The pH of a saturated solution of M(OH)3 is 10.896. Calculate the Ksp. Select one: O a. 2.44x10-10 O b. 1.28x10-13 6.19x10-7 O d. 6.88x10-8 OC

Answers

Answer 1

The Ksp value of the given saturated solution is: 1.28 x \(10^{-13\). Hence, the correct option is (b).

To calculate the Ksp of the saturated solution of \(M(OH)^3\) with a pH of 10.896, follow these steps:

1. Convert the pH to [OH-] concentration using the following formula: pOH = 14 - pH.
2. Calculate the concentration of \(M(OH)^3\) based on the stoichiometry of the reaction.
3. Determine the Ksp using the concentrations from step 2.

Step 1: Calculate pOH and [OH-]
pOH = 14 - pH = 14 - 10.896 = 3.104
[OH-] = \(10^{(-pOH)\) = \(10^{(-3.104)\) = 7.93 x \(10^{-4\) M

Step 2: Calculate [M(OH)3]
For every one \(M(OH)^3\), there are three OH- ions. Therefore:
[\(M(OH)^3\)] = (1/3) x [OH-] = (1/3) x (7.93 x \(10^{-4\)) = 2.643 x 10^-4 M

Step 3: Calculate Ksp
The dissolution reaction is: \(M(OH)^3\)(s) <=> \(M^{3+\)(aq) + 3\(OH^-\)(aq)
Ksp = [\(M^{3+\)] * \([OH^-]^3\)
Since [\(M(OH)^3\)] = [\(M^{3+\)], we can substitute and use the same value for both:
Ksp = (2.643 x \(10^{-4\)) * (7.93 x \(10^{-4})^3\) = 1.28 x \(10^{-13\)

To know more about "pH" refer here:

https://brainly.com/question/30761746#

#SPJ11


Related Questions

when i release it because the kinetic energy stored waiting to be released stored waiting to be released.


A. chemical to thermal
B. thermal to electromagnetic
C. chemical to thermal and electromagnetic
D. chemical and electromagnetic to thermal

Answers

The energy transformation is, Electrical to light. The answer is C.

When a battery-powered flashlight is turned on, electrical energy from the battery is transformed into light energy through a process called electroluminescence. Inside the flashlight, a circuit is completed when the switch is turned on, allowing electrical current to flow from the battery through a wire to a light bulb or LED (light-emitting diode). The electrical energy is converted into light energy, which illuminates the area around the flashlight.

The battery's chemical energy is not directly transformed into light, but rather is used to generate electrical energy that is then transformed into light. Hence option C is correct.

To know more about energy transformation, here

brainly.com/question/9318640

#SPJ4

--The complete question is, When a battery-powered flashlight is turned on, what type of energy transformation takes place?

A. Chemical to thermal

B. Electrical to thermal

C. Electrical to light

D. Chemical to light--

What can you infer if the fossil of a marine organism is found in an area that is now dry land?

Answers

Answer:

Fossils also help us to infer why dinosaurs and other organisms became extinct. Fossils tell us that there was a mass extinction at the time of the dinosaurs. They died out about 65 million years ago, along with more than half of all the other animal and plant species. ... Without plants, dinosaurs could not survive.

Explanation:

hope it will help you have a great day bye and Mark brainlist if the answer is correct

\(kai6417\)

#carry on learning

A customer is traveling to a branch office static ip.

Answers

Answer:

A customer is travelling to a branch office, and the network administrator provides her with a static IP address for her laptop

Explanation:

I hope this helps!!!...

Brainliest please???

the practice of psychology is bound by state laws and regulations as well as by

Answers

The practice of psychology is bound by state laws and regulations as well as by professional ethical standards.

State laws and regulations govern the practice of psychology within a specific jurisdiction. Each state has its own licensing board or regulatory body that establishes guidelines, requirements, and restrictions for practicing psychology. These laws typically address issues such as qualifications for licensure, scope of practice, client confidentiality, and professional conduct. Psychologists must adhere to these legal requirements to ensure they are practicing within the boundaries set by their respective states.

In addition to state laws, psychologists are also bound by professional ethical standards. These standards are established by professional organizations, such as the American Psychological Association (APA), and serve as guidelines for ethical behavior in the field. Ethical standards address principles such as respect for clients' rights, confidentiality, competence, and maintaining professional boundaries. Psychologists are expected to uphold these ethical principles to ensure the well-being and rights of their clients.

By adhering to both state laws and professional ethical standards, psychologists can provide competent and ethical services while maintaining accountability and safeguarding the public's trust in the profession.

