Answer:
See explanation
Explanation:
A retort stand is a piece of scientific equipment intended to support other pieces of equipment and glassware — for instance, burettes, test tubes and flasks.Biohazardous waste products include infectious waste, animal waste, used sharps, discarded vaccines, and pathological waste.What volume of a 0.100 M AgNO3 solution is required to completely react with the CaCl2 in 3.00 L of a 0.100 M CaCl2 solution? The balanced chemical equation is:
Based on the balanced chemical equation 2\(Ag(NO)_{3}\)(aq) + \(CaCl_{2}\)(aq) → 2AgCl(s) + \(Ca(NO)_{3}2\)(aq), the volume of a 0.100 M \(Ag(NO)_{3}\)solution required to completely react with the \(CaCl_{2}\) in 3.00 L of a 0.100 M \(CaCl_{2}\) solution is 3.00 L.
To determine the volume of the \(Ag(NO)_{3}\) solution required to react with the \(CaCl_{2}\) solution, we need to consider the balanced chemical equation and the stoichiometry of the reaction. The balanced chemical equation is:
2\(Ag(NO)_{3}\)(aq) + \(CaCl_{2}\)(aq) → 2AgCl(s) + \(Ca(NO)_{3}\)2(aq)
From the equation, we can see that 2 moles of \(Ag(NO)_{3}\) React with 1 mole of \(CaCl_{2}\) to produce 2 moles of AgCl. Given that the \(CaCl_{2}\) solution has a concentration of 0.100 M and a volume of 3.00 L, we can calculate the number of moles of \(CaCl_{2}\)present: moles of \(CaCl_{2}\) = concentration of \(CaCl_{2}\) × volume of \(CaCl_{2}\) solution
= 0.100 M × 3.00 L
= 0.300 moles
According to the stoichiometry of the equation, 1 mole of CaCl2 reacts with 2 moles of \(Ag(NO)_{3}\). Therefore, the number of moles of \(Ag(NO)_{3}\)required to react with the given amount of \(CaCl_{2}\) is also 0.300 moles. Now, we can calculate the volume of the \(Ag(NO)_{3}\) solution using its concentration:
volume of \(Ag(NO)_{3}\) solution = moles of \(Ag(NO)_{3}\)/ concentration of \(Ag(NO)_{3}\)
= 0.300 moles / 0.100 M
= 3.00 L
Hence, 3.00 L of the 0.100 M \(Ag(NO)_{3}\) solution is required to completely react with the \(CaCl_{2}\) in 3.00 L of the 0.100 M \(CaCl_{2}\)solution based on the balanced chemical equation and stoichiometry of the reaction.
Know more about moles here:
https://brainly.com/question/29367909
#SPJ8
1. Give the structural formula for the following molecules
2,3-dimethyl heptane
2,3-dimethylheptane is an organic compound with the chemical formula C9H20. It belongs to the class of hydrocarbons known as alkanes, specifically heptanes.
The compound is a branched alkane, meaning it has a chain of seven carbon atoms with two methyl groups (CH3) attached to the carbon atoms at positions 2 and 3. The molecular structure of 2,3-dimethylheptane can be represented as follows: CH3-CH(CH3)-CH(CH3)-CH2-CH2-CH2-CH3 In this structure, the two methyl groups are attached to the second and third carbon atoms in the heptane chain. The compound is a colorless liquid at room temperature and is primarily used as a solvent or as a component in gasoline blends. It has a relatively high octane rating, which makes it desirable for use in gasoline to improve its overall performance and reduce engine knocking.
Learn more about dimethylheptane here:
https://brainly.com/question/31481603
#SPJ11
i need help on question 3 true or false thxxx quick i’m timed
Answer:
The answer is true.
How does the concentration of soudium thiosulfate affect the rate of reaction with dilute hydrochloric acid?
Your plan should give valid results.
Answer:
As the concentration of Sodium Thiosulphate increases the length of time for cross to disappear decreases. This is because the increase of concentration of Sodium Thiosulphate will increase the rate of reaction between Hydrochloric acid and sodium Thiosulphate particles.
