Answer:
Lathanum
Explanation:
Calculate the wavelength of light if the energy is 3.82 x 10^-18 J?
Answer:
hi hehe I'm new here hehehe
What is the mass of a lead block that has a volume of 30 mL?
O 3.39 grams
O .377 mL
O 265 mL
O 339 grams
Answer:
d
Explanation:
i think it's d, but I'm not sure. my answer is a little different but maybe i used a different number for the density of lead (11.35g/cc)
Methyl hydrazine (N2H3CH3) is a common liquid propellant used in rocket fuels. Look for the standard molar enthalpies of formation of the reactants and products. Calculate the ∆H˚ for the reaction per mole of N2H3CH3.
4N2H3CH3(l) + 5N2O4(l) → 12H2O(g) + 9N2(g) + 4CO(g)
The standard enthalpy of reaction of the given reaction is -865.71 kJ per mole of N₂H₃CH₃.
What is the standard molar enthalpy of formation?The standard molar enthalpy of formation of a compound is defined as the enthalpy of formation of 1.0 mol of the pure compound in its stable state from the pure elements in their stable states at P = 1.0 bar at a constant temperature.
Let's consider the following equation.
4 N₂H₃CH₃(l) + 5 N₂O₄(l) → 12 H₂O(g) + 9 N₂(g) + 4 CO(g)
We can calculate the standard enthalpy of the reaction using the following expression.
ΔH° = Σnp × ΔH°f(p) - Σnr × ΔH°f(r)
where,
ΔH° is the standard enthalpy of the reaction.n is stoichiometric coefficient.ΔH°f is the standard molar enthalpy of formation.p are the products.r are the reactants.ΔH° = 12 mol × ΔH°f(H₂O(g)) + 9 mol × ΔH°f(N₂(g)) + 4 mol × ΔH°f(CO(g)) - 4 mol × ΔH°f(N₂H₃CH₃(l)) - 5 mol × ΔH°f(N₂O₄(l))
ΔH° = 12 mol × (-241.81 kJ/mol) + 9 mol × (0 kJ/mol) + 4 mol × (-110.53 kJ/mol) - 4 mol × (54.20 kJ/mol) - 5 mol × (-19.56 kJ/mol)
ΔH° = -3462.84 kJ
In the balanced equation, there are 4 moles of N₂H₃CH₃. The standard enthalpy of reaction per mole of N₂H₃CH₃ is:
-3462.84 kJ / 4 mol = -865.71 kJ/mol
The standard enthalpy of reaction of the given reaction is -865.71 kJ per mole of N₂H₃CH₃.
Learn more about enthalpy here: https://brainly.com/question/11628413
A solution is prepared by dissolving a solid in a liquid. What does the vapor pressure of the liquid depend on?A.the solution molarityB.the solution molalityC.the mole fraction of the liquidD.the mass percent of the solid
• The factors that influence vapour pressure is amongst others surface area.
• So the most suitale nswer will be the mole raction of the liquid will influence vapour pressure.
• Option C is the most closest answer,.
How is citric acid, a 6-carbon compound, produced in the krebs cycle?
Actually, acetyl-CoA and OAA, a four-carbon molecule, unite to start the Krebs cycle (oxaloacetate). Citric acid, which has six carbon atoms, is the result of this
The Krebs cycle is sometimes known as the citric acid cycle for this reason.
Since citric acid is also the first byproduct of the Krebs cycle, it is present in nearly every living thing's metabolism.
Recall that the first stage of cellular respiration, glycolysis, yields two pyruvate molecules. These substances enter a mitochondrion's matrix, where they initiate the Krebs cycle.
Pyruvic acid produced during glycolysis initiates the Krebs cycle. The diagram's tiny circles stand in for one carbon atom. For instance, OAA (oxaloacetate) is a four carbon molecule, but citric acid is a six carbon molecule. As the cycle continues, pay attention to what happens to the carbon atoms. How many ATP molecules are created per one cycle turn? What number of NADH and FADH2 molecules are generated?