Know more about Psychology here:

https://brainly.com/question/31538247

#SPJ11

Answer:

Explanation:

1.. 1.Stage 1, the brain produces high amplitude theta waves, which are very slow brainwaves. This period of sleep lasts only a brief time (around five to 10 minutes). If youawaken someone during this stage, they might report that they were not really asleep.2.During stage 2 sleep: People become less aware of their surroundings, Bodytemperature drops, Breathing and heart rate become more regular.Stage 2 is the second stage of sleep and lasts for approximately 20 minutes.3. During stage 3 sleep: Muscles relax, Blood pressure and breathing rate drop, Deepestsleep occurs. This stage was previously divided into stages 3 and 4. Deep, slow brain wavesknown as delta waves begin to emerge during stage 3 sleep. This stage is also sometimesreferred to as delta sleep. During this stage, people become less responsive and noises andactivity in the environment may fail to generate a response. It also acts as a transitional periodbetween light sleep and a very deep sleep. Bed-wetting was most likely to occur during thisdeep stage of sleep. Sleepwalking also tends to occur most often during the deep sleep of thisstage.4.During REM sleep:The brain becomes more activeBody becomes relaxed and immobilizedDreams occurEyes move rapidly

2 activation synthesis theory is a theory of dreaming that was developed by researchers J. AllanHobson and Robert McCarley. This theory suggests that dreams are as a result of physiologicalprocesses of the brain.Information processing theory is a cognitive approach to the human braintransforms sensory information. The theory looks at real time responses and how the braintransforms the given information. An experiment that would be used to test whether theinformation processing theory is correct is measurements of subjects brains and bodies this tofind out which areas of the brain are functioning at which time also one can look atself-reporting from the subjects whether describing what they are thinking about during anactivity or pressing a button in response to recognizing an image. To conduct this experimentwould be difficult since this processes are impossible top measure because they need someonewith a long memory and that may be hard to get baring in mind that with current humanknowledge and technology would beto directly observe.

A chemical production company annually produces 500 million pounds of the chemical maleic anhydride using four different reactors. Each reactor can be run on only one of the four settings. The followi

Answers

A chemical production company annually produces 500 million pounds of the chemical maleic anhydride using four different reactors. Each reactor can be run on only one of the four settings.

This means that each reactor contributes to the production process by running on a specific setting. The specific settings may vary depending on factors such as temperature, pressure, or other variables relevant to the production of maleic anhydride.

By utilizing all four reactors and their respective settings, the company can achieve the desired annual production of 500 million pounds. Each reactor plays a crucial role in the overall process, ensuring that the necessary quantity of maleic anhydride is produced efficiently and effectively.

To know more about chemical  Visit;

https://brainly.com/question/28792948

#SPJ11

what is the difference between sigma and pi bonds

Answers

In chemistry, a sigma bond (σ bond) is a chemical bond formed by the overlap of two atomic orbitals. On the other hand, a pi bond (π bond) is a chemical bond formed by the overlap of two p orbitals.

Sigma bonds are the strongest type of covalent bond, with a bond strength of about 280-350 kJ/mol. They are also the shortest bond, with an average length of about 0.15 nanometers (nm).

Sigma bonds are characterized by their short bond length and high bond energy. They are also directional, meaning that they are stronger in certain orientations than in others.

Pi bonds are weaker than sigma bonds, with a bond strength of about 70-100 kJ/mol. They are also longer than sigma bonds, with an average length of about 0.2nm.

Pi bonds are characterized by their longer bond length and lower bond energy compared to sigma bonds. They are also less directional than sigma bonds, meaning that they are relatively equally strong in all orientations.

Learn more about bonds:

https://brainly.com/question/13559044

Covalent bonds has two types which are a sigma bond is a chemical bond formed by the overlap of two atomic orbitals and a pi bond (π bond) is a chemical bond formed by the overlap of two p orbitals.

What is a covalent bond?

Covalent bond is defined as a type of bond which is formed by the mutual sharing of electrons to form electron pairs between the two atoms.These electron pairs are called as bonding pairs or shared pair of electrons.

Due to the sharing of valence electrons , the atoms are able to achieve a stable electronic configuration . Covalent bonding involves many types of interactions like σ bonding,π bonding ,metal-to-metal bonding ,etc.

Sigma bonds are the strongest covalent bonds while the pi bonds are weaker covalent bonds .Covalent bonds are affected by electronegativities of the atoms present in the molecules.Compounds having covalent bonds have lower melting points as compared to those with ionic bonds.

