
accelerates at 4 m/s² in 3 s?

Answers

Answer:

Use v = u + at but since u is equal to zero then it becomes v = at. The final velocity of the body is equal to 12 m/s. The acceleration of an object decreases ...

Explanation:

how is force spread over long and short durations of time?

Answers

I think you're having trouble with it only because of how you're trying to look at it.

Don't try to imagine "spreading force" over time. Just think about how long the force lasts !

Like . . .

If you push your doll stroller for 5 seconds, you'll get it up to a certain speed.

Next time, if you push it again with the same force, but you keep pushing for TEN seconds, you'll get it up to a faster speed.

Technically:

(force • time) = impulse.

You gave it more impulse the second time, so it got more momentum from you.

During the 14th-17th centuries, people believed the Sun orbited the Earth.

True
Or
False

Answers

Answer:

it is true word ........

a lion is running at constant speed toward a gazelle that is standing still, as shown in the top figure above. after several seconds, the gazelle notices the lion and accelerates directly toward him, hoping to pass the lion and force him to reverse direction. as the gazelle accelerates toward and past the lion, the lion changes direction and accelerates in pursuit of the gazelle. the lion and the gazelle eventually each reach constant but different speeds. which of the following sets of graphs shows a reasonable representation of the velocities of the lion and the gazelle as functions of time?

Answers

The graph shown in the first option nicely plots the lion's and gazelle's velocities as a function of time, so option A is the correct answer.

Velocity is the rate of change of displacement over time.

It has SI units as m/s.The total amount of movement of an object per unit time is also called velocity. It depends on both the size and direction of the moving object.Velocity can also be called as speed when distance is taken into consideration instead of displacement.

As mentioned in the problem of running at a constant speed towards a gazelle with a standing lion as shown above.

So option A is correct.

To know more about velocities,

https://brainly.com/question/13471585

#SPJ4

a lion is running at constant speed toward a gazelle that is standing still, as shown in the top figure

(a) Calculate the curl and divergence of a three dimensional flow field which is given
by v = i (y+z) + j zx + k xy .

(b) A table tennis ball of mass m = 0.0027 kg, with diameter D = 44 mm, is hit at a
velocity of U = 12 m/s in a horizontal direction with backspin of angular velocity ω
radians/sec. You may take the density of air to be 1.23 kg/m3. If the ball is to travel
on a horizontal path, not dropping due to the acceleration of gravity, explain why
mg = CLrhoU2A/2
where g is gravitational acceleration, CL is the coefficient of lift, rho is the density of
air and A is the projected area of the ball. Rearranging this expression write down
a formula for CL in terms of the other variables and evaluate this for the given
values.You are also told that the coefficient of lift is related to the angular velocity
by CL = 0.28(ωD/2U). Equating this formula with the formula you derived find the
value of ω in radians/sec that ensures the table tennis ball travels on a horizontal
path.

(c) An offshore wind turbine is supported on a vertical cylindrical pile. The diameter of
the pile is 5 m. The water depth at the site is 30 m and the maximum tidal current
at the surface is 1 m/s. Laboratory tests have indicated that the Strouhal number
is 0.3. Estimate the frequency of vortex shedding near the sea surface under peak
tidal flow conditions.

(d) The velocity potential for simple linear waves may be written as:
where H is the wave height, h is the still water depth, x is the horizontal distance,
z is vertical distance downward, t is time, k is the wave number and ω is the wave
frequency. Using the relationship u = ∂/∂x derive a formula for the horizontal
component of velocity, u. For a wave of height 2 m, period 7 s and wave length
100 m propagating in a water depth of 10m, determine the maximum horizontal
velocity at the seabed.

Answers

a) To calculate the curl and divergence of a three-dimensional flow field, we have the flow field given as

\(v = i(y + z) + j(zx) + k(xy).\)

The curl of v is defined as:

curl(v) = ∇ x vWhere ∇ is the vector differential operator.