Explanation:
Logic...
which reaction occurs at the anode of a lead-storage battery while it is in use to start a car
Answer: Oxidation happens at the anode and reduction happens at the cathode.
At the anode of a lead-storage battery while it is in use to start a car, the following reaction occurs: Pb(s) → Pb²⁺(aq) + 2e⁻.
In a lead-storage battery, the anode is the negative electrode where oxidation takes place during discharge. During the process of starting a car, the battery provides electrical energy to power the starter motor. At the anode, the reaction involves the oxidation of solid lead (Pb) to form lead ions (Pb²⁺) in an aqueous solution and release two electrons (2e⁻). This reaction is represented as:
Pb(s) → Pb²⁺(aq) + 2e⁻
The lead ions formed at the anode combine with sulfate ions (SO₄²⁻) from the electrolyte to form lead sulfate (PbSO₄) as a solid precipitate. This reaction occurs at the positive electrode, known as the cathode.
During the charging process, the reactions at the anode and cathode are reversed, and the lead sulfate is converted back to lead and lead dioxide, respectively, through a series of chemical reactions. This allows the battery to be recharged and ready for the next use.
learn more about lead-storage battery here:
https://brainly.com/question/14773324
#SPJ11
what is the density of a gas at STP that has a molar mass of 50.0 g/mol?
Answer:
2.232 g/L
Explanation:
Assuming 1 mol, volume at STP is 22.4 L so you simply divide 50g by 22.4 L to get density
The density of the given gas is required.
The density of the gas at STP is 2.232 g/L.
M = Molar mass of gas = 50 g/mol
1 mole of any gas at STP occupies 22.4 L.
V = Volume per mole = 22.4 L/mol
Density is given by
\(\rho=\dfrac{M}{V}\\\Rightarrow \rho=\dfrac{50}{22.4}\\\Rightarrow \rho=2.232\ \text{g/L}\)
Learn more:
https://brainly.com/question/8684338
https://brainly.com/question/12247942
(iii) Define ei and briefly describe the impact of molar expansion on the volume of a plug flow reactor in each of the above two cases, i.e. parts (i) and (ii). [4 MARKS]
Molar expansion accounts for the changes in the number of moles of a component within a reactor and can have a significant impact on the volume of a plug flow reactor, particularly in cases where the reactor volume is not constant.
(iii) "ei" is commonly used to represent the molar expansion term in chemical reaction engineering equations. It refers to the change in molar flow rate of a particular component i per unit time, per unit volume. The molar expansion term accounts for the variation in the number of moles of a component within a reactor due to chemical reactions or phase changes.
In a plug flow reactor, molar expansion can have different impacts on the reactor volume depending on the specific case. In part (i), where there is a constant volume, the molar expansion does not affect the reactor volume. The molar flow rates of reactants and products may change due to reactions, but the overall volume remains constant.
In part (ii), where the reactor is a semi-batch reactor with a varying volume, the molar expansion can significantly influence the volume of the reactor. As the reaction proceeds, the molar flow rates of reactants and products change, which can lead to changes in the total number of moles and, consequently, impact the reactor volume. The volume may increase or decrease depending on the molar expansion and the specific reaction taking place.
to learn more about Molar click here:
brainly.com/question/16587536
#SPJ11
Suppose that you know that the reaction shown below is the first order reaction. What is the concentration of A after 1.5 min of the beginning of reaction if the initial concentration of Ais 0.78 M and the rate constant of reaction is 0.037 s^-1? A → B a. 0.75 M b. 0.72M c. 0.028 M d. 0.22 M e. 0.74 M
The concentration of A after 1.5 min is 0.1625 M. The closest answer choice is (c) 0.028 M, which is correct.
To solve this problem, we can use the first-order rate law, which states that the rate of a first-order reaction is proportional to the concentration of the reactant:
Rate = k[A]
where k is the rate constant and [A] is the concentration of A.