Learn more about covalent bond,here:

https://brainly.com/question/19382448

#SPJ2

Question 5 (Mandatory) (1 point) For the reaction shown, how many grams of oxygen will be required to react with 15.5 grams of chromium?4 Cr + 3 O2 --------> 2 Cr2O3Question 5 options:A) 12.7 g O2B) 21.5 g O2C) 14.3 g O2D) 7.15 g O2Question 6 (Mandatory) (1 point) Consider the following combustion reaction: 2 C4H10 + 13 O2 ------------> 8 CO2 + 10 H2OIf 5.05 grams of C4H10 reacts with more than enough of O2, what is the maximum amount of CO2 that can be formed?Question 6 options:A) 122 g CO2B) 15.3 g CO2C) 0.956 g CO2D) 61.2 g CO2Question 7 (Mandatory) (1 point) Consider the reaction between HCl and O2: 4 HCl + O2 ---------------> 2 H2O + 2 Cl2Calculate the theoretical yield of H2O when 64 grams of HCl react with 19 grams of O2.Question 7 options:A) 16 g H2OB) 21 g H2OC) 32 g H2OD) 43 g H2OQuestion 8 (Mandatory) (1 point) Consider the following chemical reaction: 4 Al + 3 O2 ---------------> 2 Al2O3If 12.85 g of Al reacts completely with oxygen and 18.42 g of aluminum oxide is obtained, what is the percent yield of the reaction?Question 8 options:A) 24.28%B) 75.86%C) 65.91%D) 69.76%Question 9 (Mandatory) (1 point) When a mole of gaseous propane (C3H8) reacts completely with oxygen gas, 2044 kJ of energy is formed, along with gaseous carbon dioxide and water vapor. Which of the following equations is a correct representation of this thermochemical reaction?Question 9 options:A) C3H8(g) + O2(g) -----------> CO2(g) + H2O(g) ΔH = -2044 kJB) C3H8(g) + O2(g) -----------> CO2(g) + H2O(g) + 2044 kJC) C3H8(g) + 5 O2(g) + 2044 kJ -----------> 3 CO2(g) + 4 H2O(g) D) C3H8(g) + 5 O2(g) -----------> 3 CO2(g) + 4 H2O(g) + 2044 kJQuestion 10 (Mandatory) (1 point) The evaporation of water is endothermic: H2O(l) + 44.01 kJ --------> H2O(g) If 275 kJ of heat is absorbed, what mass of water will evaporate?Question 10 options:A) 0.347 gB) 2.18 x 105 gC) 113 gD) 6.25 gQuestion 11 (Mandatory) (1 point) Based on the following reaction: BaCl2(aq) + Na2SO4(aq) → BaSO4(s) + 2NaCl(aq) If a reaction mixture contains 4.16 g of BaCl2 and 3.30 g of Na2SO4 how many moles of the precipitate will be formed?Question 11 options:A) 0.178 molesB) 0.0200 molesC) 0.0241 molesD) 0.0278 molesQuestion 12 (Mandatory) (1 point) The following chemical equation, which is unbalanced, shows the reaction for the rusting of iron: Fe(s) + O2(g) → Fe2O3(s)How many moles of O2 are required to react completely with 1.396 g of Fe?Question 12 options:A) 0.00937 moles of O2.B) 0.0187 moles of O2.C) 0.00469 moles of O2.D) 0.0375 moles of O2.Question 13 (Mandatory) (1 point) A reaction mixture of 18.215 g Na2CO3 and 10.938 g HCl react according to the following balanced equation: Na2CO3 + 2HCl → 2NaCl + H2O + CO2What is the theoretical yield for NaCl, in moles, from this reaction mixture?Question 13 options:A) 0.300 moles of NaClB) 0.172 moles of NaClC) 0.150 moles of NaClD) 0.344 moles of NaClQuestion 14 (Mandatory) (1 point) A reaction mixture of 0.1400 g of NaOH and 0.1400 g HCl reacts according to the following equation: NaOH + HCl → NaCl + H2O ∆H = -31.0 kJWhat is the heat change, q, corresponding to this reaction mixture?Question 14 options:A) 0.109 JB) -0.119 JC) -119 JD) -109 JQuestion 15 (Mandatory) (1 point) A mass of 0.6539 g of zinc is dissolved in excess hydrochloric acid, according to the following equation: Zn(aq) + 2HCl(aq) → ZnCl2(aq) + H2(g) How many moles of Cl- ions are formed in the reaction?Question 15 options:A) 0.002 molesB) 0.02 molesC) 0.01 molesD) 0.1 moles

Answers

Question 5

Answer

D - 7.15 g O2

Explanation

Given:

Balanced chemical equation:

\(4Cr\text{ + 3O}_2\rightarrow2Cr_2O_3\)

mass of Cr = 15.5 g

Required: mass of Oxygen

Solution:

Step 1: Find the moles of Cr

n = m/M where n is the number of moles, m is the mass and M is the molar mass

n = 15.5 g/51,9961g/mol

n = 0.298 mol

Step 2: Use stoichiometry to find the moles of O

The molar ratio between Cr and O is 4:3

Therefore the number of moles of O = 0.298 x (3/4) = 0.224 mol

Step 3: From the moles, we can find the mass of O

m = n x M

m = 0.224 x 31.998

m = 7.168 g which is closer to D = 7.15 g


The symbol equation for combustion of a hydrocarbon is shown below. What number will go before the oxygen reactant when
this equation is balanced?