The curl is evaluated as:

\(curl(v) = i[(∂vz/∂y) - (∂vy/∂z)] + j[(∂vx/∂z) - (∂vz/∂x)] + k[(∂vy/∂x) - (∂vx/∂y)]where vx = y, vy = x, and vz = 1.\)

The above equation can be rewritten as:

curl(v) = - i - j + kDivergence of v is defined as:

div(v) = ∇ . v

This can be written as:

\(div(v) = ∂vx/∂x + ∂vy/∂y + ∂vz/∂z\)

Given v, we can calculate div(v) as follows:

\(div(v) = ∂vx/∂x + ∂vy/∂y + ∂vz/∂z= ∂y(y+z)/∂x + ∂x(zx)/∂y + ∂(xy)/∂z= 0+0+0=0\)

div(v) = 0, and curl(v) = - i - j + k

(b) Given that mg = CLρU^2A/2 and CL = 0.28(ωD/2U)

where \(m = 0.0027 kg, D = 44 mm = 0.044 m, U = 12 m/s, g = 9.81 m/s^2, and ρ = 1.23 kg/m^3\)

We have to derive the formula for CL in terms of the given variables and evaluate for the given values.

substituting the given values in the equation, we get:

\(mg = CLρU^2A/2CL = 2mg/(ρU^2A) = 2*0.0027*9.81/(1.23*12^2*π(0.022)^2) ≈ 0.155\)

Given that CL = 0.28(ωD/2U)

we can equate this with the above formula to obtain:

\(0.155 = 0.28(ωD/2U)ω = 2*0.155*12/(0.28*0.044) ≈ 50.06 radians/s(c)\)

For an offshore wind turbine supported on a vertical cylindrical pile, the vortex shedding frequency can be estimated using the formula:

f = St*U/D

where St is the Strouhal number, U is the velocity of the tidal current, and D is the diameter of the pile. Given that D = 5 m, h = 30 m, H = U = 1 m/s,

St = 0.3 we can evaluate the frequency of vortex shedding as:

f = 0.3*1/5 = 0.06 Hz

(d) The horizontal component of velocity is given as

\(u = ∂ϕ/∂x\)

where ϕ is the velocity potential for simple linear waves given as:

\(ϕ = H cosh(k(z+h))/cosh(kh)cos(kx-ωt)\)

Given that H = 2 m, T = 7 s, λ = 100 m, h = 10 m and g = 9.81 m/s^2, we have:

\(T = 2π/ωλ = gT^2/2π = (9.81*7^2)/(2π) ≈ 193.13 m\)

To calculate k, we use the relation k = 2π/λ.

Therefore\(,k = 2π/λ = 2π/100 = 0.0628\)rad/mSubstituting the given values in the velocity potential, we have:

\(ϕ = 2 cosh(0.0628(z+10))/cosh(0.628)cos(0.0628x - ωt)\)

The horizontal component of velocity is given as:\(u = ∂ϕ/∂x = -0.0628*2 sinh(0.0628(z+10))/cosh(0.628)sin(0.0628x - ωt)At the seabed,\)

z = -10 m

t = 0

\(u = -0.0628*2 sinh(-0.628)/cosh(0.628)sin(0) ≈ 0 m/s\)

Therefore, the maximum horizontal velocity at the seabed is 0 m/s.

To know more about divergence visit:

https://brainly.com/question/30726405

#SPJ11

When two magnets attract, they ___________.

A. Pull together
B. Change color
C. Break
D. Push apart​

Answers

Answer:

A. Pull together

Explanation:

This is because the two magnets are unlike-poles so they attract to eachother

I think A is the right answer

the mass of a raindrop is 4 milligrams. which one of the following statements indicates the correct mass of the raindrop in grams?
The rain has a mass of 4 times 10^6 grams, drop The raindrop has a mass of 4 times 10^3 grams. The raindrop has a mass of 4 times 10^-3 grams. The raindrop has a mass of 4 times 10^-6 grams. The raindrop has a mass of 4 times 10^-1 grams.

Answers

The correct statement that indicates the correct mass of the raindrop in grams has a mass of 4 x 10⁻³ grams.

Which statements indicates the correct mass of the raindrop in grams?

The raindrop has a mass of 4 x 10⁻³ grams is the correct statement that indicates the correct mass of the raindrop in grams.

Mass is the measure of the amount of matter in an object. The metric unit of mass is the gram (g).

The mass of a raindrop is 4 milligrams.1 milligram is 0.001 grams. Therefore,4 milligrams = 4 x 0.001 grams = 0.004 grams.

Using scientific notation, 0.004 grams can be written as 4 × 10⁻³ grams.

Thus, the correct statement that indicates the correct mass of the raindrop in grams is: The raindrop has a mass of 4 x 10⁻³ grams.

Learn more about mass

brainly.com/question/19694949

#SPJ11

state three industrial application of magnets

Answers

Answer:

refrigerators

door bells

magnetic compass

a student designing an electric scooter uses a simple column type load cell with two strain gauges

Answers

A load cell is an essential sensor device used for converting a force, torque, pressure, or displacement into an electrical signal. It is a key component in electronic scales, force measuring instruments, and weighing devices. A student who designs an electric scooter uses a simple column type load cell with two strain gauges.