Learn more about Carbon here:
https://brainly.com/question/13990654
#SPJ4
Fill in the SI unit for each of the following measurements. 1: Time: ___ 2. Length:___ 3. Mass:___ 4. Temperature___
the si unit for time is second
the si unir for length is meter
the si unit for mass is kilogram
the si unit for temperature is kelvin
1: Time: second 2. Length: meter 3. Mass: kilogram 4. Temperature kelvin are the SI units of measurements.
What do you mean by SI unit of measurements?
It is unit of the standard of reference which is chosen to measure any type of physical quantity.
SI Units of Measurements is the system which stands for the international system of unit.
The SI, uses standard symbols, units and abbreviations, developed by the Bureau International.
The SI unit of mass is the kilogram, length is a meter, time is second, temperature is kelvin, electric current is ampere, amount of substance is mole, luminous intensity is candela.
SI unit has a huge amount of application universally in both technical and scientific research to avoid the confusion.
This system is important as it helps the entire world to understand the measurements in one set of unit systems.
Learn more about SI unit, here:
https://brainly.com/question/12750330
#SPJ2
Which factor can cause acceleration to decrease?
How do the substances compare?
Just as all the organs in a system work together, the various body
systems work together in a healthy person. Can you think of an
example of two systems and how they work together? Explain
your ideas.
Answer:
the lungs and heart give oxygen to the cells and the sensory system gives messages to the brain
Explanation:
Identify 10 different organisms in your community and classify them as prokaryotes and eukaryotes
Here are some examples of common organisms and their classifications:
Bacteria - prokaryote
Archaea - prokaryote
Amoeba - eukaryote
Paramecium - eukaryote
Yeast - eukaryote
Mushroom - eukaryote
Fern - eukaryote
Pine tree - eukaryote
Earthworm - eukaryote
Human - eukaryote
Hope this helps!
Answer:
Here are some examples of common organisms and their classification
Explanation:
Bacteria - prokaryote
Archaea - prokaryote
Amoeba - eukaryote
Paramecium - eukaryote
Yeast - eukaryote
Mushroom - eukaryote
Fern - eukaryote
Pine tree - eukaryote
Earthworm - eukaryote
Human - eukaryote
Hope this helps!
The reactants of a chemical reaction that releases heat have ___ potential energy than the products of that chemical reaction
The reactants of a chemical reaction that releases heat have more potential energy than the products of that chemical reaction. A chemical reaction is a process in which one or more substances are transformed into one or more new substances. When a chemical reaction occurs, it involves the conversion of energy, which can be in the form of heat, light, or electrical energy.
Chemical reactions are classified into two types based on their energy transfer: exothermic and endothermic.
In exothermic reactions, the reactants of a chemical reaction that releases heat have more potential energy than the products of that chemical reaction. This is because during the exothermic reaction, energy is released as heat from the system to the surroundings. This energy released as heat comes from the potential energy stored in the chemical bonds of the reactants, which is then converted into kinetic energy of the surroundings. The products of an exothermic reaction have less potential energy than the reactants because some of the potential energy is converted into kinetic energy in the form of heat.
To know more about potential energy visit:
https://brainly.com/question/24284560
#SPJ11
An orange solid cannot be broken down into simpler components by any physical methods. When it is heated, a chemical reaction takes place and a colorless gas and a silvery liquid form. Further tests on the resulting substances shows that they cannot be broken down further by physical or chemical methods. What type of substance is the original orange solid?.
When heated, it undergoes a chemical reaction that results in the formation of a colorless vapor and a silvery liquid. Then the original orange solid is a material of an element type.