Answers

Answer:

Yes it is indeed

Explanation:

Thanks if you found this helpful

The balanced chemical equation is  \(\rm C_3H_8 + 5O_2- \rightarrow 3CO_2 + 4H_2O\).

What is chemical equation?

Chemical equation is defined as a formulation of mathematics that captures the chemical reaction. We can learn about the reactants and products involved in a chemical reaction by developing a chemical equation. It includes the symbols for the atoms of each element found in the compound, together with a count of how many of each element there are overall in the form of subscripts.

Chemical equations must be balanced in order to satisfy the law of conservation of mass, which states that "the total mass of all products of reaction in a chemical reaction is equal to the total mass of all reactants." A chemical equation is said to be balanced when the number of various elemental atoms on the reactants and products sides are equal. Chemical equations must be balanced by a process of trial and error.

Thus, the balanced chemical equation is \(\rm C_3H_8 + 5O_2- \rightarrow 3CO_2 + 4H_2O\).

To learn more about chemical equation, refer to the link below:

https://brainly.com/question/28294176

#SPJ2

The symbol equation for combustion of a hydrocarbon is shown below. What number will go before the oxygen

What does a particular point on a line of a phase diagram represent?
O A. The melting point or boiling point of a substance at a specific
pressure
B. The conditions in which temperature and pressure have equal
effects on a substance
C. The pressure created by the kinetic energy of molecules at a
particular temperature
D. The maximum temperature a substance can exist at without
bonds breaking

Answers

Answer:

D

Explanation:

Give an example for the neutralisation between a strong acid and a weak base, also mention the nature of its salt.​

need help !! ~~~~

Answers

Answer:

Neutralization occurs when a strong acid and a strong base come together in a chemical reaction to form water and salt.

Explanation:

not sure huhuhu

What is the ph of a solution that is 0. 50 m in hcooh (aq)? pka = 3. 75 for hcooh (aq)?

Answers

The pH of a solution that is 0.50 M in HCOOH is 2.045.

How do we calculate the pH?

pH of the solution will be calculated by taking the negative logarithm of the concentration of H⁺ ion.

Given chemical reaction will be:

                            HCOOH(aq)   ⇄   H⁺(aq)   +   HCOO⁻(aq)

Initial:                         0.50                    0                    0

Equilibrium:              0.50-x                  x                    x

Given that, pKa = 3.75

Ka = \(10^{-pKa}\)

Ka = \(10^{-3.75}\) = 0.000178

Ka for the above equation will be written as:
Ka = [H⁺][HCOO⁻]/[HCOOH]

Ka = (x)² / (0.50-x)

x is negligible as compared to 0.5, so the equation becomes

0.000178 = (x)² / 0.50

x² = (0.000178)(0.5) = 0.000089

x = 0.009

[H⁺] = 0.009M

pH will be calculated as:

pH = -log(0.009) = -(-2.045) = 2.045

Hence pH of the solution is 2.045.

To know more about pH, visit the below link:

https://brainly.com/question/22390063

#SPJ4

which of the following correctly shows the measurement 9.603 s rounded to three significant figures? 9.6030s 9.6s 9.60s 9.603s

Answers

Answer: I think the answer is 9.60s

Explanation: Hope it helps :)

sodium hydroxide + __________ → sodium chloride + water
What fills in the gap

Answers

Answer:

Hydrochloric acid (HCl)

Explanation:

start by writing out the formula for your reaction:

NaOH+________-------> NaCl +H2O

Reactants   ---------------->    Products

Our reactants have to be composed of an acid and a base. Already we know that sodium hydroxide (NaOH) is a strong base, therefore we know that the missing reactant has to be an acid. We see our products have an extra Hydrogen and Chlorine, so knowing that our our missing reactant is an acid and knowing that we have a hydrogen and chlorine we know that one of the strong acids is hydrochloric acid which its formula is (HCl).

Predict what color a white shirt would appear to be if the light reflected from the shirt passed through a red filter and then through a green filter.