The load cell measures force or weight by converting the tension or compression acting on the load cell into an electrical signal. A load cell typically comprises four strain gauges that are arranged in a Wheatstone bridge configuration. A column type load cell is cylindrical in shape and is designed to measure loads in compression. It typically comprises two columns that are connected by a metal diaphragm. Two strain gauges are attached to the columns, one for measuring the compressive strain and the other for measuring the tensile strain.

The student designing an electric scooter uses a load cell to measure the weight of the rider and other loads on the scooter. The load cell is typically placed at the bottom of the scooter's frame, and the weight of the rider and the scooter is applied to it. The load cell measures the weight by converting the compression force acting on it into an electrical signal. The two strain gauges attached to the columns of the load cell measure the compressive and tensile strains, respectively. These strains are converted into an electrical signal using a Wheatstone bridge circuit, and the output of the bridge is proportional to the weight applied to the load cell.The student designing the electric scooter needs to select the right load cell for the application. The load cell must be able to measure the maximum weight that the scooter can carry. The column type load cell is suitable for measuring loads in compression, which is ideal for measuring the weight of the rider and the scooter. The two strain gauges attached to the columns of the load cell help to increase the sensitivity and accuracy of the load cell. The Wheatstone bridge circuit helps to convert the strain measurements into an electrical signal that can be processed by the scooter's control system.

To know more about sensor device visit :-

https://brainly.com/question/16980426

#SPJ11

what is the flux through surface 1 φ1, in newton meters squared per coulomb?

Answers

The flux through surface 1 (φ1) is 3200 Newton meters squared per coulomb.

To calculate the flux through surface 1 (φ1) in Newton meters squared per coulomb, we can use the formula:

φ1 = E * A * cos(θ)

where E is the magnitude of the electric field, A is the area of the surface, and θ is the angle between the electric field vector and the normal vector of the surface.

In this case, the magnitude of the electric field is given as 400 N/C. The surface is a rectangle with sides measuring 4.0 m in width and 2.0 m in length.

First, let's calculate the area of the surface:

A = width * length

A = 4.0 m * 2.0 m

A = 8.0 m²

Since the surface is a rectangle, the angle θ between the electric field and the normal vector is 0 degrees (cos(0) = 1).

Now, we can substitute the given values into the flux formula:

φ1 = E * A * cos(θ)

φ1 = 400 N/C * 8.0 m² * cos(0)

φ1 = 3200 N·m²/C

Therefore, the flux through surface 1 (φ1) is 3200 Newton meters squared per coulomb.

The question should be:
what is the flux through surface 1 φ1, in newton meters squared per coulomb? The magnitude of electric field is 400N/C. Where, the surface is a rectangle, and the sides are 4.0 m in width and 2.0 min length.

Learn more about flux at: https://brainly.com/question/10736183

#SPJ11

Question 7 of 25
Which statement uses the correct Sl units to describe the velocity of the
runner?
A. She is running at 2.4 m/s2
B. She is running west at 2.4 m/s.
C. She is running west at 2.4 m/s2
D. She is running at 2.4 m/s.
SUBMIT

Answers

\( \large \mathfrak{Answer : }\)

The S.I unit of velocity is m/s and since it's velocity it needs to be in a particular direction, therefore most appropriate answer is :

B. She is running west at 2.4 m/s

which do we do to find the potential difference across a capacitor

Answers

The potential difference across a capacitor, you can use the formula

is  V = Q/C

Where V is the potential difference (voltage) across the capacitor, Q is the charge stored on the capacitor, and C is the capacitance of the capacitor.  potential difference, also known as voltage, is the difference in electric potential energy per unit of charge between two points in an electric circuit.

This formula which relates the potential difference across a capacitor to the amount of charge stored on it and the capacitance of the capacitor. The capacitance is a measure of the ability of the capacitor to store charge, while the charge on the capacitor determines the potential difference across it.

To learn more about Potential difference :

https://brainly.com/question/28566562

#SPJ4

You have a transformer with 50 turns in the primary coil if you want to increase the voltage from 5V26V how many times should be in the secondary coil

Answers

Correct question:

You have a transformer with 50 turns in the primary coil if you want to increase the voltage from 5V to 6V how many turns should be in the secondary coil ?

Answer:

the number of turns in the secondary coil is 60 turns.