We can rearrange this equation to solve for [A]:
[A] = (Rate) / k
We are given the initial concentration of A (0.78 M), the rate constant (0.037 s^-1), and the time elapsed (1.5 min). To find the rate of the reaction at this time, we need to use the half-life equation for first-order reactions:
t1/2 = ln(2) / k
where t1/2 is the half-life of the reaction. Solving for t1/2, we get:
t1/2 = ln(2) / 0.037 s^-1 = 18.7 s
This means that the concentration of A will decrease by half every 18.7 seconds.
To find the rate of the reaction after 1.5 min (or 90 seconds), we can divide the elapsed time by the half-life:
90 s / 18.7 s = 4.8
This means that the concentration of A will have decreased by a factor of 4.8 after 1.5 min.
Using the equation [A] = (Rate) / k and plugging in the initial concentration of A and the new rate, we get:
[A] = (0.78 M) / 4.8 = 0.1625 M
Therefore, the concentration of A after 1.5 min is 0.1625 M. The closest answer choice is (c) 0.028 M, which is correct.
For more questions on first order reaction : https://brainly.com/question/31379589
#SPJ11
The formula for impulse is Δ⍴ = Force*Δt, where Δ⍴ is the change in momentum, Force is the applied force, and Δt is the change in time. Think about the formula for impulse AND the amount of time it takes for the egg drop device to stop. How would increasing this amount of time help protect your egg? (Hint: Think of the formula this way, Force = Δ⍴ / Δt).
(this is for an egg drop project.)
Increasing the amount of time it takes for the egg drop device to stop would help protect the egg because it would decrease the force acting on the egg, according to the formula Force = Δ⍴ / Δt.
Impulse and Time calculation explained.
When the device comes to a stop, the change in momentum (Δ⍴) of the egg will be the same as the change in momentum of the device. If the device stops abruptly, the time interval (Δt) will be small, which means that the force acting on the egg will be larger (since Force = Δ⍴ / Δt). This large force could cause the egg to break.
On the other hand, if the device stops over a longer period of time, the time interval (Δt) will be larger, which means that the force acting on the egg will be smaller (since Force = Δ⍴ / Δt). This smaller force will be less likely to break the egg, making it more likely to survive the fall.
Therefore, increasing the amount of time it takes for the egg drop device to stop will help protect the egg by reducing the force acting on it and increasing the chances of a successful landing.
Learn more about impulse below.
https://brainly.com/question/229647
#SPJ1
pull
friction
A basket of apples is pulled with a constant force. A friction force acts in a direction opposite to the motion. The basket starts at rest and
increases its speed over time. Choose three actions that will REDUCE the rate at which the speed of the basket changes.
Pull with less force
Pull with more force
Add an apple to the basket
Take an apple out of the basket
Smooth the surface of the table to decrease friction
Roughen the surface of the table to increase friction
Answer:
Pull with less force, Add an apple to the basket, and Roughen the surface of the table to increase friction
Explanation:
SCIENCE I NEED HELP ASAP⭐️⚡️
Answer:
plants
Explanation:
a piston confines 0.200 mol ne(g) in 1.20 l at 25 8c. two experiments are performed. (a) the gas is allowed to expand through an additional 1.20 l against a constant pressure of 1.00 atm. (b) the gas is allowed to expand reversibly and isothermally to the same final volume. which process does more work?
A piston confines 0.200 mol Ne(g) in 1.20 l at 25 °C . Two experiments are performed. The process does more work is the second experiment.
(a) The gas is allowed to expand through the additional 1.20 L against the constant pressure of the 1.00atm
Irreversible path is as :
W = -Pex × ΔV
Where
Pex = 1.00 atm
ΔV = 1.20 L
W = - (1.00 atm) × 1.20 L
W = -1.20 L. atm × 101.325 J /1 L.atm
W = -121.59 J
(b) The gas is allowed to expand the reversibly and the isothermally to the same final volume is as :
W = - nRT ln (V final / V initial)
Where
n = the number of moles = 0.200
R = gas constant = 8.3145 J/K.mol
T = 298 Kelvin
V final / V initial = 2.40 / 1.20 = 2
W = - (0.200mol) × 8.3145 J/K.mol × 298K × ln(2.4/1.2)
W = - 343.5 J
Thus the second one does the more work.