Answers

Answer: brown

Explanation:

because red+green=brown

The closest living relatives to Gorillas are:

(Look at pic)

A. Humans

B. Chimpanzees, and humans equally

C. Orangutans

D. Chimpanzees

(DO NOT ANSWER IF YOU CANNOT ACTUALLY HELP)

The closest living relatives to Gorillas are:(Look at pic)A. HumansB. Chimpanzees, and humans equally

Answers

Humans, Gorillas share 98.3% of their DNA with humans
Mark Brainliest please

Answer is B

1. What is the purpose of communicating scientific information?
2. What is the purpose of writing lab reports for experiments and
activities in this book?
3. How are data plotted on a line graph?
4. What is a scientific model?
5. Contrast scientific theories and laws.

Answers

Answer:

to report on what you did, what you learned from an experiment and why the findings matter.

Explanation:

what is the number of ions in 310g of magnesium ions,Mg^2+

thank you so much

Answers

In 310 g of magnesium ions (Mg²⁺), there are approximately 7.69 × 10²⁴ magnesium ions. This calculation involves converting the mass of magnesium ions to moles.

To determine the number of ions in 310 g of magnesium ions (Mg²⁺), we need to convert the mass of magnesium ions to the number of moles and then use Avogadro's number to calculate the number of ions.

The molar mass of magnesium (Mg) is approximately 24.31 g/mol.

Number of moles = Mass / Molar mass

              = 310 g / 24.31 g/mol

              = 12.75 mol (rounded to two decimal places)

There is one magnesium ion in one mole of magnesium ions (Mg²⁺).

Number of magnesium ions

= Number of moles × Avogadro's number × Number of ions per mole

= 12.75 mol × 6.022 × 10²³ ions/mol × 1 ion

≈ 7.69 × 10²⁴ magnesium ions

Therefore, there are approximately 7.69 × 10²⁴ magnesium ions in 310 g of magnesium ions (Mg²⁺).

Learn more about moles here:

https://brainly.com/question/29367909

#SPJ11

the salt obtained from the combination of the weak acid cyanic acid, hcno, and the weak base ammonia, nh3, is used to make an aqueous solution. is the solution acidic, basic, or neutral? select the correct answer below: neutral acidic basic there is not enough information.

Answers

The aqueous solution of the salt formed from the combination of a weak acid and a weak base is neutral. Option A is correct.

The salt obtained from the combination of a weak acid and a weak base can lead to a neutral, acidic, or basic solution depending on the relative strengths of the acid and base involved. In this case, the weak acid cyanic acid (HCNO) and the weak base ammonia (NH₃) react to form the salt ammonium cyanate (NH₄CNO), which can dissociate in water as follows:

NH₄CNO(s) + H₂O(l) → NH₄⁺(aq) + CNO⁻(aq)

Since ammonium ion (NH₄⁺) is the conjugate acid of the weak base ammonia and cyanate ion (CNO⁻) is the conjugate base of the weak acid cyanic acid, their tendency to either accept or donate protons (H⁺) will depend on their respective acid/base strengths.

In this case, because both the acid and base are weak, the salt will be a neutral salt, which means it will not affect the pH of the aqueous solution. Therefore, the aqueous solution of ammonium cyanate is expected to be neutral. In summary, the salt generated by combining a weak acid with a weak base is neutral in aqueous solution. Option A is correct.

To know more about the Aqueous solution, here

https://brainly.com/question/31312979

#SPJ4

What three steps are involved in forming igneous rocks? WILL GIVE BRAINLEST AND POINTS

Melting, cooling, and hardening
Freezing, heating, and hardening
Melting, condensing, and softening
Freezing, evaporating, and softening

Answers

Answer:

I am pretty sure it is the first one: Melting, cooling and hardening

Explanation:

igneous rocks are made of molten lava and then they cool down and harden  form into a rock. PLEASE correct me if i am wrong.

Aluminum bromide and chlorine gas react to
form aluminum chloride and bromine gas.

Aluminum bromide and chlorine gas react toform aluminum chloride and bromine gas.

Answers

Answer:

ok

Explanation:

4. Plant cells have large, round vacuoles they primarily use for-

Answers

Plant cells have large, round vacuoles they primarily use for water storage so that will be option A.

A vacuole is a membrane-bound organelle found in plant, fungus, and animal cells, as well as certain protist, animal, and bacterial cells. Vacuoles are simply confined compartments filled with water holding inorganic and organic molecules in solution, including enzymes, while in certain situations they may also include solids that have been absorbed.

Vacuoles are generated by the fusing of several membrane vesicles and are just bigger versions of these. The organelle has no fixed form or size; its structure changes depending on the needs of the cell.