Explanation:

Given;

number of turns in the primary coil, P = 50 turns

primary voltage, Ep = 5V

secondary voltage, Es = 6V

The number of turns in the secondary coil is calculated as;

\(\frac{N_s}{N_p} = \frac{E_s}{E_p} \\\\\frac{N_s}{50} = \frac{6}{5} \\\\N_s = \frac{50\times 6}{5} \\\\N_s = 60 \ turns\)

Therefore, the number of turns in the secondary coil is 60 turns.

A spring-loaded ballistic cart measuring 0.5 kg is in contact with a second 0.8 kg cart. The carts are
initially at rest on a level surface. The spring is released and the lighter cart is observed to move at +0.4
m/s afterward. What is the velocity of the other cart?

Answers

A spring-loaded ballistic cart is in contact with a second cart. The velocity of the other cart is 0.25 m/s.

What is the conservation of linear momentum?

When there is no external force acting on the system, the initial momentum is equal to the final momentum.

Momentum is equal to the product of mass and its velocity.

According to the conservation of linear momentum,

m₁v₁ +m₂v₂ = m₁u₁ +m₂u₂

u and v represents the initial and final velocity. 1 and 2 represents the first and second cart.

Given is m₁ = 0.5 kg, m₂ =0.8kg, u₁ =u₂ =0 m/s and v₁ = 0.4 m/s.

Substituting the values in the conservation of momentum equation, we get the velocity of second cart is

0.5 x 0.4 + 0.8 x v₂ = 0.5 x 0 + 0.8 x 0

v₂ = +0.25 m/s (in the direction of first cart)

Thus,  the velocity of the other cart is 0.25 m/s.

Learn more about conservation of linear momentum.

https://brainly.com/question/11214803

#SPJ1

(ii) a storage tank at stp contains 28.5 kg of nitrogen (a) what is the volume of the tank? (b) what is the pressure if an additional 32.2 kg of nitrogen is added without changing the temperature?

Answers

Volume of tank=22.8

pressure=2.16*10^5

What is temperature?

Temperature is a numerical expression of how hot a substance or radiation is. There are three different types of temperature scales: average-based scales like the SI scale.

The average kinetic energy of the particles in an object is measured by its temperature. The velocity of these particles likewise increases as the temperature rises. A thermometer or a calorimeter is used to determine the temperature.

The direction of heat transfer when two bodies with different temperatures are kept in touch depends on the temperature. The kelvin is the SI unit (K).

To learn more about temperature refer to:

https://brainly.com/question/24746268

#SPJ4

Wat is the statement of law intertia

Answers

Answer:

here

Explanation:

Law of inertia states that a body remains in a position of rest or motion along a straight line unless an external force is applied..

Please mark me as brainliest

Law of inertia, also called Newton's first law, postulate in physics that, if a body is at rest or moving at a constant speed in a straight line, it will remain at rest or keep moving in a straight line at constant speed unless it is acted upon by a force.

Write an equation of the line in slope-intercept form.

Write an equation of the line in slope-intercept form.

Answers

the answer would be y=1/3x+2

An Object with a mass o 5.13kg placed on top of a spring compresses it by 0.25m (a) what is the force constant of the spring (b) How high will this object go when the spring releases its energy?

Answers

The force constant of the spring is 200.696 N/m & The height the object achieves when the spring releases its energy is 2.5087 m

The spring constant is the force needed to stretch or compress a spring, divided by the compressive or expansive distance. It's used to determine stability or instability in the spring, and therefore the system it's intended for. we know,

F = kx

Therefore,

k = F/x

We also know that the force being exerted on the spring is equal to the mass of the object. Hence, F = mg = 5.13 * 9.8 N = 50.174 N and we know compression due to the mass is 0.25m. Therefore,

K = 50.174/0.25 N/m

K = 200.696 N/m

Therefore, The Spring Constant is 200.696 N/m

On release, the spring potential energy gets converted to kinetic energy. Hence, on release, the height attained by the object is given by:

h = \(1/2 kx^{2}\)

We know that k=200.696 N/m and x=0.25 m. Therefore the height is:

h = \(1/2 (200.696 N/m)(0.25 m)^{2}\)

h = 2.5087 m

Therefore, the force constant of the spring is 200.696 N/m & The height the object achieves when the spring releases its energy is 2.5087 m

To learn more about Spring Constant :

https://brainly.com/question/1968517

Explain why a charged body loses its charge if we touch it with our hand?

if u answer me I can give u brainliest ☺️​

Answers

Answer:

Explanation: A charged body loses its charge when we touch it with our hand because some of the charge flows through our body to the ground earthing. As a result the charge on the body decreases every time we touch it. This is because of earthing.