An activity that results in the chemical conversion of one group of chemical compounds into another is known as a chemical reaction. Chemical reactions are changes that traditionally only affect the locations of electrons in the formation and breakage of chemical bonds between atoms, with no change to the nuclei (i.e., the elements present). These changes are generally captured by a chemical equation. Chemical reactions between unstable and radioactive materials, where both electronic and nuclear changes may take place, are the focus of the subfield of chemistry known as nuclear chemistry.
Reactants or reagents are the material(s) that are initially incorporated into a chemical reaction. A chemical change is typically what distinguishes chemical reactions from other types of processes, and they produce one or more products with typically distinct features.
Learn more about chemical reaction here:
https://brainly.com/question/22817140
#SPJ4
Calculate the H3O+/OH- ratio for solutions of your choice using all three values: the Molecule count, Quantity of moles, and Concentration Show your work
-water
-one base
-one acid
H3O+ and OH- ion concentrations in water are equivalent at 25 °C and have a value of 1.0 x 10-7 M each.
What is the bond between OH and H3O+?In general, a material will be an acid if [H3O+] > [OH]. Moreover, the substance will be a base if [OH] > [H3O+]. We are aware that neutral compounds do exist, though. When this occurs, [H3O+] = [OH].
What are the pH and hydronium ion concentrations of pure water at 25 C?Kw equals 1.011014 at 25 °C, therefore pH+pOH=pKw=14.00. Because the reaction is endothermic, the concentrations of the hydronium ion and hydroxide ion that occur from ionisation grow with temperature.
To know more about concentrations visit:-
https://brainly.com/question/10725862
#SPJ1
What is the contour rule or global rule in chemistry, and how is it used to determine the stereochemistry of a molecule?
a. The contour or global rule in chemistry is a principle used to determine the stereochemistry of a molecule.
b. The contour rule is used in conjunction with other principles of stereochemistry to determine the overall shape of a molecule and the arrangement of its constituent atoms in space.
The contour rule or global rule states that the three-dimensional arrangement of atoms in a molecule can be determined by examining the sequence of atoms along the longest chain of carbon atoms, and the direction of the bond connecting each atom to its neighbor. If the sequence of atoms along the longest chain of carbon atoms is arranged in a clockwise direction, the molecule is said to have R-configuration (from the Latin word rectus, meaning right). If the sequence is arranged in a counterclockwise direction, the molecule is said to have S-configuration (from the Latin word sinister, meaning left).
Learn more about contour rule: https://brainly.com/question/1253547
#SPJ11
glyphosate is a common compound found in many herbicides. why was it thought to have no effect on human health before recent scientific studies?
Glyphosate was initially thought to have no effect on human health because it primarily targets enzymes found only in plants and bacteria, not humans.
Additionally, the compound was believed to have a low toxicity level and was considered to be safe when used according to the labeled instructions.
However, recent scientific studies have suggested potential health risks associated with glyphosate exposure, including links to cancer and other health issues.
These studies have prompted further investigation and controversy surrounding the safety of glyphosate in herbicides.
To know more about Glyphosate, refer here:
https://brainly.com/question/30628930#
#SPJ11
If, per se, juice is denser than water how do they mix?
What do the horizontal portions of the graph represent? When heat is added to or removed from the substance and the temperature remains the same, where is the thermal energy going? Why?
,SJhfgaiuehrg;oiaerhgoaw
?
Answer:
nah man
Explanation:
What dicarbonyl compound is needed to prepare the following compound by an intramolecular aldol reaction?.
The given compound has a cyclic structure, indicating that it was formed by an intramolecular aldol reaction. The reactant in this reaction would be a dicarbonyl compound.
One possible dicarbonyl compound that could be used in this reaction is 3-oxo heptane dioic acid, also known as beta-ketoglutaric acid. This compound has a cyclic structure with two carbonyl groups that can undergo aldol condensation and cyclization to form a six-membered ring. The resulting product would have a similar structure to the given compound.
To know more about compound visit :
https://brainly.com/question/13516179
#SPJ11
What will most likely happen when a component is removed from a reaction system at equilibrium?