The role and relevance of vacuoles vary substantially depending on the kind of cell in which they are found, with plants, fungi, and some protists having far more prominence than animals and bacteria. In general, the vacuole performs the following functions:

Isolating materials that might be toxic or pose a risk to the cellstoring waste productsWater storage in plant cells

Learn more about Vacuoles:

https://brainly.com/question/3109110

#SPJ4

Complete question:

Plant cells have large, round vacuoles they primarily use for -

A) water storage

B) energy production.

C) protein synthesis.

D) waster removal

A solution contains 0.15 M acetic acid and 0.15 ethanol. If the equilibrium constant defined by the reaction in Problem 1 is Kc = 3.00, calculate the equilibrium concentrations of ethyl acetate, acetic acid and ethanol.

Im not sure why you would assume that ethyl acetate is (0.15-x) even tho it should be zero?

Answers

The equilibrium concentrations of Ethyl Acetate, Acetic Acid and Ethanol are 0.0875 M each.

The reaction represented by problem 1 is given as follows:CH3COOH + C2H5OH ↔ CH3COOC2H5 + H2OA solution contains 0.15 M acetic acid and 0.15 ethanol. If the equilibrium constant defined by the reaction in Problem 1 is Kc = 3.00, then the equilibrium concentrations of ethyl acetate, acetic acid and ethanol are given as follows: Ethyl Acetate is (0.15 - x): Here, x represents the molarity of ethyl acetate. Initially, the concentration of Ethyl Acetate is zero. After the reaction comes to equilibrium, the concentration of Ethyl Acetate becomes (0.15 - x). This is because x moles of Ethyl Acetate are produced from 1 mole of acetic acid and 1 mole of ethanol. Due to the law of conservation of mass, the concentration of Ethyl Acetate is equal to (0.15 - x).

Acetic Acid is (0.15 - x): Initially, the concentration of Acetic Acid is 0.15. During the reaction, x moles of Acetic Acid are consumed and the concentration of Acetic Acid becomes (0.15 - x). This is because 1 mole of Acetic Acid is consumed to produce 1 mole of Ethyl Acetate. Ethanol is (0.15 - x): Initially, the concentration of Ethanol is 0.15. During the reaction, x moles of Ethanol are consumed and the concentration of Ethanol becomes (0.15 - x). This is because 1 mole of Ethanol is consumed to produce 1 mole of Ethyl Acetate.

Now, we can calculate the value of x as follows: Kc = [CH3COOC2H5][H2O]/[CH3COOH][C2H5OH]3.00 = x/(0.15 - x)2(0.15 - x)/0.15 = x/2x/0.15 = 2(0.15 - x)/0.15x = 0.0625 M. Now, we can calculate the equilibrium concentrations of Ethyl Acetate, Acetic Acid and Ethanol as follows: Ethyl Acetate = 0.15 - x = 0.15 - 0.0625 = 0.0875 M. Acetic Acid = 0.15 - x = 0.15 - 0.0625 = 0.0875 M Ethanol = 0.15 - x = 0.15 - 0.0625 = 0.0875 M

Therefore, the equilibrium concentrations of Ethyl Acetate, Acetic Acid and Ethanol are 0.0875 M each.

To learn more about Ethanol visit;

https://brainly.com/question/29294678

#SPJ11

What quantity of 75% acid solution must be mixed with a 20% solution to produce 220 mL of a 50% solution

Answers

Answer:

You will have to mix 240 mL of 75% acid with 300 mL of 30% acid to produce 540 mL of 50% acid

Explanation:

What is the exact number of protons in the nucleus of the element group VI A and period 3? 32,8,16,34

Answers

The element group VI A, also known as the chalcogen group, consists of the elements oxygen, sulfur, selenium, tellurium, and polonium. These elements are characterized by having six valence electrons, which is why they are placed in group VI A of the periodic table.

The period number refers to the row of elements on the periodic table. Elements in period 3 include sodium, magnesium, aluminum, silicon, phosphorus, sulfur, chlorine, and argon.

It is not possible to determine the number of protons in the nucleus of an element based on its group and period alone. The number of protons in the nucleus of an element is equal to its atomic number, which is a unique property of each element.

Oxygen, which is the first element in group VI A, has an atomic number of 8, which means it has 8 protons in its nucleus. Sulfur, which is the second element in group VI A, has an atomic number of 16, which means it has 16 protons in its nucleus. Selenium, which is the third element in group VI A, has an atomic number of 34, which means it has 34 protons in its nucleus. Tellurium, which is the fourth element in group VI A, has an atomic number of 52, which means it has 52 protons in its nucleus. Polonium, which is the fifth element in group VI A, has an atomic number of 84, which means it has 84 protons in its nucleus.