Explanation:

yw .

Explanation:

When we touch a charged body, it loses its charge, due to the process of earthing. Our body is a good conductor of electricity. It transfers the charges to the earth

A student in Europe performs the same experiment, but the AC frequency there is 50 Hz. How different length of sensitized tape will he need in order to get 25 spark marks, compared to the length of your tape for the same number of marks? Give the result in centimeters.

Answers

Answer and Explanation:

The computation is shown below:

The ac frequency in the United States is 60 Hz

The ac frequency in Europe is 50 Hz

So,

Time for 25 spark in United stated is 25 ÷ 60 s

Time for 25 spark in Europe is 25 ÷ 50 s

Now

Tape length in United States is

= 0.5 × 9.8 × (25 ÷ 60)^2

= 0.85 m

= 85 cm

And,  

Tape length in europe is

= 0.5 × 9.8 × (25 ÷ 50)^2

= 1.225 m

= 122.5 cm

So, As it can be seen that

= 122.5 cm - 85 cm

=  37.5 cm

Europe has 37.5 cm more than in the United States

Calculate speed...



D=40 m

T=10 s

a
40 m/s
b
400 m/s
c
4 m/s

Answers

Answer:

c

Explanation:

speed=distance÷time

40÷10=4

On a curved roadway of radius 95m, the speed limit is 12 m/s. What should the coefficient of static friction be between the tires and the road for the car to safely navigate the curve at the posted speed?

Please please help.

Answers

The coefficient of static friction between the tires and the road is  0.16.

What is the coefficient of kinetic friction?

The coefficient of static friction between the tires and the road for the car to safely navigate the curve at the posted speed is calculated as follows;

Static friction = centripetal force

μmg = mv²/r

μ = ( v² ) / ( rg)

where;

μ is the coefficient of static frictiong is acceleration due to gravityr is the radius of the curved pathv is the maximum speed of car on the path

The coefficient of static friction between the tires and the road is calculated as follows;

μ = ( 12² ) / ( 95 x 9.8)

μ  = 0.16

Learn more about coefficient of static friction here: https://brainly.com/question/20241845

#SPJ1

The box survived the fall and is returned to the top of the building. More objects are put into the box, and the box with its contents now has a total mass of 93 kg. The box is dropped, and it reaches a higher terminal speed than before. After reaching terminal speed, what is the magnitude of the air resistance force acting upward on the falling box? (The fact that the heavier object reaches a higher terminal speed shows that the air resistance force increases with increasing speed.)

Answers

911.4N is the air resistance force acting upward on the falling box.

The constant or the highest speed that an object reaches when it falls through a liquid or gas is referred to as terminal velocity.

At terminal velocity,

The Upward force acting on an object(F) = Weight of the falling object(W).

Due to the fact that the two forces are acting in opposing directions, there is no net force acting on the item, and that's why the speed of the object becomes constant.

The Formula used to calculate the Upward force

F = mg...….. Equation(1)

where,

m = total mass of the box

g = acceleration due to gravity = 9.8 \(m/s^{2}\)

F = Air resistance force acting upward on the box

Given:

The box with its contents now has total mass of 93Kg

m = 93 kg

g = 9.8 m/s²

Substitute the values into equation (1)

F = 93×(9.8)

F = 911.4 N

Hence, the magnitude of the air resistance force acting upward on the falling box is 911.4N

Learn more about Terminal velocity here https://brainly.com/question/13570045

#SPJ4

Help! How do you find the Eccentricity??

Answers

Explanation:

The formula to determine the eccentricity of an ellipse is the distance between foci divided by the length of the major axis

What is matter made of ? Will mark as brainliest to answer

Answers

Answer:

Explanation:

All matter is made up of atoms, which are turned up of protons, neutrons and electrons.

They bond together to make up matter

Answer:

Atoms

Explanation:

All matter is made up of atoms, which are in turn made up of protons, neutrons and electrons. Atomess come togetheer to forms molecules, which are the building blocks for all types of matter

Calculate the velocity of a satellite moving in a stable circular orbit about the Earth at a height of 3700 km.

Answers

The velocity of the satellite in a stable circular orbit around the Earth at a height of \(3700 km\) is approximately \(7026 m/s\).

Why will be stable circular orbit about the Earth at a height of 3700 km?