To learn more about work here
https://brainly.com/question/13945379
#SPJ4
pls I need help Which of the following can be predicted using the activity series? (1 point) Speed of an acid-base reaction .Speed of a double replacement reaction .Possibility of a double replacement reaction. Od Possibility of a single replacement reaction.
Answer: Possibility of a single replacement reaction
Explanation:
The activity of the series of element is determined by the single replacement reactions. The activity series of element can be used to predict the possibility of a single replacement reaction.
What is single replacement reaction?A single replacement reaction is one in which one substance is replacing the other. The replacement of a metallic ion in solution by a metal atom higher in the activity series than the metal in solution falls into this category of reactions.
The reaction is depending on the reactivity of the elements. If the reactivity of the elements is very low, then the reaction very slow, some time reaction can not take place. To get reaction there is some driving force is needed.
The relative position of the two elements in the activity series provides the driving force for this kind of reaction. More active elements undergo readily reaction then less reactive like noble gas elements. It very necessary to elements very active to get react.
To find more about displacement reaction, refer the link below:
brainly.com/question/3172917
#SPJ2
caso4 · 2h2o is a(n)answerbecause it always contains a fixed ratio of water molecules to calcium and sulfate ions.
The 2h2o stands for calcium sulfate dihydrate, which means it has two water molecules connected to the calcium sulfate crystal lattice.
The correct answer to the statement "caso4 · 2h2o is a hydrate because it always contains a fixed ratio of water molecules to calcium and sulfate ions" is hydrate.
What is a hydrate?
A hydrate is a crystalline compound that includes water molecules in its composition. The water molecules are included as part of the crystal lattice, which means they are connected to the ions in the compound through hydrogen bonding.
The water molecules are usually eliminated from the hydrate when it is heated, resulting in an anhydrous compound.\A hydrate is characterized by a specific ratio of water molecules to the number of ions in the compound, and this ratio is constant throughout the substance.
Therefore, caso4 · 2h2o is a hydrate because it always contains a fixed ratio of water molecules to calcium and sulfate ions, as stated in the question.
In this case, caso4 ·
2h2o stands for calcium sulfate dihydrate, which means it has two water molecules connected to the calcium sulfate crystal lattice.
Learn more about calcium with the given link,
https://brainly.com/question/26636816
#SPJ11
For the equilibrium reaction given below, indicate the effect on the position of equilibrium if a catalyst is added to the reaction mixture. 2H, (9) + 02 (9)= 27,0 (9)+ heat O it will shift to make more reactant it will shift to make more product it will increase the pressure of the system there is no effect on the position of equilibrium Question 31 (1 point) The correct nuclide symbol for a calcium atom that has 24 neutrons is Oca 2oCa Question 32 (1 point) Question 33 (1 point) Whether or not a reaction is spontaneous is determined by O the size of the container the sign of AH the sign of as the sign of AG Question 34 (1 point) Question 36 (1 point) Which of the following formulas is written correctly? o CGH12O6 O Ch1206 C6H1206 CH1206 Question 37 (1 point)
Adding a catalyst to a reaction mixture does not have any effect on the position of equilibrium. A catalyst is a substance that increases the rate of a reaction by providing an alternate pathway with lower activation energy.
Adding a catalyst to a reaction mixture does not have any effect on the position of equilibrium. A catalyst is a substance that increases the rate of a reaction by providing an alternate pathway with lower activation energy. It speeds up both the forward and backward reactions equally, allowing the system to reach equilibrium faster, but it does not change the position of equilibrium. The equilibrium constant (Kc) remains the same before and after the addition of a catalyst. Therefore, the concentrations of the reactants and products at equilibrium do not change. In summary, a catalyst is a substance that speeds up a reaction, but it does not affect the position of equilibrium.