A. The system will be unaffected by stress.
B. The addition of a catalyst will change the equilibrium.
C. The equilibrium system will shift to remove more of what was removed.
D. The equilibrium system will shift to replace some of what was removed.
When a component is removed from a reaction system at equilibrium, the equilibrium system will shift to replace some of what was removed.
Le Catelier's principleIt states that when a reaction is in equilibrium and one of the factors that affect the rate of reactions is applied, the equilibrium will shift to neutralize the effects of the constraint.
Every equilibrium system obeys Catelier's principle.
Thus, removing one of the components in a reaction that is in equilibrium will make the equilibrium shift to create more of the component being removed.
More on equilibrium can be found here: https://brainly.com/question/15118952
Answer:
D : The equilibrium system will shift to replace some of what was removed.
Explanation:
A chemist combines 300 mL of a 0.3 M Na2SO4 solution with 200 mL of 0.4 M BaCl2 solution. How many grams of precipitate form
The mass of the precipitate, BaSO₄ obtained from the given reaction is 18.64 grams
How to determine the mole Na₂SO₄Volume of Na₂SO₄ = 300 mL = 300 / 1000 = 0.3 LMolarity of Na₂SO₄ = 0.3 MMole of Na₂SO₄ =?Mole = Molarity x Volume
Mole of Na₂SO₄ = 0.3 × 0.3
Mole of Na₂SO₄ = 0.09 mole
How to determine the mole of BaCl₂Volume of BaCl₂ = 200 mL = 200 / 1000 = 0.2 LMolarity of BaCl₂ = 0.4 MMole of BaCl₂ =?Mole = Molarity x Volume
Mole of BaCl₂ = 0.4 × 0.2
Mole of BaCl₂ = 0.08 mole
How to determine the limiting reactantBalanced equation
Na₂SO₄(aq) + BaCl₂(aq) —> BaSO₄(s) + 2NaCl(aq)
From the balanced equation above,
1 mole of BaCl₂ reacted with 1 mole of Na₂SO₄.
Therefore,
0.08 mole of BaCl₂ will also react with 0.08 mole of Na₂SO₄.
From the above illustration, we can see that only 0.08 mole of Na₂SO₄ out of 0.09 mole given is neede to react completely with 0.08 mole of BaCl₂.
Therefore, BaCl₂ is the limiting reactant
How to determine the mass of the precipitate (BaSO₄) formedBalanced equation
Na₂SO₄(aq) + BaCl₂(aq) —> BaSO₄(s) + 2NaCl(aq)
From the balanced equation above,
1 mole of BaCl₂ reacted to produce 1 mole of BaSO₄.
Therefore,
0.08 mole of BaCl₂ will also react to produce 0.08 mole of BaSO₄.
The mass of BaSO₄ can be obtained as follow
Mole of BaSO₄ = 0.08 mole Molar mass of BaSO₄ = 137 + 32 + (16×4) = 233 g/mol Mass of BaSO₄ =?Mass = mole × molar mass
Mass of BaSO₄ = 0.08 × 233
Mass of BaSO₄ = 18.64 g
Learn more about stoichiometry:
https://brainly.com/question/14735801
which substances corrode copper?
The table shows a list of Period 2 elements. Determine the number of valence
electrons for carbon, C.
A. 3
B. 1
OC. 2
OD. 4
Element
Li
Be
B
C
N
Number of Valence
Electrons
1
3
We can see that the table is for the elements that are in period 2. The valence electrons for carbon are 4. Option D
What are valence electrons?Valence electrons are the electrons located in the outermost energy level or shell of an atom. They are the electrons involved in chemical bonding between atoms, and their number determines the chemical properties of an element.
The valence electrons are responsible for the formation of chemical bonds and determine how many bonds an atom can form.
Learn more about valence electron:https://brainly.com/question/28977387
#SPJ1
In a phospholipid molecule, ____________ usually binds to a charged organic molecule, such as choline or the amino acid serine.