To calculate the velocity of a satellite in a stable circular orbit around the Earth at a given height, we can use the formula:

\(v = sqrt(GM/R)\)

where v is the velocity of the satellite, G is the gravitational constant \((6.674 x 10^-11 Nm^2/kg^2)\), M is the mass of the Earth \((5.972 x 10^24 kg)\), and R is the radius of the orbit.

First, we need to convert the height of the satellite above the Earth's surface to the radius of the orbit. We know that the radius of the Earth is approximately \(6,371 km\), so the radius of the orbit is:

\(R = height of satellite above Earth's surface + radius of Earth\\\)

\(R = 3700 km + 6371 km\)

\(R = 10071 km\)

Now we can plug in the values and calculate the velocity:

\(v = sqrt(GM/R)\)

\(v = sqrt((6.674 x 10^-11 Nm^2/kg^2)(5.972 x 10^24 kg)/(1.0071 x 10^7 m))\)

\(v = 7026 m/s\)

Learn more about stable circular

brainly.com/question/29650954

#SPJ11

Other Questions
Discuss why it is important to acquire intercultural communication skills. Be sure to include the concept of globalization.How have advances in technology impacted intercultural communication?how do cultures change?what are 3 obstacles to intercultural communication?Many intercultural communication specialists mention open-mindedness as an attribute necessary for the development of successful intercultural relationships. What are some other attributes or ways of thinking that a person should have in order to develop relationships with culturally different people? for an individual the marginal rate of substitution is constant and equal to 1/2 for all combinations of goods x and y in his consumption set. the price of good x is $12 per unit and the price of good y is $8 per unit. the individual has a total budget of $400. determine the bundle of goods x and y that maximize his utility. Consider the following functions. f(x)=6/x+7 g(x)= x/x+7 Find (f + g)(x). Find the domain of (f + g)(x). (Enter your answer using interval notation.) Find (f-g)(x). Find the domain of (f-g)(x). viruses infecting protists, including algae, have never been detected.T/F checking parameters before theyre used to make sure theyre valid is referred to as: 2. a. for the zero coupon bond 2 above that has a $1,000 maturity value and 6 years to maturity, what will be your annual compound yield for your 6-year holding period if you hold the bond to maturity, receiving the $1000 maturity value at the end of year 6? hint recall: annual compound yieldHint Recall: Annual Compound Yield = {[FV / PV] ^ 1/n} - 1 orIn other words {[What you have at the end of 6 Years / What You Paid] ^1/n } - 1n = your 6-year holding period.Annual Compound Yield for Bond 2 at End of Year 6 __________________ during isokinetic testing at high angular velocities (>240 degrees/sec), what is the approximate torque capability of eccentric muscle actions as compared to concentric muscle actions? Find the general solution to the given system. X' = (12 -9)X(4 0) What is _+_-8=29 I tried but it is very confusing please help me with the question Write an explicit formula for each sequence and find the 7'' term for each.3. -4, 12, -36...4. 12,3, 3/4. The difference between 45 and y is 9 beck at, guth d, steer ra, ball r. screening for major depression disorders in medical inpatients with the beck depression inventory for primary care. behav res ther. 1997;35(8):785-79 The Earth has a radius of about 6,000 km. How long would it take for an object traveling at the speed of light to circle the earth If the annual percentage rate (APR) is 9% and the compounding period is quarterly, what is the effective annual rate (EAR)? Enter your answer as a percentage. Do not include the percentage sign in your answer. a coefficient in a chemical reaction is a number that goes in front of an element or compound in a balanced equation. for example in the balanced equation below the coefficient in front of the h2o is 2, meaning 2 molecules of h2o are reacting to make 2 molecules of h2 and 1 molecule of o2. 2 h2o --> 2 h2 o2 what is the coefficient that goes in front of the eca in the reaction below. e3bc4 d(ca)2 --> d3(bc4)2 eca a tendency to notice and remember instances in which our hunches about future disaster are subsequently followed by harmful events contributes to Consider the following code: with inputs of 0, -1, 4, 8 and 12, what will be the output? In contrast to a political party, which focuses on a broad range of issues and exists to win elections, an interest group focuses on _____ concerns of immediate interest to its members. Imagine you are a famous composer living during the classical era, and you need musicians to play your pieces. what would most likely happen in this scenario lucy is a new manager and the employees has resisted many of the new policies she has put into place. she explains to the employees that the new policies are more effective than the old ones because they save time and allow the employees more time to spend serving customers. how is lucy overcoming resistance with her employees?