To know more about catalyst visit: https://brainly.com/question/24430084
#SPJ11
the process though which animals and plants produce offspring
Answer:
reproduction
Explanation:
can be asexual or sexual
1 mole of an ideal ga i expanded from a volume of 1. 00 liter to a volume of 8. 93 liter againt a contant external preure of 1. 00 atm. How much work (in joule) i performed on the urrounding?
The work (in joule) performed on the surrounding when 1 mole of an ideal gas expanded from a volume of 1. 00 liter to a volume of 8. 93 liter against a constant external pressure of 1. 00 atm is 803 joules
we know that,
n = 1 mole
Vi = 1 L
Vf = 8.93 L
P = 1 atm
the work performed on the surrounding under constant pressure is given as can be calculated as below:
W = P∆V
W = P(Vf—Vi)
W = 1 atm × (8.93—1) L
W = 1 atm × 7.93 L
W = 8.93 Litre•atm
Given that,
1 Litre•atm = 101.3J
So,
W = 7.93 Litre•atm × 101.3J/Litre•atm
W = 803.309 J
W ≈ 803 J
Then the work done on the surrounding is approximately
803 joules
Learn more about work here:
https://brainly.com/question/15688519
#SPJ4
Question 1 (2 points)
The higher the frequency of a wave, the lower the energy.
True
False
Answer:
False
Explanation:
There is a direct relationship between wave frequency and energy...
The higher the frequency, the higher the energy
alternatively, the lower the frequency, the lower the energy
share one occasion in which you exhibited any of the reasoning biases or heuristics covered in this week’s zaps lab
Answer:
Heuristics are the "shortcuts" that humans use to reduce task complexity in judgment and choice, and biases are the resulting gaps between normative behavior and the heuristically determined behavior (Kahneman et al., 1982).
The availability heuristic works by prioritizing infrequent events based on recency and vividness. For example, plane crashes can make people afraid of flying. However, the likelihood of dying in a car accident is far higher than dying as a passenger on an airplane.
The three heuristics that received most attention were availability, representativeness, and anchoring and adjustment. The availability heuristic refers to the tendency to assess the probability of an event based on the ease with which instances of that event come to mind.
Heuristics are mental shortcuts that allow people to solve problems and make judgments quickly and efficiently. These rule-of-thumb strategies shorten decision-making time and allow people to function without constantly stopping to think about their next course of action.
While the deodorant example is obviously simple, biases and heuristics play a role in almost all decisions we make. Choices about who to hire, how to invest in the stock market, and when to seek medical care when something ails us are examples of more important decisions that are all influenced by biases and heuristics.
Biases can occur due to various reasons, with the most common causes being: Heuristics. These are biases that are caused by our use of mental shortcuts. Limited cognitive capacity. These are biases that are caused by our limited cognitive capacity. Noisy information processing.
Heuristics help make life easier and allow us to make quick decisions that are usually pretty accurate. Being aware of how these heuristics work as well as the potential biases they introduce might help you make better and more accurate decisions.
Another cognitive bias that has its roots in the availability heuristic is known as the optimism bias. Essentially, we tend to be too optimistic for our own good. We overestimate the likelihood that good things will happen to us while underestimating the probability that negative events will impact our lives.
Explanation:
Please Help!!!!!
7. If I initially have 4.0 L of a gas at a pressure of 1.1 atm, what will the volume be if I increase the pressure to 3.4 atm?
8. A toy balloon has an internal pressure of 1.05 atm and a volume of 5.0 L. If the temperature where the balloon is released is 200 C, what will happen to the volume when the balloon rises to an altitude where the pressure is 0.65 atm and the temperature is –150 C?
9. A small research submarine with a volume of 1.2 x 105 L has an internal pressure of 1.0 atm and an internal temperature of 150 C. If the submarine descends to a depth where the pressure is 150 atm and the temperature is 30 C, what will the volume of the gas inside be if the hull of the submarine breaks?