In a phospholipid molecule, the charged organic molecule that usually binds is choline or the amino acid serine.
Choline is a hydrophilic (water-loving) molecule that contains a positively charged quaternary ammonium group. It forms an electrostatic interaction with the negatively charged phosphate group on the phospholipid molecule. This interaction helps to stabilize the overall structure of the phospholipid bilayer, as choline is attracted to the polar, hydrophilic head region of the phospholipid.
Similarly, the amino acid serine can also bind to the phospholipid molecule. Serine is a hydrophilic molecule that contains a hydroxyl group. This hydroxyl group can form hydrogen bonds with the phosphate group on the phospholipid, aiding in the stabilization of the phospholipid bilayer.
These interactions between the charged organic molecules, such as choline or serine, and the phospholipid molecule are crucial for the formation and stability of cell membranes. The phospholipid bilayer is the basic structural component of cell membranes, providing a selectively permeable barrier that separates the internal cellular environment from the external surroundings. The binding of choline or serine to the phospholipid molecule helps to maintain the integrity and functionality of the cell membrane.
To know more about Choline, refer to the link below:
https://brainly.com/question/32244356#
#SPJ11
In a phospholipid molecule, the charged organic molecule that usually binds is choline or the amino acid serine.
Choline is a hydrophilic (water-loving) molecule that contains a positively charged quaternary ammonium group. It forms an electrostatic interaction with the negatively charged phosphate group on the phospholipid molecule. This interaction helps to stabilize the overall structure of the phospholipid bilayer, as choline is attracted to the polar, hydrophilic head region of the phospholipid.
Similarly, the amino acid serine can also bind to the phospholipid molecule. Serine is a hydrophilic molecule that contains a hydroxyl group. This hydroxyl group can form hydrogen bonds with the phosphate group on the phospholipid, aiding in the stabilization of the phospholipid bilayer.
These interactions between the charged organic molecules, such as choline or serine, and the phospholipid molecule are crucial for the formation and stability of cell membranes. The phospholipid bilayer is the basic structural component of cell membranes, providing a selectively permeable barrier that separates the internal cellular environment from the external surroundings. The binding of choline or serine to the phospholipid molecule helps to maintain the integrity and functionality of the cell membrane.
To know more about Choline, refer to the link below:
brainly.com/question/32244356#
#SPJ11
Why might a geologist ask an analytical chemist to help identify the minerals in a rock.
A geologist would ask the analytical chemist to identify the rock's composition. Chemists gather data from afar and analyze matter back to earth.
Who is a geologist ?A geologist is a scientist who focuses on the processes that shape terrestrial planets and the solid, liquid, and gaseous stuff that makes up Earth. Although training in physics, chemistry, biology, and other sciences are sometimes helpful, geologists typically pursue geology as their field of study. Geology includes a significant amount of field study (field work), even if many of its subdisciplines also involve laboratory and computer work.
Geologists look for natural resources like oil, gas, precious and base metals in the energy and mining industries. They are also in the vanguard of efforts to prevent and lessen the effects of natural disasters and hazards like earthquakes, volcanoes, tsunamis, and landslides.
To learn more about geologist from the given link:
brainly.com/question/25762503
#SPJ4
draw the structural formula of 3-ethoxy-2-methylhexane.
The structural formula of 3-ethoxy-2-methylhexane can be written as CH3CH(CH3)CH(CH3)CH2CH2OCH2CH3. In this molecule, there is a six-carbon chain that contains two methyl groups and an ethoxy group. The ethoxy group is attached to the third carbon atom of the chain, while the methyl groups are attached to the second and fourth carbon atoms. The remaining two carbon atoms are attached to the fifth and sixth positions respectively.
The molecule is named as 3-ethoxy-2-methylhexane since the ethoxy group is attached to the third carbon atom of the hexane chain.