Elements in period 3 with atomic numbers 11, 12, 13, 14, 15, 16, 17, and 18 are sodium, magnesium, aluminum, silicon, phosphorus, sulfur, chlorine, and argon, respectively. These elements have 11, 12, 13, 14, 15, 16, 17, and 18 protons in their nuclei, respectively.

An initial quantity of 2. 860 g of PCl5 decomposes in a 700 ml close container. Fill in the ICE table with the appropriate value

Answers

The balanced chemical equation for the breakdown of PCl5 must first be written in order to put up an ICE table for this reaction:

PCl3 (g) + Cl2 = PCl5 (s) (g)

We can see from this equation that one mole of PCl5 produces one mole of PCl3 and one mole of Cl2. Therefore, we can use stoichiometry to calculate the amount of PCl3 and Cl2 produced from the initial quantity of PCl5.

The ICE table will help us keep track of the amount of each substance at different stages of the reaction. Here is how the table would look like:

PCl5 (s) PCl3 (g) Cl2 (g)

Initial 2.860 g 0 g 0 g

Change -x +x +x

Equilibrium 2.860 g - x x x

learn more about chemical equation here:

https://brainly.com/question/30087623

#SPJ4

Directions: For each of the following reactions:
1) Identify the type of reaction (Single Replacement, combination, double replacement, decomposition, or combustion)
2) Complete the reaction
3) Balance it



1) Ammonium Nitrate is added to sodium chloride
2) Lithium Chloride is added to Zinc Phosphate
3) Zinc is added to lithium chloride
4) Iron is added to a solution of silver nitrate
5) A solution of copper II sulfate is added to an iron nail
6) Octane (C8H18) is burned in air

Directions: For each of the following reactions:1) Identify the type of reaction (Single Replacement,

Answers

The first two reactions are double displacement reactions, the next three equations are single replacement reactions, and the last equation is a type of decomposition reaction.

Define balanced reaction.

An equation for a chemical reaction is said to be balanced if both the reactants and the products have the same number of atoms and total charge for each component of the reaction. In other words, both sides of the reaction have an equal balance of mass and charge.

Chemical formulae and symbols are used in chemical equations to depict chemical reactions. In a chemical equation, the reactants are represented on the left and the products are shown on the right.

To learn more about balanced reactions visit:

brainly.com/question/11904811

#SPJ1

The following are characteristics of ideal chemical sanitizer except:
A. Approved for food contact surface application C. High in toxicity and corrosivity
B. Destroys microorganisms rapidly
D. Leaves no residues

Answers

The following are characteristics of ideal chemical sanitizer except: Option A. Approved for food contact surface application and option C. High in toxicity and corrosivity

Chemical substances that are capable of eradicating disease-causing microorganisms are also used to sanitize. Chlorine (bleach), iodine, and quaternary ammonium are common sanitizers. Chemical disinfectants are widely used in the food service sector.

The most often used sanitizers are those that contain chlorine. They work well against all bacteria and are reasonably priced. The ideal temperature range for bleach is between 55°F and 75°F. Hot water reduces the effectiveness of bleach. In diluted form, quaternary ammonium compounds are tasteless, colorless, and harmless.

Hospitals mostly employ the following five EPA-registered substances as disinfectants at the moment: quaternary ammonium, hypochlorite, accelerated hydrogen peroxide, phenolics, and peracetic acid.

To learn more about chemical sanitizer Please click on the given link:

https://brainly.com/question/8297409

#SPJ4

giycyigiycilne + H,0 → zgiycine [S] (mM) Product formed (µmol min) 1.5 0.21 2.0 0.24 3.0 0.28 4.0 0.33 8.0 0.40 16.0 0.45 Calculate the standard error of regression (SER) for the Lineweaver-Burk slope and the Eadie-Hofstee slope to compare the precision of each. Lineweaver-Burk SER: ___ µmol min-! Eadie-Hofstee SER: _____µmol min-!

Answers

To calculate the standard error of regression (SER) for the Lineweaver-Burk slope and the Eadie-Hofstee slope, you should follow these steps:

Step 1: Transform the given data into Lineweaver-Burk and Eadie-Hofstee forms.
For Lineweaver-Burk (LB), use the equation 1/V = (1/Vmax) * (1/[S]) + (Km/Vmax) * (1/[S]).
For Eadie-Hofstee (EH), use the equation V/[S] = Vmax - (Km * V).

Step 2: Perform linear regression on the transformed data to obtain the slope (m) and intercept (b) for both the LB and EH plots.