10. People who are angry sometimes say that they feel as if they’ll explode. If a calm person with a lung capacity of 3.5 liters and a body temperature of 360 C gets angry, what will the volume of the person’s lungs be if their temperature rises to 390 C. Based on this, do you think it’s likely they will explode?
Answer:
7. 1.29L
8. 4.29L
9. 855L
10. 3.53L
Explanation:
Who will win the super bowl? Kansas City Chiefs Or the Tampa Bay Buccaneers
Answer: Kansas City Chiefs
Explanation: what ever you think.
how many group and periods are there in modern periodic table
Answer:
there is 7 periods and 18 groups
Explanation:
-------☆゚.・。°☁️ Define a chemical reaction.
Answer:
The combination,decomposition and displacement of or between atoms or a molecule during chemical change is called chemical reaction.
Explanation:
Answer:
Chemical reaction is defined as the process in which two or more than two reactants react together to form a different products at certain condition.
eg.
2H2+02=2H20
here hydrogen and oxygen react to form a water.
What pollutants can contribute to acid precipitation and how are these pollutants generated?
Answer:
I don't know I don't know about question but I can try to find it
Explanation:
I don't know about question but I can try to find it
A container with a volume 2.0 L is filled with a gas at a pressure of 1.5 atm. By decreasing the volume of
the container to 1.0 L, what is the resulting pressure? Type in your answer using the correct number of
significant figures. Remember to use the formula for Boyle's law: P₁V₁ = P₂V₂
atm
The resulting pressure of the gas after decreasing the initial volume is 3 atm.
What is Boyle's Law?According to the Boyle's Law at constant temperature, pressure of the gas is inversely proportional to the volume of the gas:
P ∝\(\frac{1}{V}\)
For the given question required equation is:
P₁V₁ = P₂V₂, where
P₁ = initial pressure = 1.5 atm
V₁ = initial volume = 2 L
P₂ = final pressure = ?
V₂ = final volume = 1 L
On putting all these values on the above equation, we get
P₁V₁ = P₂V₂
P₂ =\(\frac{1.5}{2X1}\) = 3atm
Hence required pressure is 3 atm.
Learn more about Boyle's Law here:
https://brainly.com/question/1437490
#SPJ1
Which two events will happen if more H2 and N2 are added to this reaction after it reaches equilibrium?
3H2 + N2 to 2NH3
If more \(H_{2}\) and \(N_{2}\) are added to the reaction 3\(H_{2}\) + N2 → 2\(NH_{3}\) after it reaches equilibrium, two events will occur Shift in Equilibrium and Increased Yield of \(NH_{3}\)
1. Shift in Equilibrium: According to Le Chatelier's principle, when additional reactants are added, the equilibrium will shift in the forward direction to consume the added reactants and establish a new equilibrium. In this case, more \(NH_{3}\) will be produced to counteract the increase in \(H_{2}\) and \(N_{2}\).
2. Increased Yield of \(NH_{3}\): The shift in equilibrium towards the forward reaction will result in an increased yield of \(NH_{3}\). As more \(H_{2}\) and \(N_{2}\) are added, the reaction will favor the production of \(NH_{3}\) to maintain equilibrium. This will lead to an increase in the concentration of \(NH_{3}\) compared to the initial equilibrium state.
It is important to note that the equilibrium position will ultimately depend on factors such as the concentrations of \(H_{2}\), \(N_{2}\), and \(NH_{3}\), as well as the temperature and pressure of the system. By adding more reactants, the equilibrium will adjust to achieve a new balance, favoring the formation of more \(NH_{3}\).
Know more about Le Chatelier's principle here:
https://brainly.com/question/2943338
#SPJ8
Write the formulas for the methylmercury
ion, for two of its common molecular forms, and for dimethylmercury. What is the principal source of exposure of humans to methylmercury?