The total number of carbon atoms in the molecule is six, which gives it the name of hexane. Overall, 3-ethoxy-2-methylhexane is an organic compound that is used in various industrial applications.
Hi! I'm happy to help you understand the structural formula of 3-ethoxy-2-methylhexane. First, let's break down the name to identify the components of the molecule:
- "Hexane" is the base structure, indicating a six-carbon alkane chain.
- "3-ethoxy" means that an ethoxy group (CH3CH2O-) is attached to the third carbon atom in the hexane chain.
- "2-methyl" indicates a methyl group (CH3) attached to the second carbon atom in the hexane chain.
Now, let's construct the structural formula:
CH3-CH(CH3)-CH(OCH2CH3)-CH2-CH2-CH3
In this formula:
- The hexane chain is represented by the sequence of CH3, CH, CH, CH2, CH2, and CH3.
- The methyl group (CH3) is attached to the second carbon atom, indicated by the CH in parentheses.
- The ethoxy group (OCH2CH3) is attached to the third carbon atom, shown within the parentheses of the CH(OCH2CH3) part.
I hope this helps you understand the structural formula of 3-ethoxy-2-methylhexane! If you have any more questions, feel free to ask.
commonly boiling stones are added to a solution during reflux. what purpose do they serve?
Boiling stones prevent the solution from boiling too violently during reflux.
During reflux, a solution is continuously heated and cooled to promote the reaction. Boiling stones, also known as boiling chips or anti-bumping granules, are added to the solution to prevent the liquid from boiling too violently. This is because when a liquid reaches its boiling point, it can form bubbles of gas that rapidly rise to the surface and burst, causing the liquid to splatter and potentially spilling out of the reaction vessel.
Boiling stones provide nucleation sites for the bubbles to form, allowing for a gentler and more controlled boiling. They also increase the surface area of the liquid, which can improve heat transfer and promote a more efficient reflux. Common boiling stones include pieces of porcelain, glass, or silicon carbide, which are non-reactive and inert to most chemicals.
Learn more about heat transfer here:
https://brainly.com/question/31065010
#SPJ11
What is this common laboratory equipment called and what is its purpose
Answer:This is a Flint lighter, It's usually used to make sparks to light things like burners in chemistry.
Explanation:
When atoms that have different electronegativities bond together, there will be a __________ probability of finding the electrons on the side of the molecule that has the atom with the higher electronegativity.
When atoms that have different electronegativities bond together, there will be a low probability of finding the electrons on the side of the molecule that has the atom with the higher electronegativity.
An atom is defined as the smallest unit of matter which forms an element. Every form of matter whether solid,liquid , gas consists of atoms . Each atom has a nucleus which is composed of protons and neutrons and shells in which the electrons revolve.
The protons are positively charged and neutrons are neutral and hence the nucleus is positively charged. The electrons which revolve around the nucleus are negatively charged and hence the atom as a whole is neutral and stable due to presence of oppositely charged particles.
Learn more about atoms,here:
https://brainly.com/question/1566330
#SPJ1
How long does it take for a fertilized egg to implant?.
After fertilization, the egg takes about 6-10 days to move down to the uterus and implant in the uterine lining. The implantation process is a crucial aspect of the early stages of pregnancy, and it typically occurs between days 6 and 10 after fertilization.
Implantation is a critical step in pregnancy because it is the first stage in the process of fetal development. The egg needs to implant in the uterus for the developing embryo to receive nutrients and oxygen. If implantation doesn't occur, the embryo will not be able to survive, and the body will naturally terminate the pregnancy.
In conclusion, the process of implantation takes between 6-10 days, and it's a critical step in pregnancy. It's the first stage in the process of fetal development and is necessary for the embryo to receive nutrients and oxygen. If implantation doesn't occur, the body will naturally terminate the pregnancy.
To know more about fertilization visit:
https://brainly.com/question/32111086
#SPJ11