Step 3: Calculate the residuals for both LB and EH.
Residual = Observed value - Predicted value

Step 4: Calculate the sum of squared residuals (SSR) for both LB and EH.
SSR = Σ(\(residual^2\))

Step 5: Calculate the SER for both LB and EH using the formula:
SER = √(SSR / (n - 2))
where n is the number of data points.

Please note that due to the complexity of the given data and the limited capabilities of this platform, I am unable to provide the exact numerical values for the Lineweaver-Burk SER and the Eadie-Hofstee SER. However, you can use the steps provided above to calculate the SERs using statistical software or a spreadsheet application.

To know more about "Error of regression" refer here:

https://brainly.com/question/15875279#

#SPJ11

Who developed the first scientific atomic theory?

Answers

Answer:

John Dalton

Explanation:

John Dalton (1766-1844) is the scientist credited for proposing the atomic theory. This theory explains several concepts that are relevant in the observable world.

how much energy is absorbed in breaking up the water molecules?


Answers

Answer:

1852 kJ/mol

Explanation:

Other Questions
consider the four scenarios involving visible light. in scenario a, visible light has a wavelength of 690.4 nm. determine its frequency, energy per photon, and color. What effect did thermal pollution have on water hardness? Explain why this occurred. itComplete each sentence with a verb (one or two words).1 I've lost one of my gloves. I must have droppedhave dropped it somewhere2 Their house is very near the motorway. It mustbevery noisy3 You've lived in this village a long time. You mustknowevery4 I don't seem to have my wallet with me. I must5 "How old is Fd?' 'He's older than me. He must6 I didn't hear my phone. I mustasleep7 'You're going on holiday soon. You mustforward8 I'm sure you know this song. You mustit before9 The road is closed, so we have to go another way. There mustDo you have a car?' 'You must! How could la1 David is the managing director of a large company, so he must A nurse is caring for a client who has a peripheral IV inserted for fluid replacement The nurse is assessing the client. Which of the following actions should the nurse take? Select all that apply. Exhibit a Nurses' Notes Day 1: Lactated Ringers at 100 ml/hir intusing into a 20-guage IV catheter in left hand. IV dressing dry and intact. IV site without redness or swelling. I fluid infusing well a Start a new w in the client's left hand, Place a presture dressing over the site Apply heat to the clients left hand. Elevate the client's left arm Day 2 IV site edematous. Skin surrounding catheter site tout blanched, and cool to touch. IV fluid not infusing, Stop the IV infusion Are unenumerated rights protected by the Constitution?. what is an important result of industrialization The scatterplot shows the relationship of scores for students who took a math test and history test. Based on a line of best fit, what score would be the BEST prediction for a student's history test if they made a 60 on their math test? A) 50 B) 60 C) 70 D) 75 in a single growing season, the country of pastoral can raise 100 tons of beef or produce 1,000 boxes of tulips. in the same growing season, the country of bucolic can raise 50 tons of beef or produce 750 boxes of tulips. at which of the prices below will trade occur between the two countries? allowing departments to make their own software and hardware purchases increases efficiency and minimizes the need for centralized support. Which is the balanced equation for S8 + O2 SO2?S8 + O16 8SO2S8 + O2 S8 + O2S8 + O2 S8O2S8 + 8O2 8SO2 acme global allows managers time off to attend classes and pays tuition for managers who are pursuing a master of business administration (mba) degree. tuition reimbursement is considered in the compensation system. a. benefits b. wage and salary add-ons c. incentive pay d. base pay What are the components of total quality management (tqm)? Tell whether the lines through the given points are parallel, perpendicular, or neither.Line 1: (10,5), (-8,9)Line 2: (2, - 4), (11, -6)The slope of line 1 is...The slope of line 2 is...These 2 lines are... According to the essay article, the exodus is the formative event for the early Israelites (Hebrews), not because they would become a nation, but what did God show the Hebrews that they already saw in Genesis? Whew! You helped collect all the treasures and Meg is very grateful. Now, reflect on what you learned. In a few sentences, write about what you learned while exploring fractions using the interactive number line. how do u say "i like science class" in spanish most simple way i need this for beginners spanish three stages involved in a financial statement audit include: (1) plan the audit, (2) obtain an understanding of the client and its environment and (3) assess the risks of misstatement and design further audit procedures. ordinarily the sequence in which these steps occur is: PLEASE HELP!! NO BOTS OR LINKS!!! Given the algebraic expression (27x ^ 5/3) ^ -1/3 create an equivalent expression Which angle is the included angle for sides ABand BC?ACO Angle BAngle CO Angle AB 1- Show that Au is the projection of u on the x axis.2- modify the matrix A to obtain a matrix B so that Bu is theprojection of u on the u axis. A= [1 0; 0 0] u[a;b]