The formulas for methylmercury ion and two of its common molecular forms are CH₃Hg⁺, CH₃HgCl, and (CH₃)²Hg. The principal source of exposure of humans to methylmercury is contaminated seafood.
The formula for the methylmercury ion is CH₃Hg⁺. It consists of a methyl group (CH₃) attached to a mercury ion (Hg+). Methylmercury can also form various molecular forms depending on its interaction with other compounds. One common form is methylmercury chloride (CH₃HgCl), where a chloride ion (Cl-) replaces one of the hydrogen atoms in the methylmercury ion. Another form is dimethylmercury ((CH₃)²Hg), which contains two methyl groups attached to a mercury atom.
The principal source of human exposure to methylmercury is the consumption of contaminated seafood. Methylmercury is produced in aquatic environments through microbial transformations of inorganic mercury. It biomagnifies through the food chain, accumulating in higher levels in predatory fish and marine mammals. When humans consume contaminated seafood, particularly large predatory fish like shark, swordfish, and king mackerel, ingestion they can be exposed to methylmercury. This exposure poses health risks as methylmercury is a potent neurotoxin that can affect the central nervous system, especially in developing fetuses and young children. Therefore, it is important to be aware of the potential sources of methylmercury and make informed choices regarding seafood consumption.
Learn more about ingestion here
https://brainly.com/question/31748343
#SPJ11
What is the "percent
abundance" of the size 14d
nails in this sample?
Nail Size
4d
14d
Number
of Nails
123
77
Abundance Mass
(%)
(g)
3.65
11.95
[?]
Percent Abundance
Weighted
Average (g)
6.8
The percent abundance of each nail sample would 61.5 and 38.5% respectively.
What is percent abundance?
The percent abundance of a component of a sample is the ratio of the amount of the component and the total amount of the sample itself.
The percent abundance can be mathematically expressed as:
Percent component in a sample = amount of component/amount of total sample x 100
In this case, the total number of nails can be calculated as:
123 + 77 = 200 nails.
Percent of 4d nails = 123/200 x 100 = 61.5%
Percent of 14d nails = 77/200 x 100 = 38.5%
This means that the percent component of each of the nail sizes in the sample is 61.5 and 38.5% respectively.
More on percent composition can be found here: https://brainly.com/question/17505281
#SPJ1
help me out please and thank you
The metals that are able to displace iron sulfate from solution are magnesium and aluminum.
What is the electrochemical series?The electrochemical series is a series that shows the reactivity of the metals. We must note that the order of the reactivity of the metals depends on the electrode potential of the metal. The metals that have a higher electrode potential would tend to react better and faster.
Also note that, the metals that are higher in the electrochemical series are able to displace the metals that are lower in the series from their aqueous solutions. This implies that if we add a metal to a solution that contains a meta that is lower in the electrochemical series, the lower meta is discharged from solution.
As we can see, when we add each of these metals to the iron sulfate solution, the only time that we would be able to have a reaction is when we add the aluminum or the magnesium metals.
Learn more about metals:https://brainly.com/question/18153051
#SPJ1
n aqueous solution of a compound with a molar mass of 34.02 g/mol is 21.5% by mass and has a density of 1.13 g/cm3. what is the molarity of the solution?
Molarity of the solution is 0.071
What is the molarityaqueous solution of a compound with a molar mass of 34.02 g/mol is 21.5% by mass and has a density of 1.13 g/cm3
The moles of solute per liter of solution is measured as molarity. By dividing the quantity of moles by the compound's molecular mass, convert the result to density. By converting to grams per liter and dividing by the compound's molecular mass in grams, you may convert density to molarity.The equation is as follows: Molarity = (% by weight 10 d)/GMM. Density (d) and gram molecular mass (GMM) are used here.
Derive the formula : Molarity = (% by weight × 10 × d )/ GMM
(21.5% *10 *1.13 ) /34.02 = 0.071.
Molarity of the solution is 0.071
To learn more about Molarity refer to:
https://brainly.com/question/26873446
#SPJ4